3. Glycolic Acid is used for making a polymer used as an absorbable surgical suture material. Ho OH 3.1 Draw the structure of a linear trimer of glycolic acid. glycolic acid trimer 3.2 Polyglycolic acid is hydrolyzed in the human body. Write a mechanism to show the hydrolysis of a dimer of glycolic acid.
Q: Please correct answer and don't use hand raiting
A: Step 1: GivenMass of CuSO4.5H2O = 10.5501 gMass of Cu(NH3)4SO4.H2O = ?Molar Mass of CuSO4.5H2O =…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Given:Sample mass of steak: 6.2179 gVolumetric flask volume: 50.0 mLAbsorbance of 10.0 mL sample of…
Q: Which element is oxidized and which element is reduced in the following reaction? Ni (s) + 2 HNO3…
A: In order to determine which element is oxidized and which is reduced, we first need to identify the…
Q: The following chromatogram shows the separation of several alcohols. The elution order of these…
A: The question is asking us to identify the type of liquid chromatography used based on the elution…
Q: Please correct answer and don't use hand rating
A: The pH at the equivalence point (when 25.00 mL of HCl is added) is 5.41. This is crucial for…
Q: Determine the number of grams of NH Br needed to prepare an aqueous solution at a specific pH by…
A: First, we need to calculate the pOH of the solution. The pH and pOH of a solution are related by the…
Q: Show work with explanation needed .don't give Ai generated solution. Give correct solution
A: Step 1: 1H NMR1H NMR (proton nuclear magnetic resonance spectroscopy) is a powerful analytical…
Q: Part A Which of the bonds in a carbon-oxygen double bond has more effective orbital-orbital overlap,…
A:
Q: 7. No AI use
A: Step 1: Aromaticity is a property of conjugated cycloalkenes in which the stabilization of the…
Q: Plan an asymmetric synthesis of the molecule bicyclic alcohol 3, using a chiral auxiliary strategy.…
A: Stereoselectivity:The stereoselectivity of the Wittig reaction is determined by the stereochemistry…
Q: Draw the products of the hydrolysis shown. O Macmillan Learning Chapter 6 HW - General, Organic, and…
A: In the presence of acid and water, the ester hydrolyses to a carboxylic acid and alcohol. Answer:
Q: In the drawing areas below, draw the two conformations of bromocyclohexane that are typically the…
A: Step 1:Cyclohexane in reality is in puckered form which is called "chair form" because it is most…
Q: 9. No AI Use
A:
Q: The ionization energy of silver is 731 kJ/mol. Is light with a wavelength of 415 nm sufficient to…
A: To answer this question, we need to calculate the energy of a photon with a wavelength of 415 nm and…
Q: Please rewrite the chemicals
A: In a chemical reaction, heat can be either absorbed or released. This is determined by the type of…
Q: The image shows a lipid bilayer, with the polar heads represented by circles and the hydrophobic…
A: Here, fatty acids inserted into the lipid bilayer in the correct orientation as:The hydrophilic head…
Q: 3. (a) Draw a resonance structure for Molecule 1 in Box B, which satisfies the octet for all non-…
A: Step 1: Step 2: Step 3: Step 4:
Q: 20. NO AI USE
A: Step 1: ReactionStep 2: MechanismElectron donating groups are the activating groups and electron…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: Recall that in mass spectrometry data, peaks are in the form m/z or mass of the ion per unit…
Q: (a) Write the relative reaction rate equations for the generic reaction:A + 2B → C (b) In the lab,…
A:
Q: As the lead product manager at OrganometALEKS Industries, you are trying to decide if the following…
A: Step 1:Mechanism Step 2:Note: It has one chiral carbon, which is indicated by an asterisk (*).…
Q: 11. No ai use
A:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1: Redox ReactionReaction in which oxidation and reduction occur simultaneously is known as…
Q: Please help complete both reagents tables please, both charts
A:
Q: Please correct answer and don't use hand raiting
A: We're asked to find the standard enthalpy of formation of FeS₂(s) at 600°C, given data at 298.15 K…
Q: chm
A: Step 1: Step 2: Step 3: Step 4:
Q: I need to rank these from highest to lowest priority but do not understand how
A: Ranking from highest to lowest priority:1. -CH₂CH₂CH₂Br (1-bromopropyl):This group consists of a…
Q: 8.30 What type of interaction holds the O2 units together in the Og structure? How does this…
A: The interaction holding O2 units together in the O8 structure involves weak intermolecular forces…
Q: 1- methylcyclohexane + HBr --> complete the following reaction and show the major product
A: Firstly, your question is wrong for 1-methylcyclohexane, it should be 1-methylcyclohexene instead of…
Q: ES Window Help achieve.macmillanlearning.com Learning Macmillan Learning Classify each molecule as…
A: Before we classify the given molecules, we need to understand the structures of aldehydes and…
Q: Please correct answer and don't use hand rating
A: Question 1: [HF]=5.42MQuestion 2: [HF]=2.55M
Q: Curved arrows are used to illustrate the flow of electrons. Using the provided starting and product…
A:
Q: 35. NO AI USE
A: Approach to solving the question: first of all we will see in which structure the F is at 3 to make…
Q: Suppose a boil water notice is sent out advising all residents in the area to boil their water…
A: Approach to solving the question: thermodynamics Detailed explanation: Key references: Atkins
Q: OCT The structure of D-arabinose is shown. CHO Macmillan Learning HO- H H-OH H-OH CH₂OH Which…
A: The molecules which are mirror image of each other but not superimposable are called enantiomers.…
Q: Net Ionic: 2. The combustion of fossil fuels containing sulfur contributes to the phenomenon known…
A: In the first reaction, sulfur dioxide (SO2) reacts with molecular oxygen (O2) to form sulfur…
Q: None
A: Outline of a Procedure/Design:Materials required:Calorimeter (bomb calorimeter for precise…
Q: Use the initial rates method with the given data to determine the rate law for the hypothetical…
A: Step 1: Rate LawA + B → CWe can write the general rate law for the reaction as follows:Rate =…
Q: Please correct answer and don't use hand raiting
A:
Q: Consider the following proposed reaction mechanism: Step 1: F2 + 2 NO2 → NO2F + F + NO2 Step 2: F +…
A: In the given reaction mechanism, we have two steps. In the first step, the reactants are F2 and NO2.…
Q: Show work. Don't give Ai generated solution
A: Generally halogenation of alkene gives 1,2- di haloalkane. And in the case of conjugated diene, Take…
Q: Give the geometry, number of d e-, draw the CF splitting diagram, number of unpaired e-, and…
A:
Q: YouTube Maps + Question 6 of 15 appropriate equilibrium equation for the acid or base that exists…
A: Step 1: Write the ionization of the salt.(CH3)NH2ClO4(aq)→(CH3)2NH2(aq)++ClO4(aq)− Step 2:…
Q: Use the following data and the gas chromatogram from a 20m x 0.30mm x 0.50μm capillary column to…
A: Given Data:tm = 1.00 min (unretained peak time)t1 = 3.52 min (retention time of compound 1)t2 = 8.15…
Q: You should write out what data and information you plan to collect during the experiment of…
A: Step 1: In the experiment "Introduction to Equilibrium - Le Chatelier's Principle," the goal is to…
Q: 1. Read the introduction sections above, then complete the following work to perform the indicated…
A:
Q: trans-1-ethyl-2-methylcyclohexane Drag the appropriate labels to their respective targets. Note: not…
A: Approach to solving the question:Here we just need to connect the given substituents according to…
Q: 1. BH3-THF 2. H2O2, NaOH Select to Draw Mg + Br Select to Draw Q 1. ether 2. H3O+ Please sele
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Step by step
Solved in 2 steps with 2 images
- A synthetic organic molecule, G, which contains both aldehyde and ether functional groups, is subjected to a series of reactions in a multi-step synthesis pathway. In the first step, G undergoes a Wittig reaction, leading to the formation of an alkene, H. Subsequently, H is treated with an ozone (O3) reagent followed by a reducing agent in an ozonolysis reaction, resulting in the formation of two different products, I and J. Considering the functional groups present in G and the nature of the reactions involved, what are the most probable structures or functional groups present in products I and J? A. I contains a carboxylic acid group, and J contains an aldehyde group. B. I contains a ketone group, and J contains an alcohol group. C. I and J both contain aldehyde groups. D. I contains an ester group, and J contains a ketone group. Don't use chat gpt.Chrysanthemic acid occurs as a mixture of esters in flowers of the chrysanthemum (pyrethrum) family. Reduction of chrysanthemic acid to its alcohol followed by conversion of the alcohol to its tosylate gives chrysanthemyl tosylate. Solvolysis alcohols. of the tosylate gives a mixture of artemesia and yomogi HO НО Chrysanthemic acid Chrysanthemyl alcohol OH TsO DMSO Chrysanthemyl tosylate Artemesia alcohol Yomogi alcohol Propose a mechanism for the formation of these alcohols from chrysanthemyl tosylate.Acetal derivatives of aldehydes and ketones are prepared by an acid-catalyzed dehydration reaction with alcohols or diols. Using more pictures than words, draw a reaction and a mechanism that shows the formation of acetal.
- Starting from benzene, provide a synthesis of the following compound. Ensure that the product is prepared in the highest percent yield possible. Provide all necessary reagents and draw the compound formed after each step. You do not have to use curved arrows. CI OH CIa) Write the structure of the Wittig reagent 2. b) Propose a step-by-step mechanism for the acid-catalyzed hydrolysis of 3 to product 4.Polyethylene terephthalate is also prepared by the transesterification of dimethyl terephthalate with ethylene glycol. Draw the mechanism for this nucleophilic acyl substitution.
- Describe how 3-methyl-1-phenyl-3-pentanol can be prepared from benzene. You can use any inorganic reagents and solvents, and any organic reagents provided they contain no more than two carbons.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Prostaglandins are a class of cicosanoids, fatty acid derivatives with a variety of extremely potent actions on vertebrate tissues. They are responsible for producing fever and inflammation and its associated pain. Prostaglandins are derived from the 20- carbon fatty acid arachidonic acid in a reaction catalyzed by the enzyme prostaglandin endoperoxide synthase. This enzyme, a cyclooxygenase, uses oxygen to convert arachidonic acid to PGG2, the immediate precursor of many different prostaglandins. Rate of formation of PGG2 with 10 mg/ml ibuprofen (mM/min) Arachidonic acid (mM) Rate of formation of PGG2 (mM/min) 0.190 12.3 0.228 13.9 0.342 17.5 0.570 1.33 22.2 28.8 7.71 8.88 11.9 16.3 24.0 The kinetic data given in the table are for the reaction catalyzed by a mutant of prostaglandin endoperoxide synthase. Focusing here on the first two columns, determine the Vmax and Km of the enzyme. Vmax = Km mM/min mMKetones and aldehydes react with sodium acetylide (the sodium salt of acetylene) to give alcohols, as shown in the following example: R1 ОН 1. НС—с: Na* R2 R1 R2 2. Нзо" HC Draw the structure of the major reaction product when the following compound reacts with sodium acetylide, assuming that the reaction takes preferentially from the Si face of the carbonyl group. • Use the wedge/hash bond tools to indicate stereochemistry where it exists. • You do not have to explicitly draw H atoms. • If a group is achiral, do not use wedged or hashed bonds on it. CH3 CH