The compound p - methylthiophenol more or less reactive in electrophilic aromatic substitution than phenol is to be identified. Concept introduction: The electron withdrawing or electron releasing groups have a significant role in the activation and deactivation of benzene rings during an electrophilic aromatic substitution reaction. An electron withdrawing group deactivates the benzene rings by reducing the electron density on the rings.The electrophilic groups tend to accept or withdraw the electrons from the rest of the compound.The deactivating groups are those groups that tend to withdraw the electron density from the benzene ring and decrease the overall rate of reactions.

Question

Kk.323.

Answer 1

Question

Chapter 19, Problem 19.45P

Interpretation Introduction

Interpretation: The compound p- methylthiophenol more or less reactive in electrophilic aromatic substitution than phenol is to be identified.

Concept introduction: The electron withdrawing or electron releasing groups have a significant role in the activation and deactivation of benzene rings during an electrophilic aromatic substitution reaction. An electron withdrawing group deactivates the benzene rings by reducing the electron density on the rings.The electrophilic groups tend to accept or withdraw the electrons from the rest of the compound.The deactivating groups are those groups that tend to withdraw the electron density from the benzene ring and decrease the overall rate of reactions.

Expert Solution & Answer

Trending nowThis is a popular solution!

See solution

Check out sample textbook solution

Students have asked these similar questions

Kk.323.

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.