At 25 °C, the standard enthalpy of formation of HF (aq) is - 319.9kJmolit is - 285.8Part 1 of 2Calculate the standard enthalpy of neutralization of HF (aq):HF (aq) + OH(aq) → F¯(aq) + H₂O (1)Be sure your answer has the correct number of significant digits.kJmol- 66.4Part: 1/2Part 2 of 2KJmol-of OH (aq), it is -229.6-Using the value of -56.2 kJ as the standard enthalpy change for the reactionH(aq) + OH (aq) → H₂0 (1)Calculate the standard enthalpy of change for the reactionHF (aq)H(aq) + F (aq)Be sure your answer has the correct number of significant digits.molof F (aq), it is -330.1moland of H₂O (1),

Answer-2 Enthalpy of reaction is an extensive property, so it can be added or subtracted the way…

Part 1 of 2 Calculate the standard enthalpy of neutralization of HF (aq): HF (aq) + OH (aq) → F (aq) + H₂O (1) Be sure your answer has the correct number of significant digits. kJ mol 66.4 Part: 1 / 2 Part 2 of 2 Using the value of -56.2 kJ as the standard enthalpy change for the reaction H(aq) + OH(aq) → H₂0 (1) Calculate the standard enthalpy of change for the reaction HF (aq) H(aq) + F (aq) Be sure your answer has the correct number of significant digits.

Part 1 of 2 Calculate the standard enthalpy of neutralization of HF (aq): HF (aq) + OH (aq) → F (aq) + H₂O (1) Be sure your answer has the correct number of significant digits. kJ mol 66.4 Part: 1 / 2 Part 2 of 2 Using the value of -56.2 kJ as the standard enthalpy change for the reaction H(aq) + OH(aq) → H₂0 (1) Calculate the standard enthalpy of change for the reaction HF (aq) H(aq) + F (aq) Be sure your answer has the correct number of significant digits.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter1: Chemical Foundations

Section: Chapter Questions

Problem 1RQ: Define and explain the differences between the following terms. a. law and theory b. theory and...

See similar textbooks

Similar questions

Please help me decipher what I'm doing wrong in this problem I think I may have switched factors or added unnecessary factors.
2.948 g of NH4Cl (53.19 g/mol) are added to 50.0 mL of water (18.02 g/mol, density = 1.00 g/mL) and the temperature changes from 22.30oC to 18.90oC. Use this information to calculate the enthalpy change (kJ/mol) for the reaction illustrated in equation 6 of the laboratory procedure. Use 4.18 J/(goC) as the specific heat of the solution.
An equilibrium constant for the reaction decreases twice when temperature increases from 300 K to 350 K. What is the standard enthalpy for the reaction? Round off your answer to 3 significant figures and enter it correct units.
Please provide clear solution. Thank you!
1.Given reactions A - C, determine the the change in enthalpy (kJ) for the reaction between C(s) + H2(g). Do not type units into your answer. C(graphite) + 2 H2(g) ⟶⟶ CH4(g) Δ?=?ΔH=? A. C(graphite) + O2(g) ⟶⟶ CO2(g) Δ?=−393.51??ΔH=−393.51kJB. H2(g) + 1/2 O2(g) ⟶⟶ H2O(l) Δ?=−285.83??ΔH=−285.83kJC. CO2(g) + 2 H2O(l) ⟶⟶ CH4(g) + 2 O2(g) Δ?=890.30??ΔH=890.30kJ 2. Based on your answer to the previous problem, determine the value of q (kJ) if 5.08 grams of methane (CH4) gas is produced from graphite and hydrogen gas. Do not type units into your answer.
C2H5OH(l)+3O2(g)=2CO2(g)+3H2O(l) The reaction enthalpy for standard conditions. I got the answer of -1,367 is this correct?
Determine the molar enthalpy change for reaction 3 using Hess’s law HCl(aq) + NH3(aq) ® NH4Cl(aq) DH3 = A. In the space below, show all calculation set-ups to determine the molar heat of enthalpy, in kJ/mol HCl, of reaction 3 (DH3). All numerical answers must be rounded off to correct sig figs and with proper units. If the true value of DH3 is –52.2 kJ/mol, calculate the percent error. Round off the answer in correct sig figs.
2.857 g of NH4Cl (53.19 g/mol) are added to 50.0 mL of water (18.02 g/mol, density = 1.00 g/mL) and the temperature changes from 22.30oC to 18.90oC. Use this information to calculate the enthalpy change (kJ/mol) for the reaction illustrated in equation 6 of the laboratory procedure. Use 4.18 J/(goC) as the specific heat of the solution. The equation is NH4Cl (s) --> NH4Cl (aq)
THERMODYNAMICS: Given the following hypothetical thermochemical equations: 20J3 (g) + 302x (g) – 402 (g) + 3J2X () AH = -1,017.3 kJ 4QJ3 (e) + 3X2 (@) – 202 (g) + 6J2X (1) AH = -1,548.8 kJ Calculate the value of AH (in kJ) for the reaction: a2 (g) + % X2 (a) - Q2X (g) (Round off the final answer to ONE decimal place. Do not include unit.)
21. The enthalpy changes of these reactions can be measured: AH° = -1411.1 kJ C,H,(g) +30,(g) C,H,OH(C) + 3 0,(g) 2 CO,(g) +2 H,O(€) 2 CO,(g) + 3 H,0(e) 1) AH° =-1367.5 kJ - Use these values and Hess's law to determine the enthalpy change for the reaction CH,(g) + H,0(() CH,OH(€)
2.887 g of NH4Cl (53.19 g/mol) are added to 50.0 mL of water (18.02 g/mol, density = 1.00 g/mL) and the temperature changes from 22.30oC to 18.90oC. Use this information to calculate the enthalpy change (kJ/mol) for the reaction illustrated in equation 6 of the laboratory procedure. Use 4.18 J/(goC) as the specific heat of the solution. (6) NH4Cl(s) → NH4Cl(aq) ∆H6 (measured) Your answer should have 3 sig figs
dont hend written solution