Please correct answer and don't use hand rating Consider these two entries from a fictional table of standard reduction potentials.X3++3e →X(s)E° = -1.62 VY3++3eY(s)E° = -0.14 VWhat is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode?E°cell=V

Galvanic cell:Anode is (-)veCathode is (+)ve Anode is the electrode where oxidation takes place. The…

Answered: Consider these two entries from a…

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 77AP

See similar textbooks

Similar questions

1. If you wish to convert 0.0100 mol of Au3+ (aq) ions into Au(s) in a “gold-plating” process, how long must you electrolyze a solution if the current passing through the circuit is 2.00 amps? 483 seconds 4.83 104 seconds 965 seconds 1450 seconds
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
A standard galvanic cell is constructed so that the overall cell reaction is 2A13++(aq)+3M(s)3M2+(aq)+2A1(s) Where M is an unknown metal. If G = 411 kJ for the overall cell reaction, identify the metal used to construct the standard cell.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
Consider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.
A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?
Consider the following cell running under standard conditions: Fe(s)Fe2+(aq)Al3+(aq)Al(s) a Is this a voltaic cell? b Which species is being reduced during the chemical reaction? c Which species is the oxidizing agent? d What happens to the concentration of Fe3+(aq) as the reaction proceeds? e How does the mass of Al(s) change as the reaction proceeds?
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
Use the data from the table of standard reduction potentials in Appendix H to calculate the standard potential of the cell based on each of the following reactions. In each case, state whether the reaction proceeds spontaneously as written or spontaneously in the reverse direction under standard-state conditions. (a) H2(g)+Cl2(g)2H+(aq)+2Cl(aq) (b) Al3+(aq)+3Cr2+(aq)Al(s)+3Cr3+(aq) (c) Fe2+(aq)+Ag+(aq)Fe3+(aq)+Ag(s)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
The mass of three different metal electrodes, each from a different galvanic cell, were determined before and after the current generated by the oxidation-reduction reaction in each cell was allowed to flow for a few minutes. The first metal electrode, given the label A, was found to have increased in mass; the second metal electrode, given the label B, did not change in mass; and the third metal electrode, given the label C, was found to have lost mass. Make an educated guess as to which electrodes were active and which were inert electrodes, and which were anode(s) and which were the cathode(s).

SEE MORE QUESTIONS

Recommended textbooks for you

Principles of Modern Chemistry

Chemistry

ISBN:

9781305079113

Author:

David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry

ISBN:

9781133949640

Author:

John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:

Cengage Learning

Principles of Modern Chemistry

Chemistry

ISBN:

9781305079113

Author:

David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry & Chemical Reactivity

Chemistry

ISBN:

9781133949640

Author:

John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:

Cengage Learning

Fundamentals Of Analytical Chemistry

Chemistry

ISBN:

9781285640686

Author:

Skoog

Publisher:

Cengage

General Chemistry - Standalone book (MindTap Cour…

Chemistry

ISBN:

9781305580343

Author:

Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell

Publisher:

Cengage Learning

Chemistry: Principles and Practice

Chemistry

ISBN:

9780534420123

Author:

Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS

Consider these two entries from a fictional table of standard reduction potentials. X3++3e → X(s) E° = -1.62 V Y3++3e Y(s) E° = -0.14 V What is the standard potential of a galvanic (voltaic) cell where X is the anode and Y is the cathode? E° cell = V