Interpretation:
The result of calculated standard enthalpy of reaction has to be identified if the concentration of one of the reactant solution is twice as high as it was supposed to be.
Concept Introduction:
- Calorimetry can be defined as the measurement of changes in heat.
- Two types of Calorimetry are coffee cup calorimeter and bomb calorimeter.
- The change in heat of the system can be determined with the value of the heat capacity of the calorimeter.
- The heat capacity of the calorimeter can be given as,
Standard enthalpy of reaction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
Chemistry: Atoms First
- The process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forwardNiagara Falls has a height of 167 ft (American Falls). What is the potential energy in joules of 1.00 lb of water at the top of the falls if we take water at the bottom to have a potential energy of zero? What would be the speed of this water at the bottom of the falls if we neglect friction during the descent of the water?arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forward
- 9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s) from lead metal and oxygen gas. PbO(s)+C(graphite)Pb(s)+CO(g) H = 106.8 kJ 2C(graphite)+O2(g)2CO(g) H= -221.0 kJ If 250 g of lead reacts with oxygen to form lead(II) oxide, what quantity of thermal energy (in kJ) is ahsorhed or evolved?arrow_forwardUnder what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forwardChlorine dioxide, ClO2, is a reddish yellow gas used in bleaching paper pulp. The average speed of a ClO2 molecule at 25C is 306 m/s. What is the kinetic energy (in joules) of a ClO2 molecule moving at this speed?arrow_forward
- When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardGiven the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forward
- A typical fat in the body is glyceryl trioleate, C57H104O6. When it is metabolized in the body, it combines with oxygen to produce carbon dioxide, water, and 3.022104 kJ of heat per mole of fat. (a) Write a balanced thermochemical equation for the metabolism of fat. (b) How many kilojoules of energy must be evolved in the form of heat if you want to get rid of five pounds of this fat by combustion? (c) How many nutritional calories is this? (1 nutritional calories =1103 calories)arrow_forwardA piece of lead of mass 121.6 g was heated by an electrical coil. From the resistance of the coil, the current, and the Time the current flowed, it was calculated that 235 J of heat was added to the lead. The temperature of the lead rose from 20.4C to 35.5C. What is the specific heat of the lead?arrow_forwardA 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning