Consider the hypothetical bimetallic titanium dinitrogen complexes (N2C, (μ-N2) [TiCl2L312. neutral 2e donor) a. Draw reasonable structures for A, B, and C assuming that the oxidation state of titanium in these three compounds is the same. b. Which compound would have the highest v(N-N) ? c. Which compound would have the longest N - N bond? J C A 2. Consider the hypothetical bimetallic titanium dinitrogen complexes A (U-N₂) [TiCl4L]2, B (μ- N2)[TiCl3L2]2, and C, (μ-N2) [TiCl2L3]2. (L = neutral 2 e donor) a. Draw reasonable structures for A, B, and C assuming that the oxidation state of titanium in these three compounds is the same. B b. Which compound would have the highest v(N-N)? c. Which compound would have the longest N-N bond?

Consider the hypothetical bimetallic titanium dinitrogen complexes (N2C, (μ-N2) [TiCl2L312. neutral 2e donor) a. Draw reasonable structures for A, B, and C assuming that the oxidation state of titanium in these three compounds is the same. b. Which compound would have the highest v(N-N) ? c. Which compound would have the longest N - N bond? J C A 2. Consider the hypothetical bimetallic titanium dinitrogen complexes A (U-N₂) [TiCl4L]2, B (μ- N2)[TiCl3L2]2, and C, (μ-N2) [TiCl2L3]2. (L = neutral 2 e donor) a. Draw reasonable structures for A, B, and C assuming that the oxidation state of titanium in these three compounds is the same. B b. Which compound would have the highest v(N-N)? c. Which compound would have the longest N-N bond?

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 125QRT: Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with...

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Give the number of unpaired electrons in octahedral complexes with strong-field ligands for (a) Rh3+ (b) Mn3+ (c) Ag+ (d) Pt4+ (e) Au3+
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Draw the geometric, linkage, and ionization isomers for [COCl5CN][CN].
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.