
Concept explainers
(a)
Interpretation:
The maximum amount of SO2 that is allowed to be exhausted to the atmosphere is to be calculated.
Concept introduction:
The contact process is the method of producing sulfuric acid in the high concentrations needed for industrial process. The process involved combining of sulfur and oxygen to form sulfur dioxide as follows,
S(s)+O2(g)→SO2(g)
Adding an excess of oxygen to sulfur dioxide in the presence of catalyst, the sulfur trioxide is formed. The sulfur trioxide is added to sulfuric acid which gives rise to disulfuric acid (oleum). Oleum is reacted with water to form concentrated sulfuric acid. The reactions involved is written as follows:
2SO2(g)+O2(g)⇌2SO3(g)SO3(g)+H2SO4(l)→H2S2O7(l)H2S2O7(l)+H2O(l)→2H2SO4(l) (1)
Number of moles = MassMolecular massMass = Number of moles × Molecular mass
(b)
Interpretation:
To calculate the mass of calcium hydroxide is needed to remove the sulfur dioxide.
Introduction:
In the contact process, for making sulfuric acid, if enough sulfur is burned to sulfur dioxide to produce anhydrous sulfuric acid. The sulfur dioxide is vented to the atmosphere. To prevent any SO2 from reaching atmosphere is to exhaust the gas with slaked lime (Ca(OH)2):
Ca(OH)2(s)+SO2(g)→CaSO3(s)+H2O(l)2CaSO3(s)+O2(g)→2CaSO4(s) (1)
Number of moles = MassMolecular massMass = Number of moles × Molecular mass

Want to see the full answer?
Check out a sample textbook solution
Chapter 21 Solutions
Chemistry & Chemical Reactivity
- Would the following organic synthesis occur in one step? Add any missing products, required catalysts, inorganic reagents, and other important conditions. Please include a detailed explanation and drawings showing how the reaction may occur in one step.arrow_forward(a) Sketch the 'H NMR of the following chemical including the approximate chemical shifts, the multiplicity (splitting) of all signals and the integration (b) How many signals would you expect in the 13C NMR? CH3arrow_forwardDraw the Show the major and minor product(s) for the following reaction mechanisms for both reactions and show all resonance structures for any Explain why the major product is favoured? intermediates H-Brarrow_forward
- 3. Draw ALL THE POSSBILE PRODUCTS AND THE MECHANISMS WITH ALL RESONANCE STRUCTURES. Explain using the resonance structures why the major product(s) are formed over the minor product(s). H₂SO4, HONO CHarrow_forward7. Provide the product(s), starting material(s) and/or condition(s) required for the No mechanisms required. below reaction HO + H-I CI FO Br2, FeBr3 O I-Oarrow_forward6. Design the most efficient synthesis of the following product starting from phenot Provide the reaction conditions for each step (more than one step is required) and explain the selectivity of each reaction. NO MECHANISMS ARE REQUIRED. OH step(s) CIarrow_forward
- What is the skeletal structure of the product of the following organic reaction?arrow_forwardIf a reaction occurs, what would be the major products? Please include a detailed explanation as well as a drawing showing how the reaction occurs and what the final product is.arrow_forwardWhat is the major organic product of the following nucleophilic acyl substitution reaction of an acid chloride below?arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning





