Question 18: Rank the complexes in order from the one that absorbs light at the lowest frequency to the one that absorbs light at the highest frequency by dragging the formulas into the correct boxes lowest frequency highest frequency Check [Ru(H2O)6]3- [RuF6]3+ [Ru(NO2)6]3- [RuBr6]3-

The solid anhydrous solid CoCl2 is blue in color. Because it readily absorbs water from the air, it is used as a humidity indicator to monitor if equipment (such as a cell phone) has been exposed to excessive levels of moisture. Predict what product is formed by this reaction, and how many unpaired electrons this complex will have.

Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.

What two first-row transition metals have unexpected electron configurations? A statement in the text says that first-row transition metal ions do not have 4s electrons. Why not? Why do transition metal ions often have several oxidation states, whereas representative metals generally have only one?

Would you expect salts of the gold(I) ion, Au+, to be colored? Explain.

Which of the following species is most paramagnetic? (a) Cr (b) Cr3+ (c) Mn (d) Mn2+

There are three salts that contain complex ions of chromium and have the molecular formula CrCl3 6H2O. Treating 0.27 g of the first salt with a strong dehydrating agent resulted in a mass loss of 0.036 g. Treating 270 mg of the second salt with the same dehydrating agent resulted in a mass loss of 18 mg. The third salt did not lose any mass when treated with the same dehydrating agent. Addition of excess aqueous silver nitrate to 100.0-mL portions of 0.100 M solutions of each salt resulted in the formation of different masses of silver chloride; one solution yielded 1430 mg AgCl; another, 2870 mg AgCl; the third, 4300 mg AgCl. Two of the salts are green and one is violet. Suggest probable structural formulas for these salts, defending your answer on the basis of the preceding observations. State which salt is most likely to be violet. Would a study of the magnetic properties of the salts be helpful in determining the structural formulas? Explain.

Butter yellow absorbs light with a wavelength of 408 nm, whereas the nitrated form absorbs at 478 nm. Which absorbs the higher energy light?

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?

Platinum(II) forms many complexes, among them those with the following ligands. Give the formula and charge of each complex. (a) two ammonia molecules and one oxalate ion (C2O42-) (b) two ammonia molecules, one thiocyanate ion (SCN-), and one bromide ion (c) one ethylenediamine molecule and two nitrite ions