Chemistry by OpenStax (2015-05-04)
1st Edition
ISBN: 9781938168390
Author: Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser
Publisher: OpenStax
expand_more
expand_more
format_list_bulleted
Videos
Textbook Question
Chapter 17, Problem 39E
Why do batteries go dead, but fuel cells do not?
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solution
Chapter 17 Solutions
Chemistry by OpenStax (2015-05-04)
Ch. 17 - If a 2.5 A current is run through a circuit for 35...Ch. 17 - For the scenario in the previous question, how...Ch. 17 - For each of the following balanced half-reactions,...Ch. 17 - For each of the following balanced half-reactions,...Ch. 17 - Given the following pairs of balanced...Ch. 17 - Balance the following in acidic solution: (a)...Ch. 17 - Identify the species that undergoes oxidation, the...Ch. 17 - Balance the following in acidic solution: (a)...Ch. 17 - Identify the species that was oxidized, the...Ch. 17 - Why is it not possible for hydroxide ion (OH-) to...
Ch. 17 - Why is it not possible for hydrogen ion (H+) to...Ch. 17 - Why must the charge balance in oxidation-reduction...Ch. 17 - Write the following balanced reactions using cell...Ch. 17 - Given the following cell notations, determine the...Ch. 17 - For the cell notations in the previous problem,...Ch. 17 - Balance the following reactions and write the...Ch. 17 - Identify the species oxidized species reduced, and...Ch. 17 - From the information provided, use cell notation...Ch. 17 - Why is a salt bridge necessary in galvanic cells...Ch. 17 - An active (metal) electrode was found to gain mass...Ch. 17 - An active (metal) electrode was found to lose mass...Ch. 17 - The mass of three different metal electrodes, each...Ch. 17 - For each reaction listed, determine its standard...Ch. 17 - For each reaction listed, determine its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - For the standard cell potentials given here,...Ch. 17 - For the ?G values given here, determine the...Ch. 17 - Determine the standard cell potential and the cell...Ch. 17 - Determine G and G for each of the reactions in...Ch. 17 - Use the data in Appendix L to determine the...Ch. 17 - What are the desirable qualities of an electric...Ch. 17 - List some things that are typically considered...Ch. 17 - Consider a battery made from one half-cell that...Ch. 17 - Consider a battery with the overall reaction:...Ch. 17 - An inventor proposes using a SHE (standard...Ch. 17 - Why do batteries go dead, but fuel cells do not?Ch. 17 - Explain what happens to battery voltage as a...Ch. 17 - Using the information thus far in this chapter,...Ch. 17 - Which member of each pair of metals is more likely...Ch. 17 - Consider the following metals: Ag, Au, Mg, Ni, and...Ch. 17 - Aluminum (E Al 3+/Al=2.07V) is more easily...Ch. 17 - If a sample of iron and a sample of zinc come into...Ch. 17 - Suppose you have three different metals. A, B, and...Ch. 17 - Why would a sacrificial anode made of lithium...Ch. 17 - Identify the reaction at the anode, reaction at...Ch. 17 - What mass of each product is produced in each of...Ch. 17 - How long would it take to reduce 1 mole of each of...Ch. 17 - A current of 2.345 A passes through the cell shown...Ch. 17 - An irregularly shaped metal part made from a...
Additional Science Textbook Solutions
Find more solutions based on key concepts
a) What is the mechanical advantage of a wheelbarrow, such as the one in Figure 9.24, if the center of gravity ...
College Physics
Predict whether a precipitation reaction will occur when aqueous solutions of the following substances are mixe...
CHEMISTRY-TEXT
a. Which compound has the stretching vibration for its carbonyl group at the highest frequency: acetyl chloride...
Organic Chemistry
Two curves for the same reaction are shown in the following reaction energy diagram. Which curve represents the...
General, Organic, and Biological Chemistry (3rd Edition)
3. What are prefix multipliers? List some examples.
Chemistry: Structure and Properties (2nd Edition)
33. Consider the unbalanced chemical equation.
A chemistry student tries to balance the equation by placing th...
Introductory Chemistry (5th Edition) (Standalone Book)
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- Consider the following cell running under standard conditions: Fe(s)Fe2+(aq)Al3+(aq)Al(s) a Is this a voltaic cell? b Which species is being reduced during the chemical reaction? c Which species is the oxidizing agent? d What happens to the concentration of Fe3+(aq) as the reaction proceeds? e How does the mass of Al(s) change as the reaction proceeds?arrow_forwardUse chemical equations to explain how the molten carbonate fuel cell (MCFC) works. What are its advantages and its disadvantages?arrow_forwardGive the notation for a voltaic cell whose overall cell reaction is Mg(s)+2Ag+(aq)Mg2+(aq)+2Ag(s) What are the half-cell reactions? Label them as anode or cathode reactions. What is the standard cell potential of this cell?arrow_forward
- If you put a 9-volt battery in a smoke detector in your home or apartment, you are not installing a single galvanic cell. Explain how and why this is so.arrow_forwardFor a voltage-sensitive application, you are working on a battery that must have a working voltage of 0.85 V. The half-cells to be used have a standard cell potential of 0.97 V. What must be done to achieve the correct voltage? What information would you need to look up?arrow_forwardAn aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?arrow_forward
- List some things that are typically considered when selecting a battery for a new application.arrow_forwardThe voltaic cell is represented as Zn(s)Zn2+(1.0M)Cu2+(1.0M)Cu(s) Which of the following statements is not true of this cell? a The mass of the zinc electrode, Zn(s), decreases as the cell runs. b The copper electrode is the anode. c Electrons flow through the external circuit from the zinc electrode to the copper electrode. d Reduction occurs at the copper electrode as the cell runs. e The concentration of Cu2+ decreases as the cell runs.arrow_forwardZinc react spontaneously with silver ion. Zn(s)+2Ag+(aq)Zn2+(aq)+2Ag(s) Describe a voltaic cell using this reaction. What are the half-reactions?arrow_forward
- Consider the following galvanic cell: Calculate the concentrations of Ag+(aq) and Ni2+(aq) once the cell is dead.arrow_forwardAs the voltaic cell shown here runs, the blue solution gradually gets lighter in color and the gray solution gets darker. (a) What species is oxidized and what is reduced? (b) Which electrode is the anode and which is the cathode? (C) Which metal electrode gains mass? (d) In which direction do electrons flow through the external circuit?arrow_forwardA fuel cell designed to react grain alcohol with oxygen has the following net reaction: C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) The maximum work that 1 mole of alcohol can do is 1.32 103 kJ. What is the theoretical maximum voltage this cell can achieve at 25C?arrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
World of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage Learning
Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co
Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
Introductory Chemistry: A FoundationChemistryISBN:9781285199030Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
Introductory Chemistry: An Active Learning Approa...ChemistryISBN:9781305079250Author:Mark S. Cracolice, Ed PetersPublisher:Cengage Learning
Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
World of Chemistry, 3rd edition
Chemistry
ISBN:9781133109655
Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste
Publisher:Brooks / Cole / Cengage Learning
Chemistry: Matter and Change
Chemistry
ISBN:9780078746376
Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom
Publisher:Glencoe/McGraw-Hill School Pub Co
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781285199030
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Introductory Chemistry: An Active Learning Approa...
Chemistry
ISBN:9781305079250
Author:Mark S. Cracolice, Ed Peters
Publisher:Cengage Learning
Chemistry: The Molecular Science
Chemistry
ISBN:9781285199047
Author:John W. Moore, Conrad L. Stanitski
Publisher:Cengage Learning
Introduction to Electrochemistry; Author: Tyler DeWitt;https://www.youtube.com/watch?v=teTkvUtW4SA;License: Standard YouTube License, CC-BY