Concept explainers
(a)
Interpretation: The given pairs of compounds are to be distinguished by performing suitable tests.
Concept introduction: The organic compounds are distinguishable with each other as they have different chemical properties. Due to their different
To determine: The distinguishable factor between the given pair of compound.
(b)
Interpretation: The given pairs of compounds are to be distinguished by performing suitable tests.
Concept introduction: The organic compounds are distinguishable with each other as they have different chemical properties. Due to their different functional groups, it is easy to distinguish organic compounds by performing different chemical tests like test for functional group, test for unsaturation and so on.
To determine: The distinguishable factor between the given pair of compound.
(c)
Interpretation: The given pairs of compounds are to be distinguished by performing suitable tests.
Concept introduction: The organic compounds are distinguishable with each other as they have different chemical properties. Due to their different functional groups, it is easy to distinguish organic compounds by performing different chemical tests like test for functional group, test for unsaturation and so on.
To determine: The distinguishable factor between the given pair of compound.
(d)
Interpretation: The given pairs of compounds are to be distinguished by performing suitable tests.
Concept introduction: The organic compounds are distinguishable with each other as they have different chemical properties. Due to their different functional groups, it is easy to distinguish organic compounds by performing different chemical tests like test for functional group, test for unsaturation and so on.
To determine: The distinguishable factor between the given pair of compound.
Trending nowThis is a popular solution!
Chapter 22 Solutions
Chemistry
- What is the condensed structural formula for 3,3-diethyl-2-methylhexane? A. CH3CH2CH(CH2CH3)CH2(CH3)CH2CH3 B. CH3CH2C(CH2CH3)2CH2(CH3)CH2CH3 C. CH3CH(CH3)C(CH2CH3)2CH2CH2CH3 D. CH3C(CH3)2C(CH2CH3)2CH2CH2CH3arrow_forwardWhat term describes the structural relationship between (2R,3R,4S)-2,3,4-trichloroheptane and (2R,3R,4R)-2,3,4-trichloroheptane? A. enantiomers B. diastereomers OO OO C. constitutional isomers D. not isomersarrow_forwardGive the systematic name for the following compounds. 1. C(CH3)3CH(CH3)CH2CH(CH2CH3)CH2CH3 2. CH3CH2CH2C(CH2CH3)2CH(CH3)2arrow_forward
- see imagearrow_forwardA. Classify all functional groups B. Classify if they are constitutional isomers, stereoisomers (cis–trans), same or different compoundsarrow_forwardA. Identify and name the functional group in each of the following. 1. Снзсоснз 2. снзосн2сHз 3. CH3CH=CH2 CH3CH2COOH 5. CH3CH2CHO 6. CH3CH2CH20H 4.arrow_forward
- 1.Name the following compounds using the IUPAC Nomenclature. a. CH3CH(CH3)(CH2)4CH3 b. CH3 │ CH3-CH-CH-CH3 │ CH3 2. Draw the structures of each of the following compounds a. cis-1,2-Dichlorocyclopropane b.trans-1,4-Diethylcyclohexanearrow_forward1. What functional group is produced when an aldehyde reacts with H2/Pt? A.secondary alcohol B. carboxylic acid C.hemiacetal D. primary alcohol E.alkane F.tertiary alcohol G. alkene 2. What reaction occurs when an aldehyde reacts with H2/Pt to form a primary alcohol? A. Hydration B. Hydration C. Dehydration D. Oxidation E. Reduction( hydrogentation) 3. What reaction occurs when an Ester react with H+/H2O to from a carboxylic acid and alcohol? A. Dehydration B. Reduction ( Hydrogenation) C.Hydrolysis D. Hydration E.oxidationarrow_forwardDraw the structure of the following compounds. a. 1-ethyl-3-methylcycloheptane b. Cyclopropylcyclopentane c. 1,1-diethyl-4-(3,3-dimethylbutyl)cyclohexanearrow_forward
- these two structures are ____. a. enantiomers b. diastereomers c. same compound d. constitutional isomersarrow_forward1. Which compounds contain chiral centers? Show your solution for each ww ww w w item. a. 2-Chloropentane b. 3-Chloro-1-pentene c. 3-Chloropentane d. 1,2-Dichloropropanearrow_forward13. Ethylethanoate and butanoic acid can be classified as A. positional isomers B. chain isomers C. functional isomers D. stereoisomers 14. Which of the following pairs are positional isomers A. trans-1,4-dichlorocyclohexane, cis-1,3-dichlorocyclopentane B. trans 1,4-dichlorocyclohexane, cis-1,4-dichlorocyclohexane C. 2-pentanol, Cyclopentanol D. 1,2-cycohexanediol, 1,3-cycohexanediol 15. Which of the following compounds will have zero dipole moment? A. cis-1,2-dibromoethylene B. 1,1-dibromoethylene C. trans-1,2-dibromoethylene D. all of these 16. Which of the following is not aromatic: A. cyclopentadienyl cation B. cyclopentadienyl anion C. Cyclopropenyl cation D. Cycloheptatrienyl cation 17. Which of the following compounds containing lone pair has the least tendency to donate its electrons? A. the lone pair in pyridine B. the lone pair in furan C. the lone pair in pyrole D. the lone pair in thiophenearrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning