Chemistry by OpenStax (2015-05-04)
1st Edition
ISBN: 9781938168390
Author: Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser
Publisher: OpenStax
expand_more
expand_more
format_list_bulleted
Textbook Question
Chapter 17, Problem 11E
Why is it not possible for hydrogen ion (H+) to appear in either of the half-reactions or the overall equation when balancing oxidation−reduction reactions in basic solution?
Expert Solution & Answer
Want to see the full answer?
Check out a sample textbook solution
Chapter 17 Solutions
Chemistry by OpenStax (2015-05-04)
Ch. 17 - If a 2.5 A current is run through a circuit for 35...Ch. 17 - For the scenario in the previous question, how...Ch. 17 - For each of the following balanced half-reactions,...Ch. 17 - For each of the following balanced half-reactions,...Ch. 17 - Given the following pairs of balanced...Ch. 17 - Balance the following in acidic solution: (a)...Ch. 17 - Identify the species that undergoes oxidation, the...Ch. 17 - Balance the following in acidic solution: (a)...Ch. 17 - Identify the species that was oxidized, the...Ch. 17 - Why is it not possible for hydroxide ion (OH-) to...
Ch. 17 - Why is it not possible for hydrogen ion (H+) to...Ch. 17 - Why must the charge balance in oxidation-reduction...Ch. 17 - Write the following balanced reactions using cell...Ch. 17 - Given the following cell notations, determine the...Ch. 17 - For the cell notations in the previous problem,...Ch. 17 - Balance the following reactions and write the...Ch. 17 - Identify the species oxidized species reduced, and...Ch. 17 - From the information provided, use cell notation...Ch. 17 - Why is a salt bridge necessary in galvanic cells...Ch. 17 - An active (metal) electrode was found to gain mass...Ch. 17 - An active (metal) electrode was found to lose mass...Ch. 17 - The mass of three different metal electrodes, each...Ch. 17 - For each reaction listed, determine its standard...Ch. 17 - For each reaction listed, determine its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - Determine the overall reaction and its standard...Ch. 17 - For the standard cell potentials given here,...Ch. 17 - For the ?G values given here, determine the...Ch. 17 - Determine the standard cell potential and the cell...Ch. 17 - Determine G and G for each of the reactions in...Ch. 17 - Use the data in Appendix L to determine the...Ch. 17 - What are the desirable qualities of an electric...Ch. 17 - List some things that are typically considered...Ch. 17 - Consider a battery made from one half-cell that...Ch. 17 - Consider a battery with the overall reaction:...Ch. 17 - An inventor proposes using a SHE (standard...Ch. 17 - Why do batteries go dead, but fuel cells do not?Ch. 17 - Explain what happens to battery voltage as a...Ch. 17 - Using the information thus far in this chapter,...Ch. 17 - Which member of each pair of metals is more likely...Ch. 17 - Consider the following metals: Ag, Au, Mg, Ni, and...Ch. 17 - Aluminum (E Al 3+/Al=2.07V) is more easily...Ch. 17 - If a sample of iron and a sample of zinc come into...Ch. 17 - Suppose you have three different metals. A, B, and...Ch. 17 - Why would a sacrificial anode made of lithium...Ch. 17 - Identify the reaction at the anode, reaction at...Ch. 17 - What mass of each product is produced in each of...Ch. 17 - How long would it take to reduce 1 mole of each of...Ch. 17 - A current of 2.345 A passes through the cell shown...Ch. 17 - An irregularly shaped metal part made from a...
Additional Science Textbook Solutions
Find more solutions based on key concepts
What energy transformations are involved when a dragster engine is revved, its clutch let out rapidly, its tire...
College Physics
For the generic equilibrium HA(aq) ⇌ H + (aq) + A- (aq), which of these statements is true?
The equilibrium con...
Chemistry: The Central Science (13th Edition)
Whatis the molecular formula of a gaseous fluoride of sulfur containing 70.4% F and having a density of approxi...
General Chemistry: Principles and Modern Applications (11th Edition)
1. Why is the quantum-mechanical model of the atom important for understanding chemistry?
Chemistry: Structure and Properties
1. Why is the quantum-mechanical model of the atom important for understanding chemistry?
Chemistry: Structure and Properties (2nd Edition)
Q1. Which wavelength of light has the highest frequency?
a) 10 nm
b) 10 mm
c) 1 nm
d) 1 mm
Chemistry: A Molecular Approach (4th Edition)
Knowledge Booster
Similar questions
- Classify each of the following half-reaction equations as oxidation or reduction half-reactions: a ZnZn2++2e b 2H++2eH2 c Fe2+Fe3++e d NO+2H2ONO3+4H++3earrow_forwardCalculate the equilibrium constant at 25 C for the reaction 2 Ag+(aq) + Hg() 2 Ag(s) + Hg2+(aq)arrow_forwardWhy is it not possible for hydroxide ion (OH-) to appear in either of the half-reactions or the overall equation when balancing oxidation—reduction reactions in acidic solution?arrow_forward
- Consider the following cell running under standard conditions: Fe(s)Fe2+(aq)Al3+(aq)Al(s) a Is this a voltaic cell? b Which species is being reduced during the chemical reaction? c Which species is the oxidizing agent? d What happens to the concentration of Fe3+(aq) as the reaction proceeds? e How does the mass of Al(s) change as the reaction proceeds?arrow_forwardWhat is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?arrow_forwardCalculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)arrow_forward
- Assign the oxidation numbers of all atoms in the following species. (a) PF5 (b) Na2CrO4 (c) NO2arrow_forwardAt 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.arrow_forwardAt 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.arrow_forward
- For the reaction Cu2+(aq) + Zn(s) → Cu(s) + Zn2+ (aq), why can’t you generate electric current by placing a piece of copper metal and a piece of zinc metal in a solution containing CuCl2(aq) and ZnCl2(aq)?arrow_forwardWrite balanced equations for the following half-reactions. Specify whether each is an oxidation or reduction. (a) H2O2(aq) O2(g)(in acid) (b) H2C2O4(aq) CO2(g)(in acid) (c) NO3(aq) NO(g)(in acid) (d) MnO4(aq) MnO2(s)(in base)arrow_forwardSome metals, such as thallium, can be oxidized to more than one oxidation state. Obtain the balanced net ionic equations for the following oxidation reduction reactions, in which nitric acid is reduced to nitric oxide, NO. a Oxidation of thallium metal to thallium(I) ion by nitric acid. b Oxidation of thallium(I) ion to thallium(III) ion by nitric acid. c Oxidation of thallium metal to thallium(III) by nitric acid. [Consider adding the a and b equations.]arrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax
Introductory Chemistry: An Active Learning Approa...ChemistryISBN:9781305079250Author:Mark S. Cracolice, Ed PetersPublisher:Cengage Learning
Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
Principles of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage Learning
Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co
General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
Chemistry by OpenStax (2015-05-04)
Chemistry
ISBN:9781938168390
Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark Blaser
Publisher:OpenStax
Introductory Chemistry: An Active Learning Approa...
Chemistry
ISBN:9781305079250
Author:Mark S. Cracolice, Ed Peters
Publisher:Cengage Learning
Chemistry: The Molecular Science
Chemistry
ISBN:9781285199047
Author:John W. Moore, Conrad L. Stanitski
Publisher:Cengage Learning
Principles of Modern Chemistry
Chemistry
ISBN:9781305079113
Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler
Publisher:Cengage Learning
Chemistry: Matter and Change
Chemistry
ISBN:9780078746376
Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom
Publisher:Glencoe/McGraw-Hill School Pub Co
General Chemistry - Standalone book (MindTap Cour...
Chemistry
ISBN:9781305580343
Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell
Publisher:Cengage Learning