5) A certain aerobic organism is able to metabolize the following glycolipid:"CH,OHOHHOOHA. Draw the 2 resulting structures that would occur upon initial hydrolysis of the O-glycosidic bond.B. Calculate how much ATP is formed upon complete aerobic oxidation of one mole of the compound.Assume that no ATP is produced when one mole of the glycosidic bond in the above compound ishydrolyzed. Show calculation below.

Carbohydrates form glycosidic bonds with another carbohydrate molecule to form a polysaccharide or…

Answered: 5) A certain aerobic organism is able…

Biochemistry

6th Edition

ISBN:9781305577206

Author:Reginald H. Garrett, Charles M. Grisham

Publisher:Reginald H. Garrett, Charles M. Grisham

Chapter18: Glycolysis

Section: Chapter Questions

Problem 6P: The Reactions and Meehanisms of the Leloir Pathway Write the reactions that permit galactose to be...

See similar textbooks

Similar questions

(i) During the Pyruvate Decarboxylase (PDC) catalysed reaction, a covalent coenzyme intermediate is formed. On the skeleton of the covalent coenzyme intermediate below draw the appropriate double bonds, charges, and electron pairs to illustrate the two resonance forms of this intermediate. Name each form in the boxes provided. HO S R' N -R HO S R' N -R
Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods. Calculate the net ATP yield from the complete β-oxidation of myristoleic acid. The formula of myristoleic acid is shown below (it is assumed that the total ATP production is the same for both saturated and unsaturated fatty acids having the same carbon chain length). CH3-(CH2)3-CHCH-(CH2)7-COOH (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP. ) Group of answer choices a. 96 ATP b. 92 ATP c. 94 ATP d. 34 ATP e. 36 ATP
In different organisms sucrose can be cleaved either by hydrolysis or by phosphorolysis. Calculate the ATP yield per mole of sucrose metabolized by anaerobic glycolysis starting with (a) hydrolytic cleavage and (b) phosphoro- lytic dleavage.
Consider docosanoic acid C12H43CO2H a. Label the alpha and beta Carbons. Show the beta-oxidation in an EXPANDED structure. b. Draw each acyl CoA derived from this fatty acid. c. How many acetyl Co A molecules are formed by complete beta-oxidation? d. How many cycles of beta-oxidation are needed for complete oxidation? e. How many molecules of ATP are formed from the complete catabolism of this fatty acid? Show the complete computation. f. How many moles of ATP per gram of fatty acid is formed from the complete catabolism of the given fatty acid? g. What is the molar mass of the given fatty acid? Solution: Show here the complete computations, [from a to e]
While fatty acids longer than 20 carbons are rarely found in foods, lignoceric acid (24:0) is found in a variety of tree nuts. Answer the following based on the conversion of a molecule of lignoceric acid to 8-hydroxybutyrate. (a) What are the 8-oxidation products and how many ATP are required during activation for one molecule of lignoceric acid? (b) Given the following, how many molecules of 8-hydroxybutyrate can be produced? CoA 2 2 CoA NADH NAD+ H+ OH ẞ-hydroxybutyrate (c) Based on the total NADH and FADH2 available after converting lignoceric acid into 8-hydroxybutyrate, what is the maximum yield of ATP that can be produced in the liver? Don't forget to include any ATP required for activation steps.
Given the tri-acylglyceride (TAG) below as source of energy when administered from an organism's diet, H,C-O HC-0 H,C-o [A] Show the calculated maximum amount of ATP that could be generated by the full oxidation of the compound. Illustrate where the ATPS are derived from (show the reactions and enzymes involved). You can use general structure of the FFA in the reactions involved in the process. (B) Discuss the fate of the glycerol. (C] One of the FFAS derived from the TAG has the same carbon number as glucose. Compare the maximum yield of ATP derivable from this FFA as compared to the ATP yield from glucose.
In the degradation of glycogen, the purpose of the debranching enzyme is to remove the last four glucose molecules from branches structure of glycogen. It does this by catalyzing three different reactions. Use the equations below to answer parts a-c. Synthesis of α(1,6) link ΔG = +7.1 kJ Hydrolysis of α(1,4) link ΔG = ─15.5 kJ a)What are the three chemical reactions performed during the removal of the last four glucose molecules of the branching structure of glycogen? b) Calculate ΔG for each of the three reactions described in part a. c) Now calculate the overall energy change for the net reaction carried out by this enzyme. d) Why is this reaction favorable?
The glucose/glucose-6-phosphate substrate cycle involves distinct reactions of glycolysis and gluconeogenesis that interconvert these two metabolites. Assume that under physiological conditions, [ATP] = [ADP]; [P;] = 1 mM. Consider the glycolytic reaction catalyzed by hexokinase: ATP + glucose ADP + glucose-6-phosphate AG = - 16.7 kJ/mol (a) Calculate the equilibrium constant (K) for this reaction at 298°K, and from that, calculate the maximum [glucose-6-phosphate]/ Iglucose] ratio that would exist under conditions where the reaction is still thermodynamically favorable. (b) Reversal of this interconversion in gluconeogenesis is catalyzed by glucose-6-phosphatase: glucose-6-phosphate + H20 = glucose + P AG" = -13.8 kJ/mol
Indicate the energy yield or cost, in ATP equivalents, for the following processes: (a) glycogen (3 residues) → 6 pyruvate. (b) 3 glucose → 6 pyruvate(c) 6 pyruvate → 3 glucose.
The biosynthesis of vitamin D₂ is a two-step reaction, requiring two types of concerted pericyclic reactions. Draw in the arrows for each step and identify the structure of precalciferol. If an electrocyclic reaction is required, identify if it occurs through a conrotatory or disrotatory reaction. HO H H ergosterol hv precalciferol Cast HO ergocalciferol
The enzyme-bound intermediate in this reaction has been identified as the mixed anhydride of the fatty acid and adenosine 2ºmonophosphate (AMP), acyl-AMP. R-C-O-P-O-CH2 0- Adenine 0. H H H H OH OH Complete the two equations corresponding to the two steps of the reaction catalyzed by acyl-CoA synthetase. Step 1: R-COO¯+ → acyl-AMP + COA ATP Step 2: Acyl-AMP + AMP → acyl- ADP + P H₂O H+ ATP COA The acyl-CoA synthe PP n is readily reversib i PP; ibrium constant near 1. How can this reaction be made 1
Fatty acids are converted to their coenzyme A esters in a reversible reaction catalyzed by acyl-CoA synthetase: R-COO +ATP +COA R-C-COA +AMP + PPi a) The reaction involves two steps the first of which forms an enzyme-bound intermediate identified as the mixed anhydride of the fatty acid and AMP: R-C-O-P-O-nibose-adenine Write two chemical equations coresponding to the two steps of the reaction catalyzed by the synthetase. b) The acyl-CoA synthetase reaction as written above is readily reversible. How might the reaction be made to favor formation of fatty acyl-CoA? Write within the box. Anything outside the box will not be graded. From the

SEE MORE QUESTIONS

Recommended textbooks for you

Biochemistry

ISBN:

9781305577206

Author:

Reginald H. Garrett, Charles M. Grisham

Publisher:

Cengage Learning

Biochemistry

ISBN:

9781305577206

Author:

Reginald H. Garrett, Charles M. Grisham

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS

5) A certain aerobic organism is able to metabolize the following glycolipid: "CH,OH OH HO он A. Draw the 2 resulting structures that would occur upon initial hydrolysis of the O-glycosidic bond.