Interpretation:
A cell with the electrodes of the same metal and solution of the same compound but with a different solution concentration is given. The relationships between cell potential, Gibbs free energy change and
Concept introduction:
Concentration difference leads to the spontaneous reaction in a concentration cell because a higher difference in concentration leads to positive cell potential and therefore, the change in Gibbs free energy comes out to be negative which means a spontaneous reaction. The Gibbs free energy change is the maximum work done therefore concentration difference will lead to the maximum work that can be obtained.
To determine: The type of cell formed by the electrodes of the same metal and solutions of the same compound, but at different concentration; the relationships among
Want to see the full answer?
Check out a sample textbook solutionChapter 17 Solutions
Bundle: Chemistry: An Atoms First Approach, Loose-leaf Version, 2nd + OWLv2 with Student Solutions Manual, 4 terms (24 months) Printed Access Card
- The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).arrow_forwardWhat is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?arrow_forwardAnother type of battery is the alkaline zinc-mercury cell, in which the cell reaction is Zn(s) + HgO(s) Hg() + ZnO(s) E = + 1.35 V (a) What is the standard free energy change for this reaction? (b) The standard free energy change in a voltaic cell is the maximum electrical energy that the cell can produce. If the reaction in a zinc-mercury cell consumes 1.00 g mercury oxide, what is the standard free energy change? (c) For how many hours could a mercury cell produce a 10-mA current if the limiting reactant is 3.50 g mercury oxide?arrow_forward
- A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.arrow_forwardAn aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?arrow_forwardConsider the following cell reaction at 25C. 2Cr(s)+3Fe2+(aq)2Cr3+(aq)+3Fe(s) Calculate the standard cell potential of this cell from the standard electrode potentials, and from this obtain G for the cell reaction. Use data in Appendix C to calculate H; note that Cr(H2O)63+(aq) equals Cr3+(aq). Use these values of H and G to obtain S for the cell reaction.arrow_forward
- Give the notation for a voltaic cell whose overall cell reaction is Mg(s)+2Ag+(aq)Mg2+(aq)+2Ag(s) What are the half-cell reactions? Label them as anode or cathode reactions. What is the standard cell potential of this cell?arrow_forwardUse the data from the table of standard reduction potentials in Appendix H to calculate the standard potential of the cell based on each of the following reactions. In each case, state whether the reaction proceeds spontaneously as written or spontaneously in the reverse direction under standard-state conditions. (a) H2(g)+Cl2(g)2H+(aq)+2Cl(aq) (b) Al3+(aq)+3Cr2+(aq)Al(s)+3Cr3+(aq) (c) Fe2+(aq)+Ag+(aq)Fe3+(aq)+Ag(s)arrow_forwardA voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?arrow_forward
- How is the pH scale defined? What range of pH values corresponds to acidic solutions? What range corresponds to basic solutions? Why is pH = 7.00 considered neutral? When the pH of a solution changes by one unit, by what factor does the hydrogen ion concentration change in the solution? How is pOH defined? How arc pH and pOH for a given solution related? Explain.arrow_forwardAt 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.arrow_forwardDetermine the overall reaction and its standard cell potential at 25 C for this reaction. Is the reaction spontaneous at standard conditions? Cu(s)|Cu2+(aq)Au3+(aq)|Au(s)arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoPrinciples of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning