help please answer in text form with proper workings and explanation for each and every part and steps with concept and introduction no AI no copy paste remember answer must be in proper format with all working! 1) Hydrazine, N2H4, once used as a rocket propellant, reacts with oxygen in the followingequation.N2H4(g) + O2(g) → N2(g) + 2 H2O(g)The reaction, at 50% yield, produces 4.0 moles of N2. What was the mass of hydrazine used?Assume that O2 is in excess.A) 64 gB) 32.0 gC) 260 gD) 0.063 g

Step 1:Given data,N2H4(g) + O2(g) —> N2(g) + 2H2O(g)Percentage yield = 50%Moles of N2 produced =…

1) Hydrazine, N2H4, once used as a rocket propellant, reacts with oxygen in the following equation. N2H4(g) + O2(g) → N2(g) + 2 H2O(g) The reaction, at 50% yield, produces 4.0 moles of N2. What was the mass of hydrazine used? Assume that O2 is in excess. A) 64 g B) 32.0 g C) 260 g D) 0.063 g

1) Hydrazine, N2H4, once used as a rocket propellant, reacts with oxygen in the following equation. N2H4(g) + O2(g) → N2(g) + 2 H2O(g) The reaction, at 50% yield, produces 4.0 moles of N2. What was the mass of hydrazine used? Assume that O2 is in excess. A) 64 g B) 32.0 g C) 260 g D) 0.063 g

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 127E: Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane:...

See similar textbooks

Related questions

Q: Please correct answer and don't use hand rating

Q: 10 Determine the structure of a compound with the molecular formula CH₁O that exhibits the following…

Q: None

A: In the alpha fragmentation, a bond coming from the carbon alpha to the oxygen is broken in half. One…

Q: A 5.0-g pesticide sample was decomposed by wet ashing and then dilutedto 200.0 mL in a volumetric…

A: STEP 1:To calculate the concentration of lead in the 200 mL sample solution, we need to first…

Q: Determine the order with respect to A and the order with respect to B.

A: The order of a reaction is a term used to describe the relationship between the rate of a chemical…

Q: None

A: Step 1:In ethanol the -OH bond is involved in hydrogen bonding with water. Oxygen atom is partially…

Q: Consider this organic mechanism: A H H : OH 1 2 Does this mechanism describe an acid/base reaction?…

A: Answer: The products: Bronsted -Lowry acid is defined as the compound which can donate proton (H+…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: MD orders Morphine Sulfate 5mg. Available in 8mg/ml. How much ml are administered?a. 0.55mlb.…

Q: (81310 - 76200) ÷ 0.00216 With Sig Figs

A: First, subtract 76200 from 81310. This gives us:81310-76200=5110

Q: 1) Draw the product and mechanism for this transformation. Use electron-movement File Preview se the…

A: Step 1:Step 2: Step 3: Step 4:

Q: None

A: Step 1Fill in the missing lone pairs:The oxygen atom in the hydroxyl group (OH) has two lone…

Q: 5. Calculate Art and Ar So for the autotonization of water H20 cl) → Hcaq) + OH (aq) T(K) Kw 273…

A: Step 1:The Van't Hoff equation: Plotting ln(Kw) vs (1/T) leads to ∆rH° and ∆rS° Step…

Q: Calculate the amount (in g) of excess reagent remaining after 27.06 g of Ti reacts with 79.65 g of…

A: Given:Mass of Ti = 27.06 g (4 significant figures)Mass of F2 =…

Q: Year Here is a list of atmospheric CO2 concentration (ppm) for more recent years.2 [CO2] (ppm) [CO2]…

A: Approach to solving the question: Detailed explanation:.Examples: Key references:

Q: A certain substance X has a normal freezing point of -9.8 °C and a molal freezing point depression…

A: Step 1: There is depression in freezing point when a non volatile substance is dissolved in solvent,…

Q: Which is the expected major product? CH3 СН3Сіз AICI 3 ? CH3 H3C А CH3 B Cl CH3 CH3 CH3 D CH3 CH3

A: This is Friedel-Crafts alkylation. In this case, the -CH3 group is added to the aromatic…

Q: Using the henderson-Hasselbach equation, calculate the grams of acetic acid and sodium acetate…

Q: 1) Name the following Molecules CH3 Η مام Br Br H H&C Br Η

A: Step 1:(1) 2-methylcyclopentanal Step 2:(2) 2-methylhex-3-en-2-one Step 3:(3) 2 methyl Cyclohexanal…

Q: D. Vapor Pressure in Solutions Containing Multiple Volatile Substances Up to this point we have been…

A: Step 1: Step 2: Step 3: Step 4:

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Approach to solving the question: Detailed explanation:In an atomic notation, Z is the atomic number…

Q: Drawing the mechanism of an organic - Complete this mechanism for an acid-base reaction by adding…

Q: Why can't scientific methods always be used to solve social, political ethical, and economic…

A: Moreover, controlled settings, reproducible experiments, and the gathering of empirical data are all…

Q: Please draw in detail the expected product C, explain selectivity and draw the arrow pushing…

A: I. CONCEPTS: A. Chromic acid (H2CrO4) is an oxidant used tor oxidizing alcohols. For primary…

Q: practice help

A: Question 1: Absorption of an ultraviolet wavelength photon by a molecule causesRelated…

Q: 3. H СОН. Consider this compound: HO H3Cl SH₁ H3C Of hydrogen atoms H, H, and H., select the most…

Q: For the following acid-base reaction, predict the position of the equilibrium and identify the most…

Q: Please correct answer and don't use hand rating

A: Given:- Mass of sodium chloride (NaCl) = 25 grams- Mass of water = 175 grams Required:- Mass…

Q: None

A: Step 1: Step 2:

Q: Given the reaction and information find ΔG. Acetyl-P +H2O----> Acetate + Pi ΔG°= -42.3 KJ/moles…

A: To find the Gibbs free energy change (ΔG)for the reaction under non-standard conditions, we can use…

Q: None

Q: Copper was determined in a river water sample by atomic absorption spectrometry and the method of…

A: Step 1: Determine the increase in absorbance due to the addition of the standard.Step 2: Calculate…

Q: 35. The rate of the reaction between hemoglobin (Hb) and carbo monoxide (CO) was studied at 20°C.…

A: Step 1: Step 2: Step 3: Step 4:

Q: Which structure can be a starting reagent for the Br₂ halogenation reaction used to prepare the…

A: Step 1: ReactionDesired product here is a tertiary alkyl bromide. Hence, the starting material is an…

Q: 8. Determine the mass in the units indicated of a) 0.524 moles of gold (Au) in milligrams (mg)

A: The molar mass of an element is the mass in grams of one mole of that substance. It is usually…

Q: The average adult consumes approximately 11,700 kJ per day. Assuming that the metabolic pathways…

A: IntroductionMetabolic energy is crucial for sustaining life, as it powers various biological…

Q: 2. Give the pK₂ values for the following compounds and then rank them in terms of increasing…

A: The pKa value of a compound is a measure of its acidity. The lower the pKa value, the stronger the…

Q: None

A: Step 1: Step 2:Step 3: Step 4:

Q: 2. State whether aqueous solutions of each solutions of the following salts would be acidic, basic,…

A: In order to determine whether a salt solution is acidic, basic, or neutral, we need to consider the…

Q: 8. For each of the following compounds, draw the most stable conformation and indicate the number of…

A: a. Cis - 1, 4 - dimethyl cyclohexane Most stable confirmation is shownIt can exist in one chair…

Q: Please correct answer and don't use hand rating

A: Step 1:Any molecule can contain London Dispersion forces So all compounds have dispersion forces…

Q: I need help understanding this lab. Cyclohexanol 10mL used in experiement MW= 100.16. Sufuric acid…

A: Part 1: Reaction Summary and CalculationsThe experiment involves the following…

Q: HIn H + I¯ color 1 color 2 The following absorbance data were obtained for a 5.00 × 104 M solution…

A: Recall the Beer-Lambert equation: For two absorbing components, the absorbance at a particular…

Q: None

A: Approach to solving the question: Detailed explanation: Examples: Key references:

Q: Please correct answer and don't use hand rating

A: Step 1:To address the questions regarding the atomic orbital (AO) shown in the image, here's a…

Q: Redraw the molecule below as a skeletal ("line") structure. Be sure to use wedge and dash bonds if…

A: In the chair conformation of the compound, we see that there are two substituent (Br and F). Both…

Q: If a liquid has a vapor pressure of 50.0 mmHg at 25.0 oC and ΔHvap = 15.60 kJ/mol, what is the…

A: Step 1: Step 2: Step 3: Step 4:

Q: C. Problem 16-71 How would you synthesize the following compounds from benzene? Assume that the…

A: Both the synthesis methodologies are given in figureplease see it very carefully because any changes…

Q: Zadanie 26. (0-1) Spośród wymienionego niżej zbioru metali podkreśl symbole tego (tych), które…

A: Step 1:Reakcja glinu z HCl: Glin reaguje z kwasem solnym, tworząc chlorek glinu i wydzielając…

Q: Please correct answer and don't use hand rating

A: Step 1:Step 2:Step 3: Step 4:

Question

help please answer in text form with proper workings and explanation for each and every part and steps with concept and introduction no AI no copy paste remember answer must be in proper format with all working!

1) Hydrazine, N2H4, once used as a rocket propellant, reacts with oxygen in the following
equation.
N2H4(g) + O2(g) → N2(g) + 2 H2O(g)
The reaction, at 50% yield, produces 4.0 moles of N2. What was the mass of hydrazine used?
Assume that O2 is in excess.
A) 64 g
B) 32.0 g
C) 260 g
D) 0.063 g

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
Boron forms an extensive series of compounds with hydrogen, all with the general formula BxHy. To analyze one of these compounds, you burn it in air and isolate the boron in the form of B2O3 and the hydrogen in the form of water. You find that 0.1482 g BxHy gives 0.4221 g B2O3 when burned in excess O2. Determine the empirical I formula of BxHy.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
The space shuttle environmental control system handles excess CO2 (which the astronauts breathe out; it is 4.0% by mass of exhaled air) by reacting it with lithium hydroxide, LiOH, pellets to form lithium carbonate, Li2CO3, and water. If there are seven astronauts on board the shuttle, and each exhales 20. L of air pee minute, how long could clean air be generated if there were 25,000 g of LiOH pellets available for each shuttle mission? Assume the density of air is 0.0010 g/mL.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Bacterial digestion is an economical method of sewage treatment. The reaction is an intermediate step in the conversion of the nitrogen in organic compounds into nitrate ions. What mass of bacterial tissue is produced in a treatment plant for every 1.0 104 kg of wastewater containing 3.0% NH4+ ions by mass? Assume that 95% of the ammonium ions are consumed by the bacteria.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
A mixture of butene, C4Hg, and butane, is burned in air to give CO2 and water. Suppose you burn 2.86 g of the mixture and obtain 8.80 g of CO2 and 4.14 g of H2O. What are the mass percentages of butene and butane in the mixture?
The active ingredient in Pepto-BismoÂ® (an over- the-counter remedy for an upset stomach) is bismuth sub-salicylate, C7H5BiO4. Analysis of a 1.7500-g sample of Pepto-Bismol yields 346 mg of bismuth. What percent by mass is bismuth subsalicylate in the sample? (Assume that there are no other bismuth-containing compounds in Pepto-Bismol.)
Given that the density of argon is 1.78 g/L under standard conditions of temperature and pressure, how many argon atoms are present in a room with dimensions 4.0 m 5.0 m 2.4 m that is filled with pure argon under these conditions of temperature and pressure?