Concept explainers
Interpretation:Whetherbenzene or acetylene releases more energy per mole of CH needs to be determined.
Concept introduction: Balanced chemical equation for the combustion reaction of benzene is:
Balanced chemical equation for the combustion reaction of acetylene is as follows:
Answer to Problem 6.72P
Acetylene releases more energy per CH than benzene.
Explanation of Solution
Balanced chemical equation for the combustion reaction of benzene is:
Here,
Putting the values,
Balanced chemical equation for the combustion reaction of acetylene is:
Thus, acetylene releases more energy per CH than benzene.
Want to see more full solutions like this?
Chapter 6 Solutions
Principles of General Chemistry
- Hydrazine, N2H4, is a colorless liquid used as a rocket fuel. What is the enthalpy change for the process in which hydrazine is formed from its elements? N2(g)+2H2(g)N2H4(l) Use the following reactions and enthalpy changes: N2H4(l)+O2(g)N2(g)+2H2O(l);H=622.2kJH2(g)+12O2(g)H2O(l);H=285.8kJarrow_forwardHydrogen, H2, is prepared by steam reforming, in which hydrocarbons are reacted with steam. For CH4, CH4(g)+H2O(g)CO(g)+3H2(g) Calculate the enthalpy change H for this reaction, using standard enthalpies of formation.arrow_forwardConsider the reactions of silver metal, Ag(s), with each of the halogens: fluorine, F2(g), chlorine, Cl2(g), and bromine, Br2(l). What chapter data could you use to decide which reaction is most exothermic? Which reaction is that?arrow_forward
- Compounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJarrow_forwardThe equation for the fermentation of glucose to alcohol and carbon dioxide is: C6H12O6(aq) 2C2H5OH(aq) + 2CO2(g) The enthalpy change for the reaction is 67 kJ. Is this reaction exothermic or endothermic? Is energy, in the form of heat, absorbed or evolved as the reaction occurs?arrow_forwardA commercial process for preparing ethanol (ethyl alcohol), C2H5OH, consists of passing ethylene gas. C2H4, and steam over an acid catalyst (to speed up the reaction). The gas-phase reaction is Use bond enthalpies (Table 9.5) to estimate the enthalpy change for this reaction when 37.0 g of ethyl alcohol is produced.arrow_forward
- The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardThe reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?arrow_forwardWhich of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?arrow_forward
- Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardWith a platinum catalyst, ammonia will burn in oxygen to give nitric oxide, NO. 4NH3(g)+5O2(g)4NO(g)+6H2O(g);H=906kJ What is the enthalpy change for the following reaction? NO(g)+32H2O(g)NH3(g)+34O2(g)arrow_forwardWhat mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
- Introductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning