Q: Draw enantiomers for the following compound using perspective formulas. Br CH3CHCH2OH Draw the…
A: Enantiomers are a type of stereoisomer where two molecules are non-superimposable mirror images of…
Q: (lab)1. What is the % yield of recovered caffeine? recovered is 10 mg. (Post lab) 2. What was the %…
A: 1Q)To calculate the % yield, we need the theoretical yield. Since the theoretical yield is not…
Q: 23
A: Step 1:Step 2: Step 3: Step 4:
Q: Show how you might use a nucleophilic substitution reaction of 1-bromopropane to synthesize each of…
A: e. Butanoic acidNucleophile: Cyanide ion (CN-)Reaction conditions: Sodium cyanide (NaCN) in…
Q: [References] For each of the species below, identify any cyclic conjugated system, then: A.…
A: The following conditions required for aromaticity: Aromatic compounds: 1. The structure must be…
Q: Bookmarks Window Help achieve.macmillanlearning.com Macmillan Learning ots stion 14 of 32 > tv The…
A: Step 1: Step 2: Step 3: Step 4:
Q: Name it according to IUPAC rules.
A: Step 1: Step 2: Step 3: Step 4:
Q: An oil-diffusion pump aided by a mechanical forepump can readily produce a “vacuum” with pressure 10…
A: The Ideal Gas Law is a fundamental principle in the study of physical chemistry and thermodynamics.…
Q: Show work with explanation needed. Don't give Ai generated solution
A: Step 1: Lewis structureChemical structure represents the valence electrons present in each atom of…
Q: Air in a piston/cylinder assembly at 200 kPa and 500 K is expanded in a constant-pressure process to…
A:
Q: Please correct answer and don't use hand raiting
A: Step 1:To keep the temperature from changing, the heat absorbed or released by dissolving one…
Q: The buffer mentioned in the image is from the following question:"What is the pH of a buffer made by…
A: The pH of buffer solution calculation:Step 1:The buffer prepared from weak acid and their conjugate…
Q: Which chloride will most rapidly undergo solvolysis in aqueous enthanol?
A: Approach to solving the question: As we know, solvolysis is a type of SN1 reaction in which the…
Q: Draw a Newman projection for the conformer shown below as viewed from the left side of the molecule.…
A: This may help you.
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Approach to solving the question: Analyze the Molecular Formula (C₄H₆NPCl):C₄H₆ means there are 4…
Q: Please correct answer and don't use hand raiting
A: This MO diagram of SCN- showing that the alternating lobes of electron density above & below the…
Q: The ionization energy of silver is 731 kJ/mol. Is light with a wavelength of 415 nm sufficient to…
A: To answer this question, we need to calculate the energy of a photon with a wavelength of 415 nm and…
Q: CCI4, an important commercial solvent, is prepared by the reaction of Cl2(g) with a carbo compound.…
A: Step 1: Step 2: Step 3: Step 4:
Q: Help this chemistry question
A: Step 1:The nucleophilic substitution reaction is a reaction in which a nucleophile replaces the…
Q: (b) The molar conductivity (^m) of the acetic acid is given as 5.27 x 104 S m² mol-¹ at a…
A: Step 1: Step 2: Step 3: Step 4:
Q: is it possible to have a cis-1-tert-butyl-2-methylcyclohexane that is equitorial for both…
A:
Q: (not a graded assignment just aleks practice)
A: Draw the major productCH3-O-CH2-C(CH3)(CH2CH2CH3)2 This molecule is formed by replacing the Cl with…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Part 2: Explanation:We are tasked with calculating the enthalpy change (ΔH) and the heat (q) for…
Q: The mean radius of an orbital on the hydrogen atom is given by the expression: = 1(1+1)\n²a n²…
A:
Q: None
A: Part B: compound: Parent name: The longest continuous carbon chain has 5 carbon atoms. Therefore,…
Q: None
A: To solve this problem, we'll go through it step by step.*Step 1: Write the balanced chemical…
Q: Please correct answer and don't used hand raiting
A:
Q: Please correct answer and don't use hand rating
A: Check the all atom connectivity's for each structure. If they are different, then they are not…
Q: Part II: Titration of Vinegar with Standaralzed Naun Report Table AV.4: Part 2 Calculations. Data…
A: Step 1:Moles of NaOH = Molarity of NaOH * Volume of NaOH Step 2:Moles of Acetic Acid = Moles of NaOH…
Q: A chemist has three different acid solutions. The first acid solution contains 20% acid, the second…
A: Let's denote the amount of the 20% solution as x, the amount of the 40% solution as y, and the…
Q: Please correct answer and don't use hand raiting
A: The image shows two different injection techniques, often used in gas chromatography (GC): 1. Split…
Q: 18
A:
Q: Show work. don't give Ai generated solution
A: Approach to solving the question:To write the IUPAC name of the given structure, we use the…
Q: . What is the pH of a buffer made by dissolving 0.200 mol NaH2PO4 (s) and 0.300 mol Na₂HPO4 in a…
A:
Q: Predict the products of this organic reaction: Pt + 2 H₂ ? Specifically, in the drawing area below…
A:
Q: What is the suspected pKa value for this compound
A: Benzenesulfonamide Overview Structure: Benzenesulfonamide consists of a benzene ring attached to a…
Q: Not 52.9 or 56.0
A:
Q: Consider the following proposed reaction mechanism: Step 1: F2 + 2 NO2 → NO2F + F + NO2 Step 2: F +…
A: In the given reaction mechanism, we have two steps. In the first step, the reactants are F2 and NO2.…
Q: The second end point in the titration curve does not have an easy to define equivalence point and…
A: Analysis of the First Derivative — The first derivative of the titration curve, seen in the middle…
Q: Show work .give correct solution. Don't give Ai generated solution
A:
Q: None
A:
Q: Please correct answer and don't use hand rating
A: Part 2:Explanation: Step 1: Calculate the total number of electrons for [NiCl₄]²⁻.- Ni²⁺ ion: Ni is…
Q: Mass of empty weighing paper Mass of weighing paper + unknown Mass of unknown Trial 1 Trial II Trial…
A: StepsGiven:Molarity of H2SO4 = 2 MVolume of H2SO4 = 20.00 mL = 0.0200 LCalculation:Moles of H2SO4 =…
Q: A chemical reaction involves the reactants A and B, and the product C. Use the experimental data…
A: The order of the reaction with respect to each reactant can be determined by comparing the rates of…
Q: Experiment for Kinetics – The Iodine Clock Reaction Results A1+B in 10 degree: Trial 1: it took…
A: First, we need to calculate the average time it took for the reaction to occur at each temperature.…
Q: 0.5 pointS Choose the most stable chair conformation of the following molecule. Choose only one…
A: Most stable chair conformation of trisubstituted cyclohexane:In the trisubstituted cyclohexane,…
Q: Give detailed mechanism Solution with explanation needed..avoid handwritten Solution. Don't give Ai…
A: Step 1:The reactant is a tertiary alcohol with an iodine substituent in a cyclohexane ring. The…
Q: A sample of gas contains 1.97 moles at 37.8 °C in a volume of 3.61 L. If 0.530 moles of gas are…
A: The first step is to convert the temperatures from Celsius to Kelvin because the ideal gas law uses…
Q: Set up the dissociation expression for water at equilibrium.
A: Step 1:The following equation can be used to represent the dissociation of water at equilibrium:…
Q: Both enantiomers of a-terpineneol may be isolated from various natural sources: the (S) isomer is a…
A: To determine the number of chiral centers in this molecule, we look for carbon atoms that have four…
I need to rank these from highest to lowest priority but do not understand how
Step by step
Solved in 2 steps
- We used "dry" dichloromethane this week, where all water was removed from solvent by first adding a chemical absorbent then distilling the solvent. Why did we need to ensure no water was in the reaction? Choose TWO of the following that are true. (hint: think about the reaction mechanism and what could happen if water were present) 000 water could behave as a nucleophile and perform a "hydrolysis" reaction on pthalic anhydride, so the intended reaction would not proceed water would decompose the catalyst, so the intended reaction would not proceed water would behave as an electrophile and would be attacked by p-xylene, so the intended reaction would not proceed even a little water would lower solubility of reactants dramaticallyf) о- -S- 11 (CH3)2CHOH Δ13. Classify the pairs of molecules as not the same molecule, structural isomers, diastereomers. enantiomers or identical. Circle any molecules that are not achiral. (a) (b) (c) F X Br. H H HY CI "Br Br H H CI H3C Br H Br I I Br CI H Br CH H H CH3 Br
- Rank each of the representations of NOCl from best to worst, placing the best structure on top and the worst at the bottom.d and e only(CH3)3C- (CHa)3C Br Br cis-1-bromo-4-tert-butylcyclohexane trans-1-bromo-4-tert-butylcyclohexane a. The cis and trans isomers of 1-bromo-4-tert-butylcyclohexane react at different rates with KOC(CH)3 to afford the same mixture of enantiomers A and B. Draw the structures of A and B. b. Which isomer reacts faster with KOC(CHa)g? Offer an explanation for this difference in reactivity. c. Reaction of cis-1-bromo-4-tert-butylcyclohexane with NAOCH3 affords C as the major product, whereas reaction of trans-1-bromo-4-tert-butylcyclohexane affords D as the major product. Draw the structures for C and D. d. The cis and trans isomers react at different rates with NaOCH3. Which isomer reacts faster? Offer an explanation for the difference in reactivity. e. Why are different products formed from these alkyl halides when two different alkoxides are used as reagents?
- Name the following molecules. Don't forget stereochemistry which is indicated for each molecule!! F H H H CH₂CH3 H. CI H CH3. H CI H- H–|CH,CH,CH3 -CH3 CH₂CH3 Br F HIIH H,, н C(CH3)3 HH3C-C=C-CH2-CH-CH3 excess H2 ČH3J of Br G K OH Br H L OCH 3 of 1 M OH NH (i) Compound H is an example of what functional group? Select alternative (ii) Compound G is classified as a: Select alternative ✓. (iii) Which compound has all carbons sp2 hybridised? Select alternative ✓ (iv) Which two compounds in Table 1 are constitutional isomers? Select alternative (v) Which statement best describes the stereochemistry of compo G? Select alternative (vi) Which compound in Table 1 is the MOST polar? Select alternative (vii) What is the systematic (IUPAC) name of compound G? Select alternative (viii) Which compounds will have MORE than 4 signals in their 13C NMR spectra? Select alternative (ix) Which electrophile from Table 1 will react fastest in an SN1 reaction? Select alternative (x) How many constitutionally isomeric alkenes will be formed when compound L reacts with NaOH? Select alternative (xi) Which compound(s) from Table 1 can be used to form a Grignard reagent? Select alternative (xii) Which functional groups can be…
