Concept explainers
(a)
Interpretation:
The IUPAC name of the given compound needs to be determined.
Concept Introduction:
Organic compounds are the compounds that are mainly composed of C and H atoms. The branch of chemistry that deals with preparation, reactions, and properties of organic compounds. The molecular formula of organic compound represents the number of bonded atoms with their atomic symbols. The structural formula represents all the bonded atoms with
(b)
Interpretation:
The IUPAC name of the given compound needs to be determined.
Concept Introduction:
Organic compounds are the compounds that are mainly composed of C and H atoms. The branch of chemistry that deals with preparation, reactions, and properties of organic compounds. The molecular formula of organic compound represents the number of bonded atoms with their atomic symbols. The structural formula represents all the bonded atoms with chemical bonds and the arrangement of atoms in the molecule. IUPAC purposed some rules to determine the name of organic compound that is based on the number of C atoms in the longest chain of the compound and name of branches.
(c)
Interpretation:
The IUPAC name of the given compound needs to be determined.
Concept Introduction:
Organic compounds are the compounds that are mainly composed of C and H atoms. The branch of chemistry that deals with preparation, reactions, and properties of organic compounds. The molecular formula of organic compound represents the number of bonded atoms with their atomic symbols. The structural formula represents all the bonded atoms with chemical bonds and the arrangement of atoms in the molecule. IUPAC purposed some rules to determine the name of organic compound that is based on the number of C atoms in the longest chain of the compound and name of branches.
(d)
Interpretation:
The IUPAC name of the given compound needs to be determined.
Concept Introduction:
Organic compounds are the compounds that are mainly composed of C and H atoms. The branch of chemistry that deals with preparation, reactions, and properties of organic compounds. The molecular formula of organic compound represents the number of bonded atoms with their atomic symbols. The structural formula represents all the bonded atoms with chemical bonds and the arrangement of atoms in the molecule. IUPAC purposed some rules to determine the name of organic compound that is based on the number of C atoms in the longest chain of the compound and name of branches.
(e)
Interpretation:
The IUPAC name of the given compound needs to be determined.
Concept Introduction:
Organic compounds are the compounds that are mainly composed of C and H atoms. The branch of chemistry that deals with preparation, reactions, and properties of organic compounds. The molecular formula of organic compound represents the number of bonded atoms with their atomic symbols. The structural formula represents all the bonded atoms with chemical bonds and the arrangement of atoms in the molecule. IUPAC purposed some rules to determine the name of organic compound that is based on the number of C atoms in the longest chain of the compound and name of branches.
(f)
Interpretation:
The IUPAC name of the given compound needs to be determined.
Concept Introduction:
Organic compounds are the compounds that are mainly composed of C and H atoms. The branch of chemistry that deals with preparation, reactions, and properties of organic compounds. The molecular formula of organic compound represents the number of bonded atoms with their atomic symbols. The structural formula represents all the bonded atoms with chemical bonds and the arrangement of atoms in the molecule. IUPAC purposed some rules to determine the name of organic compound that is based on the number of C atoms in the longest chain of the compound and name of branches.
Want to see the full answer?
Check out a sample textbook solutionChapter 12 Solutions
General, Organic, & Biological Chemistry
- Give the IUPAC name for each compound.arrow_forwardWhat is the IUPAC name for the following compound? OH O 1-isopropyl-4-hydroxycyclopentane O 1-isopropyl-3-cyclopentanol O 3-isopropylcyclopentanol O 1-isopropyl-4-cyclopentanolarrow_forwardWhat is the IUPAC name for this:CH3CH(OH)CH(CH3)CH(CH3)CH(CH3)2 CH3CH(OH)CH(CH3)CH(CH3)CH(CH3)2arrow_forward
- In which solvent is cyclohexane most soluble? Water Diethyl ether Hexanol ethanolarrow_forwardGive the IUPAC name for each compound:(CH3)3CCH2CH(CH2CH3)2 CH3(CH2)3CH(CH2CH2CH3)CH(CH3)2arrow_forwardDraw structures for the four constitutional isomers of molecular formula C4H10O that contain an OH group. Give the IUPAC name for each alcohol.arrow_forward
- What is the IUPAC name for the following structure? CH2CH3 CI O 2-chloro-2-ethyl cyclohexane O Ethyl cyclohexane O Chloro-ethyl cyclohexane O 1-chloro-2-ethyl cyclohexanearrow_forwardWhat is the IUPAC name for the following compound? Select one O 1-propyl-3-isopropyl-2- methylcyclohexane O 1-isopropyl-2-methyl-4- propylcyclohexane 1-isopropyl-3-methyl-4- propylcyclohexane O 4-isopropyl-2-methyl-1- propylcyclohexane 1-propyl-2-methyl-4- Isopropylcyclohexanearrow_forwardWhy can formaldehyde (CH20) be prepared in the form of a 37% solution in water, whereas octanal cannot? (Select all that apply.) | Octanal is more hydrophilic than formaldehyde. O Formaldehyde is a small molecule. O Formaldehyde is polar. O Octanal is mostly hydrophobic.arrow_forward
- Organic And Biological ChemistryChemistryISBN:9781305081079Author:STOKER, H. Stephen (howard Stephen)Publisher:Cengage Learning,General, Organic, and Biological ChemistryChemistryISBN:9781285853918Author:H. Stephen StokerPublisher:Cengage Learning