Answered: How many coulombs of charge are…

Science

Chemistry

How many coulombs of charge are necessary to produce 147 g of Al from Al3+(aq)? (F = 96,500 C/mol)

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter6: Chemical Calculations: Formula Masses, Moles, And Chemical Equations

Section: Chapter Questions

Problem 6.74EP: Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction...

See similar textbooks

Related questions

Q: The following reaction has K= 3.03 when at equillibrium: CO(g) + 2H2(g) --- CH3OH(g) The reagent…

A: To calculate the final (equilibrium) concentrations of CO, H2, and CH3OH, use ICE table to relate…

Q: CIO (aq) + Cr(OH)3(s) CrO42(aq) + Cl¯(aq) basic What is the standard cell potential, E° cell, for…

A: Step 1:The standard electrode potential, often referred to as standard potential, indicates the…

Q: please answer in text form and in proper format answer with must explanation , calculation for each…

A: Non metal like N and O and Cl and C can form only covalent bonds with each other as these are…

Q: For the fusion reaction shown, calculate the change in energy of the reaction in units of joules per…

A: Step 1: The reaction: 12H+12H→23He+01nThe atomic mass of 12H=2.01410uThe atomic mass of…

Q: 3 PHASE DIAGRAMS. Sketch the temperature-composition (“T-x") phase diagram for acetone, (CH3)2 CO),…

A: To sketch the temperature-composition (T-x) phase diagram for the acetone-chloroform mixture, we…

Q: 1. Predict the product of the following reaction and show the mechanism. a) 1.1 equiv LDA b) -78 C…

A: The given reaction is an aldol condensation followed by dehydration, which will yield an…

Q: The young expert Hand written solution is not allowed please

A: The given reaction is:- 2NO2(g) → 2NO + O2 This is the balanced reaction. Given S(entropy) of O2 =…

Q: Name the functional groups present in a glucose molecule

A: The open chain structure of glucose (C6H12O6) is shown below.The aldehyde group (-CHO) is shown in…

Q: EQUILIBRIUM CALCULATIONS with ICE TABLES - WORKSHEET 1. Consider the reaction: 2 SO₂ (g) + O2(g) 2…

A: 2)3)4)

Q: None

A: Step 1:(a)Let me explain the net ionic equation for the reaction between chromium(III) chloride and…

Q: Predict the major organic product(s), if any, for the following reactions. 1. OH conc. H2SO4 Δ OH…

A: The objective of the question is to predict the major organic product(s) for the given reactions…

Q: For each of the following reactions give the Major product(s) of the reaction only and statethe…

A: Refer to the boxed structures below for the structures of the major products: C) The mechanism below…

Q: (a) A voltaic cell is constructed as follows: Zn | Zn2+ | H+ | H2 The half-cell reactions are:…

A: Step 1: Step 2: Step 3: Step 4:

Q: please answer these questions!!

A: (5)STEP 1:For n=2ψ=a2sin(anπx)=a2sin(a2πx)px=ih∂x∂ or…

Q: 1) Which of the following resonance structures of DMAP are wrong? N N DMAP A N B N + N N= N + C D

Q: Please do question 2 and classify as either aromatic or nonaromatic. Explain the mechanism/ process

A: Step 1: Huckel's ruleAromatic: (4n+2)π electrons in the system and the system should be fully…

Q: A sample of krypton gas at a pressure of 1.12 atm and a temperature of 28.5 °C, occupies a volume of…

A: The objective of the question is to find the pressure of the krypton gas after it is allowed to…

Q: Bomb calorimetry is also known as constant pressure calorimetry. True or False ______ are composed…

A: EXPLAINED ABOVE IN DETAILED.

Q: Calculate the solubility (in M) of O2 in the blood of a scuba diver at a depth of 100 feet, where…

A: We can calculate the solubility using the the formula for Henry's Law:Sg=kPgWhere:Sg is the…

Q: Question 12 Propose best Williamson ether syntheses for the following compounds. Select all…

A: The given compound is benzyl ethyl ether. This can be prepared by Williamson ether synthesis. Step…

Q: What is the chemistry involved in sunscreens? What is the process of making sunscreens? Chemicals…

A: EXPLAINED ABOVE IN DETAILED.

Q: Designate which of the following acids and bases are traditional ( Arrhenius) acids adn bases. HCO3,…

A: Step 1:Acid is defined by the Arrhenius theory as a substance that releases H+ ions when it…

Q: None

Q: Draw the structure(s) of the major organic product(s) of the following reaction. CI N₂ KI Draw one…

A: When compound reacts with potassium iodide (KI), a substitution reaction may occur, leading to the…

Q: F3 Modify the structure to draw the organic product of the following reaction. Note that [O] is…

A: The given structure is CH2CHOHCH3, which is a secondary alcohol. The presence of [O] indicates that…

Q: A 25.0 mL aliquot of 0.0580 M EDTA was added to a 47.0 mL solution containing an unknown…

A: Step 1: Here EDTA will make complex with v+3 and remaining EDTA will react with Ga+3 So the…

Q: dont provide handwriting solution .....

A: References Smith, M. B. (2020). March's advanced organic chemistry: reactions, mechanisms, and…

Q: *Reaction is in image* Questions based on reaction in image: The oxidizing agent is: The reducing…

A: Step 1:Given reaction:- PO₃³⁻ (aq) + Cl₂(g) --> PO₄³⁻ (aq) + Cl⁻(aq) Questions based on…

Q: Use the following atomic weights and quantities to calculate the overall % yield of…

A: Here's how to approach this problem:Scenario:A researcher wants to know if the proportion of adults…

Q: *Reaction is in image* Questions based on reaction in image: The oxidizing agent is: The reducing…

Q: The "particle in a ring" is another relatively simple 1-D quantum mechanics problem: The Schrödinger…

A: PART A: PART B:PART C:PART D:

Q: Please answer the following chem question

A: Step 1:Step 2:Step 3:

Q: 4. Show the mechanism for the following transformation. As always, be sure to show all intermediates…

A: References Smith, M. B. (2020). March's advanced organic chemistry: reactions, mechanisms, and…

Q: Identify the type of polymerization in each of the following:

A: Step 1:Answer a) This is an example of Condensation Polymerisation . Because in this two polymers of…

Q: Considering which of the OH groups should be more accessible to MsCl, suggest a mechanism for the…

A: Step 1: Step 2: Step 3: Step 4:

Q: None

A: Step 1: Step 2: Step 3: Step 4:

Q: How long will it take for the concentration of A to decrease from 0.500 M to 0.200 M in the…

A: Step 1:Step 2:

Q: A solution contains 0.127 M ammonium iodide and 0.112 M ammonia. The pH of this solution is

A: Step 1: Step 2: Step 3: Step 4:

Q: It a 0.1M solution of glucose 1-phosphate at 25°C is incubated with a catalytic amount of…

A: To calculate the Gibbs free energy change (ΔG) for the enzymatic reaction where glucose 1-phosphate…

Q: Question 12 Propose best Williamson ether syntheses for the following compounds. Select all…

A: Step 1:The SN2 pathway is required for the synthesis this reaction is useful only when the alkyl…

Q: i know the answer is -583kJ but I did not understand why. I would appreciate any help on how to…

Q: Determine the pH of each solution. a) 0.16 M NH4Cl (Kb(NH3)=1.76×10^−5) b) 0.16 M NaC2H3O2…

A: Step 1 To determine the pH of each solution, we need to understand that NH4Cl and NaC2H3O2 are salts…

Q: 2. Propose starting materials and reagents to achieve the following synthesis. Assume the circled…

A: Step 1: Choosing the Starting MaterialThe desired product,…

Q: For the decomposition of Ag2O: 2Ag2O(s)-4Ag(s)+O2(g) (a) Obtain an expression for AG° as a function…

Q: 1. σ=[(Σd2)/(n-1)]½ n= number of trials d= measured value - mean…

A: There are two formulas in finding Standard Deviation, population standard deviation denoted by σ…

Q: A 250.0-mg sample of an organic weak acid is dissolved in an appropriate solvent and titrated with…

A: The objective of this question is to determine the equivalent weight of an organic weak acid that…

Q: | CH2C6H5 CH3 + BH3 + H2O2/OH + CrO3, pyridine → A A + CH3-Li + H*/H2O → B

A: Step 1: Step 2:

Q: 1 THE SECOND LAW [6] Calculate the change in the entropies of the system and the surroundings, and…

A: Step 1: Step 2: Step 3: Step 4:

Q: Question 14 Propose best Williamson ether syntheses for the following compounds. Select all…

Question

100%

Show work, thank you!

How many coulombs of charge are necessary to produce 147 g of Al
from Al3+(aq)? (F = 96,500 C/mol)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

What is the mass of fish, in kilograms, that one would have to consume to obtain a fatal dose of mercury, if the fish contains 30 parts per million of mercury by weight? (Assume that all the mercury from the fish ends up as mercury (II) chloride in the body and that a fatal dose is 0.20 g of HgCl2.) How many pounds of fish is this?
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Chlorine exists mainly as two isotopes, 37Cl and 33Cl. Which is more abundant? How do you know?
Calculate the mass in grams of 3.839 moles of (a) hydrazine, a rocket propellant. (b) caffeine, C4H5N2O. (c) theobromine, C7H8N4O2, the alkaloid present in chocolate and cocoa.
You take 1.00 g of an aspirin tablet (a compound consisting solely of carbon, hydrogen, and oxygen), burn it in air, and collect 2.20 g CO2 and 0.400 g H2O. You know that the molar mass of aspirin is between 170 and 190 g/mol. Reacting 1 mole of salicylic acid with I mole of acetic anhydride (C4H6O3) gives you 1 mole of aspirin and 1 mole of acetic acid (C2H4O2). Use this information to determine the molecular formula of salicylic acid.
Tungsten (W) metal, which is used to make incandescent bulb filaments, is produced by the reaction WO3+3H23H2O+W How many grams of H2 are needed to produce 1.00 g of W?
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?
Nitrogen fixation in the root nodules of peas and other legumes occurs with a reaction involving a molybdenum-containing enzyme named nitrogenase. This enzyme contains two Mo atoms per molecule and is 0.0872% Mo by mass. Calculate the molar mass of the enzyme.
The compound As2I4 is synthesized by reaction of arsenic metal with arsenic triiodide. If a solid cubic block of arsenic (d = 5.72 g/cm3) that is 3.00 cm on edge is allowed to react with 1.01 1024 molecules of arsenic triiodide, what mass of As2I4 can be prepared? If the percent yield of As2I4 was 75.6%, what mass of As2I4 was actually isolated?
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
4.22 Generally, an excess of O2 is needed for the reaction Sn+O2SnO2 . What is the minimum number of moles of oxygen required to oxidize 7.3 moles of tin?
How many coulombs of charge are necessary to produce 139 g of Al from Al³⁺(aq)? (F = 96,500 C/mol)

SEE MORE QUESTIONS

Recommended textbooks for you

General, Organic, and Biological Chemistry

Chemistry

ISBN:

9781285853918

Author:

H. Stephen Stoker

Publisher:

Cengage Learning

Chemistry: The Molecular Science

Chemistry

ISBN:

9781285199047

Author:

John W. Moore, Conrad L. Stanitski

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

General, Organic, and Biological Chemistry

Chemistry

ISBN:

9781285853918

Author:

H. Stephen Stoker

Publisher:

Cengage Learning

Chemistry: The Molecular Science

Chemistry

ISBN:

9781285199047

Author:

John W. Moore, Conrad L. Stanitski

Publisher:

Cengage Learning

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN: