(a)
Interpretation : At equilibrium the value of
Concept Introduction :
The Arrhenius equation is used to determine the temperature dependence of the
Activation energy (in the same units as R*T)
(a)
Interpretation : A catalyst can increase the rate of forward reaction but not the reverse reaction is that statement is true or false.
Concept Introduction :
The catalysis is the process of increasing the rate of the
Want to see the full answer?
Check out a sample textbook solutionChapter 15 Solutions
Chemical Principles
- A process that is reactant-favored at equilibrium can never be spontaneous. This statement is (a) true (b) falsearrow_forwardCarbon dioxide decomposes into CO and O2 at elevated temperatures. What is the equilibrium partial pressure of oxygen in a sample at 1000 C for which the initial pressure of CO2 was 1.15 atm?arrow_forwardTitanium(IV) oxide is converted to titanium carbide with carbon at a high temperature. TiO2(s) + 3 C(s) 2 CO(g) + TiC(s) (a) Calculate rG and K at 727 C. (b) Is the reaction product-favored at equilibrium at this temperature? (c) How can the reactant or product concentrations be adjusted for the reaction to proceed at 727 C?arrow_forward
- The standard equilibrium constant is 2.1109for this reaction at 25 C Zn2+(aq)+4NH3(aq)Zn(NH3)42+(aq) (a) Calculate rG at this temperature. (b) If standard-state concentrations of the reactants andproducts are combined, in which direction will the reaction proceed? (c) Calculate rG when [Zn(NH3)42+] = 0.010 M, [Zn2+] =0.0010 M, and [NH3] = 3.5104M.arrow_forwardConsider the reaction 2SO2(g)+O2(g)2SO3(g) (a) Calculate G at 25C. (b) If the partial pressures of SO2 and SO3 are kept at 0.400 atm, what partial pressure should O2 have so that the reaction just becomes nonspontaneous (i.e., G=+1.0 k J)?arrow_forwardMonochloroethane (C2H5Cl) can be produced by the direct reaction of ethane gas (C2H6) with chlorine gas or by the reaction of ethylene gas (C2H4) with hydrogen chloride gas. The second reaction gives almost a 100% yield of pure C2H5Cl at a rapid rate without catalysis. The first method requires light as an energy source or the reaction would not occur. Yet G for the first reaction is considerably more negative than G for the second reaction. Explain how this can be so.arrow_forward
- Elemental boron, in the form of thin fibers, can be made by reducing a boron halide with H2. BCl3(g) + 32 H2(g) B(s) + 3 HCl(g) Calculate rH, rS, and rG at 25 C for this reaction. Is the reaction predicted to be product-favored at equilibrium at 25 C? If so, is it enthalpy- or entropy-driven? [S for B(s) is 5.86 J/K mol.]arrow_forwardConsider the following relationships: G = 1, H = TS, Q = 1. G = G, K = 1 Which of these relationships is(are) always true for a reaction at equilibrium?arrow_forwardCobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.arrow_forward
- Hydrogenation, the addition of hydrogen to an organic compound, is an industrially important reaction. Calculate rH, rS, and rG for the hydrogenation of octene, C8H16, to give octane, C8H19 at 25 C. Is the reaction product- or reactant-favored at equilibrium? C8H16(g) + H2(g) C8H18(g) Along with data in Appendix L, the following information is needed for this calculation.arrow_forwardAdenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?arrow_forwardConsider the equation G = G + RT ln(Q). What is the value of G for a reaction at equilibrium? What does Q equal at equilibrium? At equilibrium, the previous equation reduces to G = RT ln(K). When G 0, what does it indicate about K? When G 0, what does it indicate about K? When t G = 0, what does it indicate about K? G predicts spontaneity for a reaction, whereas G predicts the equilibrium position. Explain what this statement means. Under what conditions can you use G to determine the spontaneity of a reaction?arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning