The structural formula of C o ( N O 2 ) 2 C l .4 N H 3 has to be interpreted given that it precipitates 1 mol AgCl per formula unit when treated with excess A g N O 3 solution. Concept introduction: Complex compounds are primarily formed by transition elements which are d-block elements. A co-ordination compound is known as a complex compound is made of metal atom/ion and ligand(s). Ligands are considered as Lewis bases and the central metal atom is Lewis acid. Ligands donate a pair of electron to metal ion and establishes bonding with metal ion which is known as co-ordinate bond and hence these compounds are named as co-ordination compounds. The ligands represented inside the square brackets. Co-ordination number of a central metal atom in its complex compound refers to the number of ligands bonded to central metal atom.

Question

Want to see the full answer?

Answer 1

Question

Chapter 22, Problem 22.31QP

Interpretation Introduction

Interpretation:

The structural formula of Co(NO2)2Cl.4NH3 has to be interpreted given that it precipitates 1 mol AgCl per formula unit when treated with excess AgNO3 solution.

Concept introduction:

Complex compounds are primarily formed by transition elements which are d-block elements. A co-ordination compound is known as a complex compound is made of metal atom/ion and ligand(s). Ligands are considered as Lewis bases and the central metal atom is Lewis acid. Ligands donate a pair of electron to metal ion and establishes bonding with metal ion which is known as co-ordinate bond and hence these compounds are named as co-ordination compounds. The ligands represented inside the square brackets.

Co-ordination number of a central metal atom in its complex compound refers to the number of ligands bonded to central metal atom.

Expert Solution & Answer

Want to see the full answer?

Check out a sample textbook solution

See solution

Students have asked these similar questions

In acidic aqueous solution, the purple complex ion Co(NH3)5Br2+ undergoes a slow reaction in which the bromide ion is replaced by a water molecule, yielding the pinkish-orange complex ion : Co(NH3)5(H2O)3+ Co(NH3)5Br2+Purple(aq)+H2O(l) → Co(NH3)5(H2O)3+Pinkish−orange(aq)+Br−(aq)The reaction is first order in Co(NH3)5Br2+, the rate constant at 25 ∘C is 6.3×10−6 s−1, and the initial concentration of Co(NH3)5Br2+ is 0.100 MM. What is its molarity after a reaction time of 19.0 h ? How many hours are required for 85 %% of the Co(NH3)5Br2+ to react?

CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds denoted A and B. When A is reacted with silver nitrate, 2/3 of the chlorine atoms precipitate. B, submitted to the same treatment, exhibits the precipitation of 1/3 of the present chlorine atoms. What are the formulas of compounds A and B?

The cobalt carbonyl complex, Co2(CO)8, undergoes an oxidation with hydrogen gas to form a monomeric metal hydride product, HCo(CO)4. The resulting complex could have one of three possible structures, so an infrared spectrum was obtained. If the spectrum has 12 observable bands overall, what is the likely structure?