Skip to main content

Bartleby Sitemap - Textbook Solutions

All Textbook Solutions for Chemistry: Matter and Change

28PP 29SSC 30SSC 31SSC 32SSC 33SSC 34SSC 35PP 36PP 37PP 38PP 39PP 40PP 41PP 42PP 43PP 44PP 45PP 46PP 47PP 48PP 49PP 50SSC 51SSC 52SSC 53SSC 54SSC 55SSC 56SSC 83A 84A 85A 86A 87A 88A 89A Determine the number of representative particles in each substance. a. 0.250molofsilver b. 8.5610-3molofsodiumchloride c. 35.3molofcarbondioxide d. 0.425molofnitrogen(N2)Determine the number of representative particles in each substance. a. 4.45 molOf C6H12O6 c. 2.24 mol Of H2 b. 0.250 mol of KNO3 d. 9.56 mol of Zn 92A Determine the number of moles in each substance. a. 3.251020 atoms of lead b. 4.961024 molecules ofglucose c. 1.561023 formula units of sodium hydroxide d. 1.251025 copper(II) ions 94A 95A RDA of Selenium The recommended daily allowance (RDA) of selenium in your diet is 8.87104 mol. How many atoms of selenium is this?97A 98A 99A 100A 101A 102A 103A 104A 105A 106A 107A Calculate the mass of each element. a. 5.22 mol of He b. 0.0455 mol of Ni c. 2.22 mol of Ti d. 0.00566 mol of Ge Perform the following conversions. a. 3.50 mol of LitogofLi b. 7.65 g of Co to mol of Co c. 5.62 gofKrto mol ofKr d. 0.0550 mol of As to g of As Determine the mass in grams of each element. 1.331022molofSb 4.751014molofPt 1.221023molofAg 9.851024molofCr Complete Table 10.3.Convert each to mass in grams. a. 4.221015 atoms c b. 8.651025 atoms H c. 1.251022 atoms O d. 4.441023 atoms Pb 113A 114A 115A 116A 117A 118A 119A 120A 121A 122A 123A 124A 125A 126A 127A 128A 129A 130A 131A 132A 133A 134A 135A 136A 137A 138A 139A 140A 141A 142A 143A 144A 145A 146A 147A Pain Relief Acetaminophen, a common aspirin substitute, has the formula C8H9NO2 . Determine the number of molecules of acetaminophen in a 500-mg tablet.149A 150A 151A 152A 153A 154A 155A 156A 157A 158A 159A 160A 161A 162A Express the composition of each compound as the mass percent of its elements (percent composition). a. sucrose (C12H22O11) c. magnetite (Fe3O4) b. aluminum sulfate (Al2(SO4)3)VitaminD3 Your body's ability to absorb calcium is aided by vitamin Chemical analysis of vitamin yields the data shown in Figure 10.22. What are the empirical and molecular formulas for vitamin D3 ?165A Cholesterol Heart disease is linked to high blood cholesterol levels. What is the percent composition of the elements in a molecule of cholesterol (C27H45OH) ?167A 168A 169A 170A 171A 172A 173A 174A 175A 176A 177A 178A 179A Determine the mass percent of anhydrous sodium carbonate (Na2CO3) and water in sodium carbonate decahydrate (Na2CO310H2O) .Table 4 shows data from an experiment to determine the formulas of hydrated barium chloride. Determine the formula for the hydrate and its name.Chromium(lll) nitrate forms a hydrate that is 40.50% water by mass. What is its chemical formula?Determine the percent composition of MgCO35H2O and draw a pie graph to represent the hydrate.What is the formula and name of a hydrate that is 85.3% barium chloride and 14.7% water?Gypsum is hydrated calcium sulfate. A 4.89-g sample of this hydrate was heated. After the water was removed, 3.87 g anhydrous calcium sulfate remained. Determine the formula for this hydrate and name the compound.A 1.628-g sample of a hydrate of magnesium iodide is heated until its mass is reduced to 1.072 g and all water has been removed. What is the formula of the hydrate?Borax Hydrated sodiumtetraborate (Na2B4O7xH2O) is commonly called borax. Chemical analysis indicates that this hydrate is 52.8% sodium tetraborate and 47.2% water. Determine the formula and name the hydrate.188A 189A 190A 191A 192A 193A 194A 195A 196A 197A 198A 199A 200A 201A 202A 203A 204A 205A 206A 207A 208A 209A 210A 211A 212A 213A 214A 215A 216A 1STP 2STP 3STP 4STP 5STP 6STP 7STP 8STP 9STP 10STP 11STP 12STP 13STP 14STP 15STP 16STP 1PP 2PP 3PP 4PP 5PP 6PP 7SSC 8SSC 9SSC 10SSC 11SSC 12SSC 13SSC 14SSC 15PP 16PP 17PP 18PP 19PP 20PP 21PP 22SSC 23SSC 24SSC 25SSC 26SSC 27SSC 28SSC 29PP 30PP 31PP 32PP 33PP 34PP 35PP 36PP 37PP 38PP 39PP 40PP 41PP 42PP 43PP 44PP 45PP 46PP 47SSC 48SSC 49SSC 50SSC 51SSC 52SSC 53SSC 54PP 55PP 56PP 57PP 58PP 59PP 60PP 61PP 62PP 63PP 64PP 65PP 66PP 67SSC 68SSC 69SSC 70SSC 71SSC 72SSC 73SSC 74PP 75PP 76SSC 77SSC 78SSC 79SSC 80SSC 81SSC 82SSC 36A 37A 38A 39A 40A 41A 42A 43A Interpret the following equation in terms of particles, moles, and mass. 4Al(s)+3O2(g)2Al2O3(s)Smelting When tin(IV) oxide is heated with carbon in a process called smelting, the element tin can be extracted. SnO2(s)+2C(s)Sn(l)+2CO(g) Interpret the chemical equation in terms of particles, moles, and mass.When solid copper is added to nitric acid, copper (ll) nitrate, nitrogen dioxide, and water are produced. Write the balanced chemical equation for the reaction. List six mole ratios for the reaction.When hydrochloric acid solution reacts with lead (ll) nitrate solution, lead (Il) chloride precipitates and a solution Of nitric acid is produced. a. Write the balanced chemical equation for the reaction. b. Interpret the equation in terms of molecules and formula units, moles, and mass.When aluminum is mixed with iron(lll) oxide, iron metal and aluminum oxide are produced, along with a large quantity of heat. What mole ratio would you use to determine moles of Fe if moles of Fe2O3 is known? Fe2O3(s)+2A1(s)2Fe(s)+A12O3(s)+heat Solid silicon dioxide, often called silica, reacts with hydrofluoric acid (HF) solution to produce the gas silicon tetrafluoride and water. a. Write the balanced chemical equation for the reaction. b. List three mole ratios, and explain how you would use them in stoichiometric calculations.50A 51A 52A Antacids Magnesium hydroxide is an ingredient in some antacids. Antacids react with excess hydrochloric acid in the stomach to relieve indigestion. Mg(OH)2+HClMgCl2+H2O a. Balance the reaction of Mg(OH)2 with HCI. b. Write the mole ratio that would be used to determine the number of moles of MgCl2 produced when HCI reacts with Mg(OH)2 .54A 55A 56A 57A 58A 59A Ethanol (C2H5OH) , also known as grain alcohol, can be made from the fermentation of sugar C6H12O6 .The unbalanced chemical equation for the reaction is shown below. C6H12O6C2H5OH+CO2 Balance the chemical equation and determine the mass of C2H5OH produced from 750 g of C6H12O6 .Welding If 5.50 mol of calcium carbide (CaC2) reacts with an excess of water, how many moles of acetylene (C2H2) , a gas used in welding, will be produced? CaC2(s)+2H2O(l)Ca(OH)2(aq)+C2H2(g)62A 63A 64A 65A 66A 67A 68A 69A 70A 71A 72A 73A 74A

Page: [1][2][3][4][5][6][7][8][9][10][11]