At 25 °C, the standard enthalpy of formation of HF (aq) is - 319.9kJmolit is - 285.8Part 1 of 2Calculate the standard enthalpy of neutralization of HF (aq):HF (aq) + OH(aq) → F¯(aq) + H₂O (1)Be sure your answer has the correct number of significant digits.kJmol- 66.4Part: 1/2Part 2 of 2KJmol-of OH (aq), it is -229.6-Using the value of -56.2 kJ as the standard enthalpy change for the reactionH(aq) + OH (aq) → H₂0 (1)Calculate the standard enthalpy of change for the reactionHF (aq)H(aq) + F (aq)Be sure your answer has the correct number of significant digits.molof F (aq), it is -330.1moland of H₂O (1),

Answer-2 Enthalpy of reaction is an extensive property, so it can be added or subtracted the way…

Part 1 of 2 Calculate the standard enthalpy of neutralization of HF (aq): HF (aq) + OH (aq) → F (aq) + H₂O (1) Be sure your answer has the correct number of significant digits. kJ mol 66.4 Part: 1 / 2 Part 2 of 2 Using the value of -56.2 kJ as the standard enthalpy change for the reaction H(aq) + OH(aq) → H₂0 (1) Calculate the standard enthalpy of change for the reaction HF (aq) H(aq) + F (aq) Be sure your answer has the correct number of significant digits.

Part 1 of 2 Calculate the standard enthalpy of neutralization of HF (aq): HF (aq) + OH (aq) → F (aq) + H₂O (1) Be sure your answer has the correct number of significant digits. kJ mol 66.4 Part: 1 / 2 Part 2 of 2 Using the value of -56.2 kJ as the standard enthalpy change for the reaction H(aq) + OH(aq) → H₂0 (1) Calculate the standard enthalpy of change for the reaction HF (aq) H(aq) + F (aq) Be sure your answer has the correct number of significant digits.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Please help me decipher what I'm doing wrong in this problem I think I may have switched factors or added unnecessary factors.
2.948 g of NH4Cl (53.19 g/mol) are added to 50.0 mL of water (18.02 g/mol, density = 1.00 g/mL) and the temperature changes from 22.30oC to 18.90oC. Use this information to calculate the enthalpy change (kJ/mol) for the reaction illustrated in equation 6 of the laboratory procedure. Use 4.18 J/(goC) as the specific heat of the solution.
An equilibrium constant for the reaction decreases twice when temperature increases from 300 K to 350 K. What is the standard enthalpy for the reaction? Round off your answer to 3 significant figures and enter it correct units.
1.Given reactions A - C, determine the the change in enthalpy (kJ) for the reaction between C(s) + H2(g). Do not type units into your answer. C(graphite) + 2 H2(g) ⟶⟶ CH4(g) Δ?=?ΔH=? A. C(graphite) + O2(g) ⟶⟶ CO2(g) Δ?=−393.51??ΔH=−393.51kJB. H2(g) + 1/2 O2(g) ⟶⟶ H2O(l) Δ?=−285.83??ΔH=−285.83kJC. CO2(g) + 2 H2O(l) ⟶⟶ CH4(g) + 2 O2(g) Δ?=890.30??ΔH=890.30kJ 2. Based on your answer to the previous problem, determine the value of q (kJ) if 5.08 grams of methane (CH4) gas is produced from graphite and hydrogen gas. Do not type units into your answer.
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
2.857 g of NH4Cl (53.19 g/mol) are added to 50.0 mL of water (18.02 g/mol, density = 1.00 g/mL) and the temperature changes from 22.30oC to 18.90oC. Use this information to calculate the enthalpy change (kJ/mol) for the reaction illustrated in equation 6 of the laboratory procedure. Use 4.18 J/(goC) as the specific heat of the solution. The equation is NH4Cl (s) --> NH4Cl (aq)
2.887 g of NH4Cl (53.19 g/mol) are added to 50.0 mL of water (18.02 g/mol, density = 1.00 g/mL) and the temperature changes from 22.30oC to 18.90oC. Use this information to calculate the enthalpy change (kJ/mol) for the reaction illustrated in equation 6 of the laboratory procedure. Use 4.18 J/(goC) as the specific heat of the solution. (6) NH4Cl(s) → NH4Cl(aq) ∆H6 (measured) Your answer should have 3 sig figs
dont hend written solution
Part III: Determine the molar enthalpy change for reaction 3 using Hess’s law HCl(aq) + NH3(aq) ® NH4Cl(aq) DH3 = A. In the space below, show all calculation set-ups to determine the molar heat of enthalpy, in kJ/mol HCl, of reaction 3 (DH3). For full credit, all numerical answers must be rounded off to correct sig figs and with proper units
3H2SO4 (aq) + 2Al(s). ----> Al2(SO4)3 (aq) + 3H2 (g) DeltaH = - 1055kJ a. What is the enthalpy change when 35.3 mL of 0.430 M sulfuric acid reacts with 0.436 g aluminum? b. Calculate the standard enthalpy of formation for Al2(SO4)3 (aq)
The standard heat of formation, AH;, is defined as the enthalpy change for the formation of one mole of Part B substance from its constituent elements in their standard states. Thus, elements in their standard states have AH: = 0. Heat of formation values can be used The combustion of ethene, C2H4, occurs via the reaction to calculate the enthalpy change of any reaction. C2H4 (g) + 302 (g)→2CO2(g) + 2H20(g) Consider, for example, the reaction with heat of formation values given by the following table: 2NΟ (5) + Ο, (s) 2ΝO, (g) ΔΗρ (kJ/mol) Substance with heat of formation values given by the following table: C2H4 (g) 52.47 CO2 (g) -393.5 Substance (kJ/mol) H2O(g) -241.8 NO(g) 90.2 Calculate the enthalpy for the combustion of ethene. 02 (g) Express your answer to four significant figures and include the appropriate units. NO2(g) 33.2 • View Available Hint(s) Then the heat of formation for the overall reaction is ΔΗ ΔΗ (products) -ΔΗ; (reactants ) [2(90.2) + 0] HA ? 2(33.2) -114 kJ/mol…