Chemistry by OpenStax (2015-05-04)
1st Edition
ISBN: 9781938168390
Author: Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser
Publisher: OpenStax
expand_more
expand_more
format_list_bulleted
Videos
Textbook Question
Chapter 17, Problem 34E
What are the desirable qualities of an electric battery?
Expert Solution & Answer
Trending nowThis is a popular solution!
Chapter 17 Solutions
Chemistry by OpenStax (2015-05-04)
Ch. 17 - If a 2.5 A current is run through a circuit for 35...Ch. 17 - For the scenario in the previous question, how...Ch. 17 - For each of the following balanced half-reactions,...Ch. 17 - For each of the following balanced half-reactions,...Ch. 17 - Given the following pairs of balanced...Ch. 17 - Balance the following in acidic solution: (a)...Ch. 17 - Identify the species that undergoes oxidation, the...Ch. 17 - Balance the following in acidic solution: (a)...Ch. 17 - Identify the species that was oxidized, the...Ch. 17 - Why is it not possible for hydroxide ion (OH-) to...
Ch. 17 - Why is it not possible for hydrogen ion (H+) to...Ch. 17 - Why must the charge balance in oxidation-reduction...Ch. 17 - Write the following balanced reactions using cell...Ch. 17 - Given the following cell notations, determine the...Ch. 17 - For the cell notations in the previous problem,...Ch. 17 - Balance the following reactions and write the...Ch. 17 - Identify the species oxidized species reduced, and...Ch. 17 - From the information provided, use cell notation...Ch. 17 - Why is a salt bridge necessary in galvanic cells...Ch. 17 - An active (metal) electrode was found to gain mass...Ch. 17 - An active (metal) electrode was found to lose mass...Ch. 17 - The mass of three different metal electrodes, each...Ch. 17 - For each reaction listed, determine its standard...Ch. 17 - For each reaction listed, determine its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - For the standard cell potentials given here,...Ch. 17 - For the ?G values given here, determine the...Ch. 17 - Determine the standard cell potential and the cell...Ch. 17 - Determine G and G for each of the reactions in...Ch. 17 - Use the data in Appendix L to determine the...Ch. 17 - What are the desirable qualities of an electric...Ch. 17 - List some things that are typically considered...Ch. 17 - Consider a battery made from one half-cell that...Ch. 17 - Consider a battery with the overall reaction:...Ch. 17 - An inventor proposes using a SHE (standard...Ch. 17 - Why do batteries go dead, but fuel cells do not?Ch. 17 - Explain what happens to battery voltage as a...Ch. 17 - Using the information thus far in this chapter,...Ch. 17 - Which member of each pair of metals is more likely...Ch. 17 - Consider the following metals: Ag, Au, Mg, Ni, and...Ch. 17 - Aluminum (E Al 3+/Al=2.07V) is more easily...Ch. 17 - If a sample of iron and a sample of zinc come into...Ch. 17 - Suppose you have three different metals. A, B, and...Ch. 17 - Why would a sacrificial anode made of lithium...Ch. 17 - Identify the reaction at the anode, reaction at...Ch. 17 - What mass of each product is produced in each of...Ch. 17 - How long would it take to reduce 1 mole of each of...Ch. 17 - A current of 2.345 A passes through the cell shown...Ch. 17 - An irregularly shaped metal part made from a...
Additional Science Textbook Solutions
Find more solutions based on key concepts
3. CAUTION Why is genetic drift aptly named?
a. It causes allele frequencies to drift up or down randomly.
b. I...
Biological Science (6th Edition)
1. A person gets in an elevator on the ground floor and rides it to the top floor of a building. Sketch a veloc...
College Physics: A Strategic Approach (3rd Edition)
How do you think a cell performing cellular respiration rids itself of the resulting CO2?
Campbell Biology (11th Edition)
5.2 In a diploid species of plant, the genes for plant height and fruit shape are syntenic and separated by m....
Genetic Analysis: An Integrated Approach (3rd Edition)
Q1. Which wavelength of light has the highest frequency?
a) 10 nm
b) 10 mm
c) 1 nm
d) 1 mm
Chemistry: A Molecular Approach (4th Edition)
1. Why is the quantum-mechanical model of the atom important for understanding chemistry?
Chemistry: Structure and Properties (2nd Edition)
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).arrow_forwardGive the notation for a voltaic cell whose overall cell reaction is Mg(s)+2Ag+(aq)Mg2+(aq)+2Ag(s) What are the half-cell reactions? Label them as anode or cathode reactions. What is the standard cell potential of this cell?arrow_forwardAn aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?arrow_forward
- Use the data from the table of standard reduction potentials in Appendix H to calculate the standard potential of the cell based on each of the following reactions. In each case, state whether the reaction proceeds spontaneously as written or spontaneously in the reverse direction under standard-state conditions. (a) H2(g)+Cl2(g)2H+(aq)+2Cl(aq) (b) Al3+(aq)+3Cr2+(aq)Al(s)+3Cr3+(aq) (c) Fe2+(aq)+Ag+(aq)Fe3+(aq)+Ag(s)arrow_forwardA standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.arrow_forwardUse chemical equations to explain how the molten carbonate fuel cell (MCFC) works. What are its advantages and its disadvantages?arrow_forward
- For a voltage-sensitive application, you are working on a battery that must have a working voltage of 0.85 V. The half-cells to be used have a standard cell potential of 0.97 V. What must be done to achieve the correct voltage? What information would you need to look up?arrow_forwardIf you put a 9-volt battery in a smoke detector in your home or apartment, you are not installing a single galvanic cell. Explain how and why this is so.arrow_forwardA fuel cell designed to react grain alcohol with oxygen has the following net reaction: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) The maximum work that 1 mole of alcohol can do is 1.32 103 kJ. What is the theoretical maximum voltage this cell can achieve at 25C?arrow_forward
arrow_back_ios
arrow_forward_ios
Recommended textbooks for you
Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co
World of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage Learning
Introductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
Introductory Chemistry: An Active Learning Approa...ChemistryISBN:9781305079250Author:Mark S. Cracolice, Ed PetersPublisher:Cengage Learning
Living By Chemistry: First Edition TextbookChemistryISBN:9781559539418Author:Angelica StacyPublisher:MAC HIGHER
Chemistry: The Molecular Science
Chemistry
ISBN:9781285199047
Author:John W. Moore, Conrad L. Stanitski
Publisher:Cengage Learning
Chemistry: Matter and Change
Chemistry
ISBN:9780078746376
Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom
Publisher:Glencoe/McGraw-Hill School Pub Co
World of Chemistry, 3rd edition
Chemistry
ISBN:9781133109655
Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste
Publisher:Brooks / Cole / Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781337399425
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Introductory Chemistry: An Active Learning Approa...
Chemistry
ISBN:9781305079250
Author:Mark S. Cracolice, Ed Peters
Publisher:Cengage Learning
Living By Chemistry: First Edition Textbook
Chemistry
ISBN:9781559539418
Author:Angelica Stacy
Publisher:MAC HIGHER
Introduction to Electrochemistry; Author: Tyler DeWitt;https://www.youtube.com/watch?v=teTkvUtW4SA;License: Standard YouTube License, CC-BY