(a)
Interpretation:
The effect of addition of
Concept introduction:
Le Chatelier's principle states that if a system in equilibrium gets disturbed due to modification of concentration, temperature, volume, and pressure, then it reset to counteract the effect of disturbance.
(b)
Interpretation:
The effect of addition of
Concept introduction:
Le Chatelier's principle states that if a system in equilibrium gets disturbed due to modification of concentration, temperature, volume, and pressure, then it reset to counteract the effect of disturbance.
(c)
Interpretation:
The effect of addition of water in given reaction results in change in concentration of
Concept introduction:
Le Chatelier's principle states that if a system in equilibrium gets disturbed due to modification of concentration, temperature, volume, and pressure, then it reset to counteract the effect of disturbance.
(d)
Interpretation:
The effect of increase in temperature of given reaction results in change in concentration of
Concept introduction:
Le Chatelier's principle states that if a system in equilibrium gets disturbed due to modification of concentration, temperature, volume, and pressure, then it reset to counteract the effect of disturbance.
Effect of change in temperature:
Endothermic reaction: In this reaction increase in temperature which is absorbed in reactant side, the reaction occurs in a way to relieve the stress in reactant side. The reaction occurs along the direction of product side and increases equilibrium constant.
Exothermic reaction: In this reaction increase in temperature which is released in product side, the reaction occurs in a way to relieve the stress in product side. The reaction occurs along the direction of reactant side and decreases equilibrium constant.
Want to see the full answer?
Check out a sample textbook solutionChapter 13 Solutions
General Chemistry: Atoms First
- Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?arrow_forwardSuppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?arrow_forwardDescribe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.arrow_forward
- Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?arrow_forwardWrite a chemical equation for an equilibrium system that would lead to the following expressions (ad) for K. (a) K=(PH2S)2 (PO2)3(PSO2)2 (PH2O)2 (b) K=(PF2)1/2 (PI2)1/2PIF (c) K=[ Cl ]2(Pcl2)[ Br ]2 (d) K=(PNO)2 (PH2O)4 [ Cu2+ ]3[ NO3 ]2 [ H+ ]8arrow_forwardAn equilibrium involving the carbonate and bicarbonate ions exists in natural waters: HCO5_(aq) «=* H+(aq) + COf-(aq) Assuming that the reactions in both directions are elementary' processes: Write rate expressions for the forward and reverse reactions. Write an expression for the equilibrium constant based on the rates of the forward and reverse reactions.arrow_forward
- At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?arrow_forwardShow that the complete chemical equation, the total ionic equation, and the net ionic equation for the reaction represented by the equation KI(aq)+I2(aq)KI3(aq) give the same expression for the reaction quotient. KI3 is composed of the ions K+ and I3-.arrow_forwardThe atmosphere consists of about 80% N2 and 20% O2, yet there are many oxides of nitrogen that are stable and can be isolated in the laboratory. (a) Is the atmosphere at chemical equilibrium with respect to forming NO? (b) If not, why doesnt NO form? If so, how is it that NO can be made and kept in the laboratory for long periods?arrow_forward
- The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?arrow_forwardConsider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12arrow_forwardMethanol, a common laboratory solvent, poses a threat of blindness or death if consumed in sufficient amounts. Once in the body, the substance is oxidized to produce formaldehyde (embalming fluid) and eventually formic acid. Both of these substances are also toxic in varying levels. The equilibrium between methanol and formaldehyde can be described as follows: CH3OH(aq)H2CO(aq)+H2(aq) Assuming the value of K for this reaction is 3.7 1010, what are the equilibrium concentrations of each species if you start with a 1.24 M solution of methanol? What will happen to the concentration of methanol as the formaldehyde is further converted to formic acid?arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningWorld of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning