Concept explainers
Interpretation:
The standard enthalpy of formation of Methane has to be calculated.
Concept Introduction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
Hess law:
The enthalpy change for given set of reactants to the given set of products is the same, whether the process takes place in single or sequence of steps. This is called as Hess’s law.
Enthalpy is generally calculated from the standard enthalpy of formation.
To calculate: The
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
Chemistry: Atoms First
- The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forwardA 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardCompounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJarrow_forward
- What mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardWhich of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?arrow_forward
- The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardWhen lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?arrow_forwardThe reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?arrow_forward
- The enthalpy change for the reaction of hydrogen gas with fluorine gas (o produce hydrogen fluoride is 542 U for the equation as written: mg src=Images/HTML_99425-10-41QAP_image001.jpg alt="" align="top"/> l type='a'> What is the enthalpy change per mole of hydrogen fluoride produced? Is the reaction exothermic or endothermic as written? What would be the enthalpy change for the reverse of the given equation (that 1%, for the decomposition of HF into its constituent elements)?arrow_forwardWe burn 3.47 g lithium in excess oxygen at constant atmospheric pressure to form Li2O. Then, we bring the reaction mixture back to 25 C. In this process 146 kJ of heat is given off. Calculate the standard formation enthalpy of Li2O.arrow_forwardHydrogen, H2, is prepared by steam reforming, in which hydrocarbons are reacted with steam. For CH4, CH4(g)+H2O(g)CO(g)+3H2(g) Calculate the enthalpy change H for this reaction, using standard enthalpies of formation.arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning