help please answer in text form with proper workings and explanation for each and every part and steps with concept and introduction no AI no copy paste remember answer must be in proper format with all working! Calculate E° for the reaction below,cell5Cd2+(aq) + 2Mn2+(aq) + 8H2O(1) -> 5Cd(s) + 2MnO4 (aq) + 16H*(aq)given the following standard reduction potentials.MnO4 (aq) + 8H+(aq) + 5e -> Mn2+(aq) + 4H2O(1)Cd2+(aq) + 2e -> Cd(s)+8.40 V0 -1.92V+1.04 V+1.12 V+5.04 VE° = +1.52 VE° = -0.40 V

Step 1: Redox ReactionReaction in which oxidation and reduction occur simultaneously is known as…

Calculate E° for the reaction below, cell 5Cd2+(aq) + 2Mn2+(aq) + 8H2O(1) -> 5Cd(s) + 2MnO4 (aq) + 16H*(aq) given the following standard reduction potentials. MnO4 (aq) + 8H+(aq) + 5e -> Mn2+(aq) + 4H2O(1) Cd2+(aq) + 2e -> Cd(s) +8.40 V 0 -1.92V +1.04 V +1.12 V +5.04 V E° = +1.52 V E° = -0.40 V

Calculate E° for the reaction below, cell 5Cd2+(aq) + 2Mn2+(aq) + 8H2O(1) -> 5Cd(s) + 2MnO4 (aq) + 16H*(aq) given the following standard reduction potentials. MnO4 (aq) + 8H+(aq) + 5e -> Mn2+(aq) + 4H2O(1) Cd2+(aq) + 2e -> Cd(s) +8.40 V 0 -1.92V +1.04 V +1.12 V +5.04 V E° = +1.52 V E° = -0.40 V

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 77AP

See similar textbooks

Related questions

Q: K 13m Problem 27 of 28 Submit Curved arrows are used to illustrate the flow of electrons. Using the…

A: Step 1:Step 2: Step 3: Step 4:

Q: When the molecular reaction between sodium silicate and copper(II) nitrite is balanced correctly the…

A: step 1 :Here we have to balance the molecular reaction between sodium silicate (Na2SiO3) and…

Q: Provide the correct systematic name for the compound shown here. H3CH2CH2C H3CH2C

A: --------I m sure this will help you I hope you will appreciate my efforts Thank you!!!!!!Happy…

Q: Please correct answer and don't use hand rating

A: We are given two dissociation constants:K1=4.47×10−7K2=4.68×10−11 The concentration of [H+]:Since pH…

Q: None

A: To solve this problem, we first set up the equilibrium expression for the…

Q: The iron-chromium redox battery makes use of the reaction Cr2+ (aq) + Fe3+ (aq) 6 Cr3+ (aq) + Fe2+…

A: Step 1: Write the half - cell reaction for the anode -: Cr2+ -> Cr3+(aq.) + e- Step 2: Write the…

Q: In this section you should record any visual observations you make for denisty (colors,appearances…

A: The provided question discusses the observations and data collection for an experiment involving the…

Q: If you could tell me if i did the 1st part right. I am unsure how to do the second part. Thanks

A: Approach to solving the question: Detailed explanation:Practice A:Step 1: To determine the number of…

Q: Show work..Give IUPAC name of the given compound. Don't give Ai generated solution

A: Compound Part 2 of 3:Select the longest continuous carbon chain: The longest continuous chain has…

Q: If Kp = 989 for the reaction below at 310.0 K, then what is the value of Kc?(R = 0.08314…

A: The reaction:2 A(g) + B(s) → 2 C(s) + D(g)Solution:The relation between Kp and Kc is given as,Kp =…

Q: A first order reaction is 80.0% complete in 5 minutes, what is the rate constant of the reaction in…

A: k=1/tln(Ao/A)t= time in minutesAo=initial concentratio of reactantsA= concentration of reactants in…

Q: eagent, I HBr/CH2Cl2 | BH3, followed by H2O2/NaOH/H2O || H2/Pt Br2 H+/H₂O III IV > dus te

A: 1. To form an alcohol from 2-methyl-1-butene, the appropriate reagent is BH3 followed by…

Q: 6. How orbitals overlap to make a bond (σ bond: head-on overlap, л bond: sideways overlap) 7. The…

A: Step 1: Step 2: Step 3: Step 4:

Q: K Problem 9.b of 28 Submit Curved arrows are used to illustrate the flow of electrons. Using the…

Q: Assign an oxidation number to carbon in the following compound: CH4O2

A: Step 1: Explanation The oxidation number of hydrogen(H) is generally +1 in the combined stateThe…

Q: Balance the following reaction equation: Fe+ 02 → Fe2O3

A: The unbalanced chemical equation given is: Fe + O2 → Fe2O3.

Q: Please correct answer and don't use hand rating

Q: PREDICT THE PRODUCT

A: The Diels-Alder reaction is a [4+2] cycloaddition reaction between a diene and a dienophile, forming…

Q: circle the lower energy isomer of the two conformation isomers

A: Step 1: Step 2: Step 3: Step 4:

Q: Show work with explanation needed. Don't give Ai generated solution

A: (a)Longest Chain: The main chain has 7 carbons, so the base name is heptene.Double Bond: The double…

Q: (from Aleks practice problems not part of a graded assignment)

A: Step 1:Mechanism The electrophile (H+) adds to one of the terminal carbons of the diene, forming a…

Q: Fill in the missing information: symbol ☐ ☐ atom or ion? check all that apply number of number of…

A: Sn is neutral atom since number of electrons equals number of protons Ni3- is a cation since it…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Steps to Solve the Problem:

Q: Show work..don't give Ai generated solution

A: Answer: The name indicates that there were two alkene part present (1,2-diene). The preffix di…

Q: Monochromaters used in spectroscopy can consist of gratings or prisms. Which of the following…

A: A monochromator is a device used in spectroscopy for producing monochromatic light (light of a…

Q: 13. A 50.0 mL sample of 0.15 M HA is titrated with a 0.10 M KOH solution. The Ka of HA is 1.35 X…

A: Step 1:Step 2: Step 3:Step 4:

Q: Explain why both pairs are localized in detail, thanks

A: The image shows a chemical structure with two nitrogen atoms, both of which have lone pairs…

Q: If 8 moles of NH3 and 10.00 moles of O2 react in the following reaction, how many moles of which…

A: Given:Available moles of NH3 = 8 mol (1 significant…

Q: How many signals would you expect in the proton NMR spectrum for the molecules shown below (Me =…

A: In conclusionThe signal of each are 2 for letter A, 3 for letter B, 5 for letter C and 6 of letter…

Q: 5. 6. Using the template provided, draw the two chair conformers of the molecule shown in the box…

A: Approach to solving the question:Detailed explanation: Chair Conformer 1:Carbon 1 has the methyl…

Q: How many moles of NO2 would be required to produce 2.43 moles of HNO3 in the presence of excess…

A: The given chemical reaction is: 3 NO2 + H2O -> 2HNO3 + NO. This reaction shows that 3 moles of…

Q: Can you name and describe the forces and interactions in both MgCl2 and H2O before mixing them…

A: -----I m sure this will help youI hope you will appreciate my efforts Thank you!!!!Happy…

Q: Which option is correct and which option is incorrect, Give all options solution. Don't use AI.

Q: What can be predicted from the valence electrons of the elements in a compound formed by a…

A: The valence electrons of the elements in a compound provide valuable insights into several key…

Q: Select the correct reagent(s) for each step of the synthesis as shown below. [1] Cl [2] [4] Cl. NO,…

A: Step 1: Step 2: Step 3: Step 4:

Q: Please correct answer and don't use hand rating

A: Key Points About Chirality: Chiral Molecules: A molecule is chiral if it cannot be superimposed on…

Q: Please correct answer and don't use hand rating

A: Initial conditions: Continuate the melting machinery. The substance commences at 50°C, down its…

Q: Please correct answer and don't use hand rating

A: Step 1: Enter Data into ExcelOpen Excel and create a new worksheet.In the first row, enter the…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Given: [NaOH]=0.0100M;VNaOH=???mL;VHOCl=1.00L;[HOCl]=0.0500M;Ka=4.0x10−8The constant is obtained…

Q: Please explain in detail thank you

A: Step 1: Step 2: Step 3: Step 4:

Q: Name it according to IUPAC rules.

A: Step 1: Step 2: Step 3: Step 4:

Q: 8. What is the index of hydrogen deficiency (IHD) of chloroquine, C18H26CIN3? A) 6 B) 7 C) 8 D) 9 E)…

A: Approach to solving the question: 9) To calculate the IHD value of chloroquine, we use the following…

Q: Please correct answer and don't use hand rating

A: Given: molH+=0.065;V=1.00L;[HOCl]=0.365M;[OCl−]=0.249M;Ka=4.0x10−8The constant is obtained here:…

Q: Convert the following: A.) 76.8 cmHg to atm B.) 27.5 atm to kPa C.) 6.50 atm to bar D.) 0.937 kPa…

A: -------I m sure this will help you I hope you will appreciate my efforts Thank you!!!!!Happy…

Q: Show the reaction of acetophenone with NH2OH, HCl catalyst.

A: Reaction of acetophenone with NH2OH, in presence of HCl catalyst are given below with mechanism. In…

Q: Net Ionic: 2. The combustion of fossil fuels containing sulfur contributes to the phenomenon known…

A: In the first reaction, sulfur dioxide (SO2) reacts with molecular oxygen (O2) to form sulfur…

Q: Generate the solubility-product expression for AgBr --> Ksp = Al(IO3)3 --> Ksp = Ag3AsO4…

A: Solubility product expression is actually the equilibrium constant expression for dissolution of…

Q: help please answer in text form with proper workings and explanation for each and every part and…

A: Step 1: Hexane (CH₃(CH₂)₄CH₃) is a nonpolar solvent, meaning it dissolves nonpolar compounds well.…

Q: 1. Calculation for conversion of Maleic to Fumaric acid (2 points) Mass of Maleic acid Molar mass of…

Q: Please correct answer and don't use hand rating

A: Part D)The reaction will be 2NO+O2→2NO2so as per balanced equation two moles of NO will react…

Question

help please answer in text form with proper workings and explanation for each and every part and steps with concept and introduction no AI no copy paste remember answer must be in proper format with all working!

Calculate E° for the reaction below,
cell
5Cd2+(aq) + 2Mn2+(aq) + 8H2O(1) -> 5Cd(s) + 2MnO4 (aq) + 16H*(aq)
given the following standard reduction potentials.
MnO4 (aq) + 8H+(aq) + 5e -> Mn2+(aq) + 4H2O(1)
Cd2+(aq) + 2e -> Cd(s)
+8.40 V
0 -1.92V
+1.04 V
+1.12 V
+5.04 V
E° = +1.52 V
E° = -0.40 V

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Cu2+(aq)+Ni(s)Cu(s)+Ni2+(aq) (b) 2Ag(s)+Cl2(g)2AgCl(s) (c) Cl2(g)+2I(aq)2Cl(aq)+I2(s)
It took 150. s for a current of 1.25 A to plate out 0.109 g of a metal from a solution containing its cations. Show that it is not possible for the cations to have a charge of 1+.
What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).