Concept explainers
Interpretation:
The irons present in hemoglobin is either
Concept Introduction:
Electronic configuration: The electronic configuration is the distribution of electrons of an given molecule or respective atoms in atomic or molecular orbitals.
Paramagnetic: The Paramagnetic properties are due to the presence of unpaired electrons, and from the realignment of the electron paths caused by the external magnetic field.
Diamagnetic properties: In diamagnetic materials all the electron are paired so there is no permanent net magnetic moment per atom.
General electronic configuration of
Want to see the full answer?
Check out a sample textbook solutionChapter 7 Solutions
Chemistry & Chemical Reactivity
- Identify, based on the position in the periodic table, the actinide elements among those in the following list: Co, Cm, Cd, Ce, Cf.arrow_forwardWhat structural feature is used to determine whether a compound can exist as optical isomers?arrow_forwardPlatinum(II) forms many complexes, among them those with the following ligands. Give the formula and charge of each complex. (a) two ammonia molecules and one oxalate ion (C2O42-) (b) two ammonia molecules, one thiocyanate ion (SCN-), and one bromide ion (c) one ethylenediamine molecule and two nitrite ionsarrow_forward
- The addition of S2- ion to Fe(OH)2(s) results in the formation of FeS(s). Explain why the addition of S2- ion to Cr(OH)3(s) does not result in the formation of Cr2S3(s).arrow_forwardOne of the steps for refining silver involves converting silver into dicyanoargenate(I) ions: 4Ag(s) + 8CN−(aq) + O2(g) + 2H2O(l) ⟶ 4[Ag(CN)2]−(aq) + 4OH−(aq)Explain why oxygen must be present to carry out the reaction. Why does the reaction not occur as: 4Ag(s) + 8CN−(aq) ⟶ 4[Ag(CN)2−(aq)?arrow_forwardSolid Mg2B205 contains the "pyroborate" anion. Draw the structure for this ion. What are other isoelectronic species? asap please.arrow_forward
- CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds denoted A and B. When A is reacted with silver nitrate, 2/3 of the chlorine atoms precipitate. B, submitted to the same treatment, exhibits the precipitation of 1/3 of the present chlorine atoms. What are the spatial structures of complex ions A and B? (If necessary, draw their different stereoisomers).arrow_forward(a) Draw a Lewis dot and cross structure (including any lone pairs) for a NBr3 molecule and determine the shape of the molecule and number of valence electrons. (b) Six ammonia ligands form a complex ion with Co²+. What is the overall charge of the complex ion? Write the formula for the complex ion. What is the coordination number of the complex ion? Explain how ammonia ligands form a complex ion with Co²+? What is the geometry of the complex ion? Would you expect the complex to be coloured? Explain why? i. ii. iii. iv. V. vi.arrow_forwardThe compound [Fe(H2O)6]SO2 has a pale green color. The compound K4[Fe(CN)6] has a bright yellow color. Which of the following statements are NOT true? Select the correct answer below: A) The compound K4[Fe(CN)6] absorbs higher energy light. B) H2O produces a stronger ligand field than CN−. C) The compound K4[Fe(CN)6] is likely a low-spin complex because it contains strong-field ligands. D) The compound [Fe(H2O)6]SO2 is likely a high-spin complex because it contains weak-field ligands.arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning