Concept explainers
Interpretation:
Phenol is considerably stronger acid than cyclohexanol; the reason has to be proposed.
Concept Introduction:
Base and its conjugate Acid: A Base is a species that can gain a proton. When a base gains a proton
Electron delocalization stabilizes base: If a base has delocalized electrons, then the negative charge that results when the base’s conjugate acid loses a proton will belong to one atom. If a base has delocalized electrons, then the negative charge that results when the base’s conjugate acid loses a proton will be shared by two or more atoms. A base with delocalized electron is more stable than a similar base with localized electrons.
Effect of hybridization on Acidity: The electronegativity of an atom depends on its hybridization.
The stronger acid will have its proton attached to the more electronegative atom.
Trending nowThis is a popular solution!
Chapter 10 Solutions
Organic Chemistry
- Compare and explain the acidity of phenol, ethanol, acetic acid. (Using pKa, structures of conjugate base)arrow_forwardComplete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forwardAldehydes and ketones react with one molecule of an alcohol to form compounds called hemiacetals, in which there is one hydroxyl group and one ether-like group. Reaction of a hemiacetal with a second molecule of alcohol gives an acetal and a molecule of water. We study this reaction in Chapter 16. Draw structural formulas for the hemiacetal and acetal formed from these reagents. The stoichiometry of each reaction is given in the problem.arrow_forward
- Which combination of starting compounds should be chosen to prepare pentyl propanoate pentanoic acid and propanol pentanol and propanoic acid pentanol and pentanoic acid propanol and propanoic acidarrow_forwardWhich is more acidic, p-methylphenol or phenol? why? Why is water more acidic than ethanol but slightly less acidic than methanol? Explain the acidity trend of alcohols: 1>2 > 3arrow_forwardHow does resonance affect the acidity of a compound? Why is phenol more acidic in some alcohols and why is carboxylic acid more acidic?arrow_forward
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.arrow_forward
- Phenylethanol can be oxidised to phenylethanal or phenylethanoic acid, depending on the reagents used (both the alcohol and the aldehyde are of interest for their antimicrobial properties, while the acid is used to treat type II hyperammonemia): A (a) (b) (c) CoH,CH,CHO phenylethanal B C6H5CH₂CH₂OHC₂H₂CH₂CO₂H phenylethanol Suggest reagents (shown as A and B in the scheme above) that could be used to carry out the oxidation of the alcohol to the aldehyde and the acid, respectively. C6H5CH₂- Suggest two other syntheses of phenylethanoic acid, in each case indicating the starting materials and other reagents required, but not giving details of mechanism. One of your proposed syntheses must start with a compound which only contains seven carbon atoms (the acid product contains eight carbon atoms). phenylethanoic acid Phenylethanal can be converted to a hydrate in the presence of aqueous acid, though the position of equilibrium is very far to the left: H H+/H₂O OH C6H5CH₂-C-H OH Explain why…arrow_forwardHydration of aldehydes and ketones can be catalyzed by acid or base. Bases catalyze hydration by: protonating the carbonyl oxygen making the carbonyl group more electrophilic employing hydroxide ion, which is a better nucleophile than water making the carbonyl group less electrophilic shifting the equilibrium position of the reaction to favor productsarrow_forwardGive at least 5 examples of biological compounds having an ether functional group and identify the biochemical importance of each compound.arrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage LearningGeneral, Organic, and Biological ChemistryChemistryISBN:9781285853918Author:H. Stephen StokerPublisher:Cengage LearningOrganic And Biological ChemistryChemistryISBN:9781305081079Author:STOKER, H. Stephen (howard Stephen)Publisher:Cengage Learning,
- Organic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage LearningIntroduction to General, Organic and BiochemistryChemistryISBN:9781285869759Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar TorresPublisher:Cengage LearningChemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage Learning