Concept explainers
(a)
Interpretation : The enthalpy of the formation of
Concept Introduction :
The enthalpy is defined as the product of the pressure and volume added up with the system internal energy. It is the property of
(a)
Answer to Problem 108AE
The enthalpy of formation of
Explanation of Solution
Nitrogen trifloride is colorless, inorganic thermally stable compound. It is non- flammable in nature. The stability is due to comparable size of nitrogen and fluoride. While the nitrogen iodide is an explosive compound due to the difference in the size of the atoms.
Consider the following reaction
Consider the enthalpy of formation of
Subtitling
Thus, the enthalpy of formation of
(b)
Interpretation : The molecular geometries of the species are determined.
Concept Introduction :
The molecular geometry is the three dimensional shape of the atom that contains the molecule. It consists of the general shape which contains bond lengths, bond angles, transition angles and other parameters determining the position of atoms.
(b)
Answer to Problem 108AE
It will have 4 bond pairs and the geometry will become tetrahedral with
Explanation of Solution
According to the vesper theory the molecular geometry are predicted as follows
Total valance shell electrons of the
Thus it will have 2 lone pairs and 2 bond pairs and the geometry will become V-shaped geometry with
It is represented as follows:
Total valance shell electrons of the
Thus it will have 4 bond pairs and the geometry will become tetrahedral with
Want to see more full solutions like this?
Chapter 18 Solutions
Chemical Principles
- The first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forwardHow many kilojoules of heat will be released when exactly 1 mole of manganese, Mn, is burned to form Mn3O4(s) at standard state conditions?arrow_forwardThe enthalpy change for the reaction of hydrogen gas with fluorine gas (o produce hydrogen fluoride is 542 U for the equation as written: mg src=Images/HTML_99425-10-41QAP_image001.jpg alt="" align="top"/> l type='a'> What is the enthalpy change per mole of hydrogen fluoride produced? Is the reaction exothermic or endothermic as written? What would be the enthalpy change for the reverse of the given equation (that 1%, for the decomposition of HF into its constituent elements)?arrow_forward
- When boron hydrides burn in air, the reactions are very exothermic (a) Write a balanced equation for the combustion of B5H9(g) in air to give B2O3(s) and H2O(g). (b) Calculate the enthalpy of combustion for B5H9(g) (fH = 73.2 kJ/mol), and compare it with the enthalpy of combustion of B2H6 (2038 kJ/mol). (The enthalpy of formation of B2O3(s) is 1271.9 kJ/mol.) (c) Compare the enthalpy of combustion of C2H6(g) with that of B2H6(g). Which transfers more energy as heat per gram?arrow_forwardThe Ostwald process for the commercial production of nitric acid from ammonia and oxygen involves the following steps: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) a. Use the values of Hf in Appendix 4 to calculate the value of H for each of the preceding reactions. b. Write the overall equation for the production of nitric acid by the Ostwald process by combining the preceding equations. (Water is also a product.) Is the overall reaction exothermic or endothermic?arrow_forwardAlthough nitrogen trifluoride (NF3) is a thermally stable compound, nitrogen triiodide (NI3) is known to be a highly explosive material. NI3 can be synthesized according to the equation BN(s) + 3IF(g) BF3(g) + NI3(g) a. What is the enthalpy of formation for NI3(s) given the enthalpy of reaction (307 kJ) and the enthalpies of formation for BN(s) (254 kJ/mol), IF(g) (96 kJ/mol), and BF3(g) (1136 kJ/mol)? b. It is reported that when the synthesis of NI3 is conducted using 4 moles of IF for every 1 mole of BN, one of the by-products isolated is [IF2]+[BF4]. What are the molecular geometries of the species in this by-product? What are the hybridizations of the central atoms in each species in the by-product?arrow_forward
- Calculate the standard molar enthalpy of formation of NO(g) from the following data: N2(g)+2O22NO2(g)H298=66.4kJ2NO(g)+O22NO2(g)H298=114.1kJarrow_forwardWhen lightning strikes, the energy can force atmospheric nitrogen and oxygen to react to make NO: N2(g)+O2(g)2NO(g)H=+181.8kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = +181.8 kJ? (c) What is the enthalpy change when 3.50 g nitrogen is reacted with excess O2(g)?arrow_forwardConsider the Haber process: N2(g)+3H2(g)2NH3(g);H=91.8kJ The density of ammonia at 25C and 1.00 atm is 0.696 g/L. The density of nitrogen, N2, is 1.145 g/L, and the molar heat capacity is 29.12 J/(mol C). (a) How much heat is evolved in the production of 1.00 L of ammonia at 25C and 1.00 atm? (b) What percentage of this heat is required to heat the nitrogen required for this reaction (0.500 L) from 25C to 400C, the temperature at which the Haber process is run?arrow_forward
- A reaction used to produce the silicon for semiconductors from sand (SiO2), can be broken up into three steps: SiO2(s)+2C(s)Si(s)+2CO(g)H=689.9kJ Si(s)+2Cl2(s)SiCl4(g)H=657.0kJ SiCl4(g)+2Mg(s)2MgCl2(g)+Si(s)H=625.6kJ (a) Write a thermochemical equation for the overall reaction where silicon is obtained from silicon dioxide and CO and MgCl2 are by-products. (b) What is H for the formation of one mole of silicon? (c) Is the overall reaction exothermic?arrow_forwardFrom the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)arrow_forwardUsing the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning