Estimate the change in standard reaction entropy of the following two reactions when the temperature is increased from 25°C to 37°C at constant pressure under the assumption that constant-pressure molar heat capacity of linear gaseous molecules is ½-R and that of nonlinear gaseous molecules is 4R. (R is the ideal gas constant, 8.31 J mol¹ K-¹). a. 2 H2(g) + O2(g) → 2 H₂O(g) b. CH4(g) +2 O2(g) → CO2(g) + 2 H₂O(g) 2

Estimate the change in standard reaction entropy of the following two reactions when the temperature is increased from 25°C to 37°C at constant pressure under the assumption that constant-pressure molar heat capacity of linear gaseous molecules is ½-R and that of nonlinear gaseous molecules is 4R. (R is the ideal gas constant, 8.31 J mol¹ K-¹). a. 2 H2(g) + O2(g) → 2 H₂O(g) b. CH4(g) +2 O2(g) → CO2(g) + 2 H₂O(g) 2

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.107QE: Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is...

See similar textbooks

Similar questions

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
Billions of pounds of acetic acid are made each year, much of it by the reaction of methanol with carbon monoxide. (AssumeT= 298 K.) CH3OH() + CO(g) CH3COOH() (a) By calculating the standard Gibbs free energy change, rG, for this reaction, show that it is product-favored. (b) Determine the standard Gibbs free energy change, rG,for the reaction of acetic acid with oxygen to form gaseous carbon dioxide and liquid water. (c) Based on this result, is acetic acid thermodynamicallystable compared with CO2(g) and H2O()? (d) Is acetic acid kinetically stable compared with CO2(g)and H2O()?
In the thermodynamic definition of a spontaneous process, why is it important that the phrase “continuous intervention” be used rather than just “intervention?”
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
When (if ever) are high temperatures unfavorable to a reaction thermodynamically?
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?
Explain why absolute entropies can be measured.
Without looking up their standard entropies in reference tables, identify which of the following lists the materials in order of increasing entropy. (a) H2O() NaCl(s) NH3(g) (b) H2O() NH3(g) NaCl(s) (c) NaCl(s) H2O() NH3(g) (d) NH3(g) H2O() NaCl(s)