In a generic chemical reaction involving reactants A and B and products C and D, aA + bB cC + dD, the standard enthalpy AHxn of the reaction is given by AHxn = CAH; (C) + dAH; (D) —aAH; (A) – bAH; (B) Notice that the stoichiometric coefficients, a, b, c, d, are an important part of this equation. This formula is often generalized as follows, where the first sum on the right-hand side of the equation is a sum over the products and the second sum is over the reactants: AHrxn = Σproducts NAH; - reactants mAH where m and n represent the appropriate stoichiometric coefficients for each substance. Part A What is AHxn for the following chemical reaction? CS2(g) + 2H₂O(1)→CO2(g) + 2H₂S(g) You can use the following table of standard heats of formation (AH) to calculate the enthalpy of the given reaction. HA Element/Compound H(g) H₂(g) H₂O(1) CS₂ (g) Value C(g) C(s) Units Standard Heat of Formation (kJ/mol) ? 218 0 -285.8 116.7 71 0 Element/ Compound Express the standard enthalpy of reaction to three significant figures and include the appropriate units. ► View Available Hint(s) N(g) O₂(g) O(g) H₂S(g) CO₂(g) HNO3(aq) Standard Heat of Formation (kJ/mol) 473 0 249 -20.60kJ -393.5kJ -206.6

In a generic chemical reaction involving reactants A and B and products C and D, aA + bB cC + dD, the standard enthalpy AHxn of the reaction is given by AHxn = CAH; (C) + dAH; (D) —aAH; (A) – bAH; (B) Notice that the stoichiometric coefficients, a, b, c, d, are an important part of this equation. This formula is often generalized as follows, where the first sum on the right-hand side of the equation is a sum over the products and the second sum is over the reactants: AHrxn = Σproducts NAH; - reactants mAH where m and n represent the appropriate stoichiometric coefficients for each substance. Part A What is AHxn for the following chemical reaction? CS2(g) + 2H₂O(1)→CO2(g) + 2H₂S(g) You can use the following table of standard heats of formation (AH) to calculate the enthalpy of the given reaction. HA Element/Compound H(g) H₂(g) H₂O(1) CS₂ (g) Value C(g) C(s) Units Standard Heat of Formation (kJ/mol) ? 218 0 -285.8 116.7 71 0 Element/ Compound Express the standard enthalpy of reaction to three significant figures and include the appropriate units. ► View Available Hint(s) N(g) O₂(g) O(g) H₂S(g) CO₂(g) HNO3(aq) Standard Heat of Formation (kJ/mol) 473 0 249 -20.60kJ -393.5kJ -206.6

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

An equilibrium constant for the reaction decreases twice when temperature increases from 300 K to 350 K. What is the standard enthalpy for the reaction? Round off your answer to 3 significant figures and enter it correct units.
Gypsum is the hydrate of calcium sulfate, CaSO4 · 2 H2O. It is the primary material in sheet rock, used to make walls in houses. If you heat 21.05 g of the hydrate and drive off the water, what is the weight of the anhydrous salt remaining? Report your response to the proper degree of certainty and include the correct unit symbol (i.e., g, mL, km, etc.).
(2B) A heat engine operates between a hot source at 130.°C and a cold sink at 10.°C. How much workcan be done by the engine if 523 kJ of heat are extracted from the hot source?
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
the standard heat of formation of lead nitrate corresponds to the reaction
A critical reaction in the production of energy to do work or drive chemical reactions in biological systems is the hydrolysis of adenosine triphosphate, ATP, to adenosine diphosphate, ADP, as described by the reaction АТР(аq) + H,О() — ADP(aq) + НРО (аq) ADP(aq) + HPO (aq) for which AGixn = -30.5 kJ/mol at 37.0 °C and pH 7.0. Calculate the value of AGrxn in a biological cell in which [ATP] = 5.0 mM, [ADP] = 0.40 mM, and [HPO;-] = 5.0 mM. AGrxn kJ/mol * TOOLS x10 Is the hydrolysis of ATP spontaneous under these conditions? yes no
i need solution of all parts . please
ab
Esc ||| = OTHERMOCHEMISTRY A student runs two experiments with a constant-volume "bomb" calorimeter containing 1200. g of water (see sketch at right). Calculating heat of reaction from bomb calorimetry data First, a 5.000 g tablet of benzoic acid (C6H,CO₂H) is put into the "bomb" and burned completely in an excess of oxygen. (Benzoic acid is known to have a heat of combustion of 26.454 kJ/g.) The temperature of the water is observed to rise from 16.00 °C to 38.96 °C over a time of 9.2 minutes. 2 4. Next, 5.730 g of acetaldehyde (C₂H₂O) are put into the "bomb" and similarly completely burned in an excess of oxygen. This time the temperature of the water rises from 16.00 °C to 42.19 °C. 84°F Sunny Use this information, and any other information you need from the ALEKS Data resource, to answer the questions below about this reaction: FI Explanation Is this reaction exothermic, endothermic, or neither? 4- F₂ Check 2C₂H4O(g) + 50₂(g) 4CO₂(g) + 4H₂O(g) Be sure any of your answers that are…
259 kg of water with a temperature of 27.4 °C is heated through complete combustion of benzoic acid. If 4.19 moles of benzoic acid were used in heating the water, what is the expected final temperature of the water? The reaction and heat of combustion for benzoic acid are given below. 1502(g) + 2C6H5COOH(aq) → 14CO2(9) + 6H20(1) AH = -3227 kJ/mol 24.4 °C 39.9 °C 14.9 °C 30.4 °C 28.1 °C
2. The predominant forms of heavy metals (Zn, Pb, Fe, Cu, Ni, etc.) in aerobic sediments are the carbonates and the oxide or hydroxide forms. An important consideration in modeling the sediment is the stable chemical form of the metal in question. Consider the reaction: AG = 25 kJ/mol Pb(OH)₂ (s) + CO₂(aq) → PbCO₂ (s) + H₂O a. At what partial pressure of CO₂(g) will Pb(OH)2(s) and PbCO3(s) be at equilibrium? b. If the system is at equilibrium with the atmosphere, Pc02-10-3.38 atm, calculate 4G for the reaction. What is the stable form of lead in the sediments?
molar enthalpy of formation of H2O(l) from its elements in their standard states (25 oC and 100 kPa)?