1 THE SECOND LAW [6] Calculate the change in the entropies of the system and the surroundings, and the total change in entropy, when the volume of a sample of argon gas of mass 21 g at 298 K and 1.50 bar increases from 1.20 dm³ to 4.60 dm3 in (a) an isothermal reversible expansion (b) an isothermal irreversible expansion against pex = 0 (c) an adiabatic reversible expansion

1 THE SECOND LAW [6] Calculate the change in the entropies of the system and the surroundings, and the total change in entropy, when the volume of a sample of argon gas of mass 21 g at 298 K and 1.50 bar increases from 1.20 dm³ to 4.60 dm3 in (a) an isothermal reversible expansion (b) an isothermal irreversible expansion against pex = 0 (c) an adiabatic reversible expansion

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter16: Thermodynamics: Directionality Of Chemical Reactions

Section: Chapter Questions

Problem 101QRT: Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this...

See similar textbooks

Similar questions

In the thermodynamic definition of a spontaneous process, why is it important that the phrase “continuous intervention” be used rather than just “intervention?”
Under what conditions is the entropy of a substance equal to zero?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
It has been demonstrated that buckminsterfullerene (C60), another allotrope of carbon (Section 2.3), may be converted into diamond at room temperature and 20,000 atmospheres pressure (about 2 GPa). The standard enthalpy of formation, fH, for buckminsterfullerene is 2320 kJ/mol at 298.2 K. a. Calculate rH for the conversion of C60 to diamond at standard state conditions and 2982 K. b. Assuming that the standard entropy per mole of carbon in both C60 and diamond is comparable (both about 23 J/K mol), is the conversion of C60 to diamond product-favoredat room temperature?
A 220-ft3 sample of gas at standard temperature and pressure is compressed into a cylinder, where it exerts pressure of 2000 psi. Calculate the work (in J) performed when this gas expands isothermally against an opposing pressure of 1.0 atm. (The amount of work that can be done is equivalent to the destructive force of about 1/4 lb of dynamite, giving you an idea of how potentially destructive compressed gas cylinders can be if improperly handled!)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the decomposition of phosgene? COCl2(g)CO(g)+Cl2(g)
Why isnt the entropy of elements in their standard pressure at normal that is, room temperatures equal to zero?
Explain why the statement No process is 100 efficient is not the best statement of the second law of thermodynamics.
Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().