Concept explainers
Interpretation:
The explanation for cooling effect of ethanol on rubbing against skin has to be given.
Concept Introduction:
Heat is flow of thermal energy involving two bodies at various temperatures. The flow of thermal energy involving two bodies at various temperatures is called as heat. The flow of heat implies that energy is either released or absorbed on describing about energy changes that takes place during a process.
Exothermic process is the chemical process in which heat is released to the surroundings.
Endothermic process is the chemical process in which heat is absorbed from the surroundings.
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
Chemistry: Atoms First
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forward
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardThe thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forwardThe temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.arrow_forward
- Alloys When a 58.8-g piece of hot alloy is placed in125 g of cold water in a calorimeter, the temperature ofthe alloy decreases by 106.1°C, while the temperature ofthe water increases by 10.5°C. What is the specific heat ofthe alloy?arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardWhat mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forward
- The combustion of 1.00 mol liquid methyl alcohol (CH3OH) in excess oxygen is exothermic, giving 727 kJ of heat. (a) Write the thermochemical equation for this reaction. (b) Calculate the enthalpy change that accompanies the burning 10.0 g methanol. (c) Compare this with the amount of heat produced by 10.0 g octane, C8H18, a component of gasoline (see Exercise 5.41).arrow_forwardExplain the difference between heat capacity and specific heat of a substance.arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning