![Organic Chemistry](https://www.bartleby.com/isbn_cover_images/9781305080485/9781305080485_largeCoverImage.gif)
Concept explainers
The antipsychotic drug flupentixol is prepared by the following scheme:
![Check Mark](/static/check-mark.png)
a)
The alkyl chloride, structure of D has to be identified and R and S configuration has to be assigned for the products.
Concept introduction:
R and S nomenclature: it is used to assign the molecule using CIP rules.
The CIP rules are as follows:
Select the chiral carbon and assign the numbers according to the decreasing atomic mass of atoms attached to it.
If the numbering follows clockwise direction then the molecule is termed as R and if it follows anti-clockwise direction then molecule is termed as S.
Chiral: A molecule is non superimposable on its mirror image is called chiral molecule.
Four different atoms attached to a carbon atom is called chiral molecule.
Isomer: A molecule having the same molecular formula but with different chemical structure is called isomer.
Stereoisomers: Stereoisomers are molecules that have the same molecular formula and they differ only in arrangement of atom in three-dimensional space.
Enantiomers: A compound which is non-superimposable mirror image is called enantiomers.
Diastereomers: A compound which is non-superimposable and non-mirror image is called diastereomers.
Racemic mixture: A racemic mixture is simply a mixture containing an equal amount of each enantiomer.
Achiral: A molecule is superimposable on its mirror image is called achiral molecule.
Answer to Problem 81AP
The reaction is given below,
Explanation of Solution
Given information:
The given reactant shown below,
The given compound (A) reacts with chloro propanol gives the compound (C).
The reaction is given below,
The alkyl chloride, structure of D is given and R and S configuration is assigned for the products.
![Check Mark](/static/check-mark.png)
b)
Interpretation:
The alkyl chloride, structure of D has to be identified and R and S configuration has to be assigned for the products.
Concept introduction:
R and S nomenclature: it is used to assign the molecule using CIP rules.
The CIP rules are as follows:
Select the chiral carbon and assign the numbers according to the decreasing atomic mass of atoms attached to it.
If the numbering follows clockwise direction then the molecule is termed as R and if it follows anti-clockwise direction then molecule is termed as S.
Chiral: A molecule is non superimposable on its mirror image is called chiral molecule.
Four different atoms attached to a carbon atom is called chiral molecule.
Isomer: A molecule having the same molecular formula but with different chemical structure is called isomer.
Stereoisomers: Stereoisomers are molecules that have the same molecular formula and they differ only in arrangement of atom in three-dimensional space.
Enantiomers: A compound which is non-superimposable mirror image is called enantiomers.
Diastereomers: A compound which is non-superimposable and non-mirror image is called diastereomers.
Racemic mixture: A racemic mixture is simply a mixture containing an equal amount of each enantiomer.
Achiral: A molecule is superimposable on its mirror image is called achiral molecule.
Answer to Problem 81AP
The Grignard reagent is given below,
Explanation of Solution
Given information:
The given reactant shown below,
The Grignard reagent is given below,
The compound (c) reaction with thionyl chloride gives chlorinated compound, then it is reacting with magnesium gives the Grignard reagent (D).
The alkyl chloride, structure of D is given and R and S configuration is assigned for the products.
![Check Mark](/static/check-mark.png)
c)
Interpretation
The alkyl chloride, structure of D has to be identified and R and S configuration has to be assigned for the products.
Concept introduction:
R and S nomenclature: it is used to assign the molecule using CIP rules.
The CIP rules are as follows:
Select the chiral carbon and assign the numbers according to the decreasing atomic mass of atoms attached to it.
If the numbering follows clockwise direction then the molecule is termed as R and if it follows anti-clockwise direction then molecule is termed as S.
Chiral: A molecule is non superimposable on its mirror image is called chiral molecule.
Four different atoms attached to a carbon atom is called chiral molecule.
Isomer: A molecule having the same molecular formula but with different chemical structure is called isomer.
Stereoisomers: Stereoisomers are molecules that have the same molecular formula and they differ only in arrangement of atom in three-dimensional space.
Enantiomers: A compound which is non-superimposable mirror image is called enantiomers.
Diastereomers: A compound which is non-superimposable and non-mirror image is called diastereomers.
Racemic mixture: A racemic mixture is simply a mixture containing an equal amount of each enantiomer.
Achiral: A molecule is superimposable on its mirror image is called achiral molecule.
Answer to Problem 81AP
The pair of enantiomers is given below,
Explanation of Solution
Given information:
The given reactant shown below,
The pair of enantiomers is given below,
The compound (D) reaction with compound (E) gives enantiomer of corresponding products.
The alkyl chloride, structure of D is given and R and S configuration is assigned for the products.
![Check Mark](/static/check-mark.png)
d)
Interpretation:
The alkyl chloride, structure of D has to be identified and R and S configuration has to be assigned for the products.
Concept introduction:
R and S nomenclature: it is used to assign the molecule using CIP rules.
The CIP rules are as follows:
Select the chiral carbon and assign the numbers according to the decreasing atomic mass of atoms attached to it.
If the numbering follows clockwise direction then the molecule is termed as R and if it follows anti-clockwise direction then molecule is termed as S.
Chiral: A molecule is non superimposable on its mirror image is called chiral molecule.
Four different atoms attached to a carbon atom is called chiral molecule.
Isomer: A molecule having the same molecular formula but with different chemical structure is called isomer.
Stereoisomers: Stereoisomers are molecules that have the same molecular formula and they differ only in arrangement of atom in three-dimensional space.
Enantiomers: A compound which is non-superimposable mirror image is called enantiomers.
Diastereomers: A compound which is non-superimposable and non-mirror image is called diastereomers.
Racemic mixture: A racemic mixture is simply a mixture containing an equal amount of each enantiomer.
Achiral: A molecule is superimposable on its mirror image is called achiral molecule.
Answer to Problem 81AP
The compound (F) undergoes hydrolysis reaction gives E and Z isomers of corresponding products.
Explanation of Solution
Given information:
The given reactant shown below,
The compound (F) undergoes hydrolysis reaction gives E and Z isomers of corresponding products.
The alkyl chloride, structure of D is given and R and S configuration is assigned for the products.
Want to see more full solutions like this?
Chapter 11 Solutions
Organic Chemistry
- Compound H (C8H6O3) gives a precipitate when treated with hydroxylamine in aqueous ethanol and a silver mirror when treated with Tollens solution. Following is its 1H-NMR spectrum. Deduce the structure of compound H.arrow_forwardFollowing is the structural formula of Surfynol, a defoaming surfactant. Describe the synthesis of this compound from acetylene and a ketone. How many stereoisomers are possible for Surfynol?arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.arrow_forward
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.arrow_forwardCompound X (molecular formula C10H12O) was treated with NH2NH2,−OH to yield compound Y (molecular formula C10H14). Based on the 1H NMR spectra of X and Y given below, what are the structures of X and Y?arrow_forwardA synthetic organic molecule, G, which contains both aldehyde and ether functional groups, is subjected to a series of reactions in a multi-step synthesis pathway. In the first step, G undergoes a Wittig reaction, leading to the formation of an alkene, H. Subsequently, H is treated with an ozone (O3) reagent followed by a reducing agent in an ozonolysis reaction, resulting in the formation of two different products, I and J. Considering the functional groups present in G and the nature of the reactions involved, what are the most probable structures or functional groups present in products I and J? A. I contains a carboxylic acid group, and J contains an aldehyde group. B. I contains a ketone group, and J contains an alcohol group. C. I and J both contain aldehyde groups. D. I contains an ester group, and J contains a ketone group. Don't use chat gpt.arrow_forward
- Predict the products formed when cyclohexanone reacts with the following reagents. h) sodium acetylide, then mild H3O+arrow_forwardWhen acetonitrile is treated with concentrated sulfuric acid and tert-butanol, followed by water, a product is formed whose 'H NMR spectrum exhibits the following three signals: singlet, 1.3 ppm, 9 H; singlet, 2.0 ppm, 3 H; and broad singlet, 8.2 ppm, 1 H. Its IR spectrum exhibits one broad absorption of medium intensity between 3300 and 3500 cm-1, and a narrow, intense absorption near 1650 cm¯1. A key intermediate is shown. Draw the structure of the product, and draw the complete, detailed mechanism for the reaction. CH3 CH3 H2SO4 (conc) H2O ? + H3C H3C H3C-C=Ñ-c `CH3 CH3 HOarrow_forwardCompound A undergoes an acid-catalyzed hydrolysis. One of the products (B) that is isolated gives the following 1H NMR spectrum. Identify the compounds A and Carrow_forward
- A compound has the molecular formula C6H12O2. Its IR spectrum shows a strong absorption band near 1740 cm-1. Its 1H NMR spectrum consists of two singlets at δ 1.2 and δ 3.6. Which is the most likely structure of the compound?arrow_forwardPhenacetin is an analgesic compound having molecular formula C10H13NO2. Once a common component in over-thecounter pain relievers such as APC (aspirin, phenacetin, caffeine), phenacetin is no longer used because of its liver toxicity. Deduce the structure of phenacetin from its 1H NMR and IR spectra.arrow_forwardA dialkyl-substituted benzene, C14H22, is treated with basic potassium permanganate, followed by acid workup. The same dialkyl-substituted benzene was recovered afterward from the reaction mixture. Draw the structure of the compound.arrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage Learning
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305080485/9781305080485_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305580350/9781305580350_smallCoverImage.gif)