For the reaction2 Cul(s) + Cd(s) → Cd (ag) + 2 (ag) + 2 Cu(s) E = +0.23 Vgiven that E°c"/Sd = -0.403 V, determine E° for the half-reaction in V2 Cul(s) + 2 e2 Cu(s) + 2 1(ag)

Answered: Image /qna-images/answer/560e0cd3-591f-4be1-9029-03a6d06a65c7.jpg

Answered: For the reaction 2 Culls) + Çd(s) → Cd…

For the reaction 2 Culls) + Çd(s) → Cd (ag) + 2 (ag) + 2 Cu(s) E = +0.23 V %3D given that E°cs"/Sd = -0.403 V, determine E° for the half-teaction in V %3D Culls) + 2 e - 2 Culs) + 2 1-(aa)

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter20: Electrochemistry

Section20.1: Voltaic Cells

Problem 5PP

See similar textbooks

Related questions

Q: The equation AG = -nFE also can be applied to half-reactions. Use standard reduction potentials to…

Q: Calculate AG and K at 25°C for the reactions. 7H2O+2 Cr43 Cl2 Cr20,2- +6 Cl +14H+ e = 0.03 V a. cell…

Q: Ag(s)|Ag (satd Agl)||Ag*(0.100 M) |Ag Ecell = 0.417 V %3D

A: Molarity of Ag+=0.100MEmf=0.417VKsp=?

Q: LECTROCHEMISTRY: Copper was electroplated from a CuzSo4 solution onto an electrode with an active…

Q: It is desired to separate silver in a solution that is 0.0591 M BiO", 0.120 M Cu“ ,0.0986 M Ag", and…

A: Interpretation: To check whether the separation of the species is feasible by controlled potential…

Q: ELECTROCHEMISTRY: Copper was electroplated from a CuzSO4 solution onto an electrode with an active…

A: We will first calculate the mass of cu, then find volume of cu. Using this we will calculate…

Q: The Latimer diagram for tellurium in basic solution at 25 °C is shown. Select the species that is…

Q: Balance the following redox reaction in basic solution. 2+ + N₂H4(aq) + Cu (aq) → N₂(g)+Cu (aq)

A: First we need to determine the oxidation and reduction half reaction. Then we balance them one by…

Q: A spoon is to be electroplated with Ag(s) using a solution containing Ag+ ions. If 32.4 grams of…

A: The amount of substance deposited on the electrode on passing electric current is given by the…

Q: 1. Balance the following basic redox reaction using the half-reaction method. Br2 → BrO; + Br

A: Stepwise balancing the redox reaction in basic medium-

Q: ELECTROCHEMISTRY: Copper was electroplated from a Cu2S04 solution onto an electrode with an active…

A: Copper was electroplated from a Cu2SO4 solution onto an electrode with an active surface area of…

Q: Given the following standard reduction potentials: Mg2 (aq) + 2e - Mg(s) E° = -2.357 V %3D Al3* (aq)…

A: We have to predict the spontaneous reaction.

Q: A galvanic cell at a temperature of 25.0 °C is powered by the following redox reaction: 2103 (aq) +…

Q: Using standard reduction potentials from the ALEKS Data tab, calculate the standard reaction free…

Q: Consider the following standard reduction potentials: F2(g) + 2 e- 2 F'(aq) E° = +2.87 V Mg2*(aq) +…

Q: 8. For the oxidation-reduction reaction: S406(aq) + Cr+(aq) Cr (aq) + S202 (aq), -> the appropriate…

A: recall the given half cell reactions Reduction half cell reaction S4O62-+2e-→2S2O32- ......(i)…

Question

For the reaction
2 Cul(s) + Cd(s) → Cd (ag) + 2 (ag) + 2 Cu(s) E = +0.23 V
given that E°c"/Sd = -0.403 V, determine E° for the half-reaction in V
2 Cul(s) + 2 e
2 Cu(s) + 2 1(ag)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
For the reaction Cu2+(aq) + Zn(s) → Cu(s) + Zn2+ (aq), why can’t you generate electric current by placing a piece of copper metal and a piece of zinc metal in a solution containing CuCl2(aq) and ZnCl2(aq)?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
You have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.
Consider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.
What is the voltage of a concentration cell of Cl ions where the concentrations are 1.045 and 0.085 M? What the spontaneous reaction?
A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
From the information provided, use cell notation to describe the following systems: (a) In one half-cell, a solution of Pt(NO3)2 forms Pt metal, while in the other half-Cell, Cu metal goes into a.Cu(NO3)2 solution with all solute concentrations 1 M. (b) The cathode consists of a gold electrode in a 0.55 M Au(NO3)3 solution and the anode is a magnesium electrode in 0.75 M Mg(NO3)2 solution. (c) One half-cell consists of a silver electrode in a 1 M AgNO3 solution, and in the other half-cell, a copper Electrode in 1 M Cu(NO3)2 is oxidized.
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).