Interpretation:
Whether the standard enthalpy of the reaction is equal to the standard enthalpy of formation or not is to be determined.
Concept introduction:
The standard enthalpy of a reaction is the amount of enthalpy to occur under standard conditions.
The standard enthalpy of a reaction can be determined using the equation given below:
Here, the
The value of enthalpy of the formation of an element is zero at its most stable state.
Answer to Problem 87AP
Solution:
(a)
(b)
(c)
(d)
Explanation of Solution
a)
The reaction is given as follows:
Hydrogen in its
For the given equation, the enthalpy of the reaction is as follows:
The enthalpy of formation is zero for
Hence, for the reaction
b)
The reaction is given as follows:
Oxygen in its
For the given equation, the enthalpy of the reaction is as follows:
The enthalpy of formation is zero for
Hence, for the reaction
c)
The reaction is given as follows:
Hydrogen in its
For the given equation, the enthalpy of the reaction is as follows:
The enthalpy of formation is zero for
Hence, for the reaction
d)
The reaction is given as follows:
Oxygen is in its diatomic form, that is,
For the given equation, the enthalpy of the reaction is as follows:
The enthalpy of formation is zero for
Hence, for the reaction
Want to see more full solutions like this?
Chapter 5 Solutions
Chemistry
- Chlorine dioxide, ClO2, is a reddish yellow gas used in bleaching paper pulp. The average speed of a ClO2 molecule at 25C is 306 m/s. What is the kinetic energy (in joules) of a ClO2 molecule moving at this speed?arrow_forwardThe complete combustion of acetylene, C2H2(g), produces 1300. kJ of energy per mole of acetylene consumed. How many grams of acetylene must be burned to produce enough heat to raise the temperature of 1.00 gal water by 10.0c if the process is 80.0% efficient? Assume the density of water is 1.00 g/cm3arrow_forwardWhen solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forward
- A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.arrow_forwardNatural gas companies in the United States use the therm as a unit of energy. One therm is 1105 BTU. (a) How many joules are in one therm? (1J=9.48104BTU) (b) When propane gas, C3H8, is burned in oxygen, CO2 and steam are produced. How many therms of energy are given off by 1.00 mol of propane gas?arrow_forwardThe enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.arrow_forward
- A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?arrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forwardA rebreathing gas mask contains potassium superoxide, KO2, which reacts with moisture in the breath to give oxygen. 4KO2(s)+2H2O(l)4KOH(s)+3O2(g) Estimate the grams of potassium superoxide required to supply a persons oxygen needs for one hour. Assume a person requires 1.00 102 kcal of energy for this time period. Further assume that this energy can be equated to the heat of combustion of a quantity of glucose, C6H12O6, to CO2(g) and H2O(l). From the amount of glucose required to give 1.00 102 kcal of heat, calculate the amount of oxygen consumed and hence the amount of KO2 required. The ff0 for glucose(s) is 1273 kJ/mol.arrow_forward
- Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJarrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardAcetic acid, HC2H3O2, is the sour constituent of vinegar (acetum is Latin for vinegar). In an experiment, 3.58 g of acetic acid was burned. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) If 52.0 kJ of heat evolved, what is H per mole of acetic acid?arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningPhysical ChemistryChemistryISBN:9781133958437Author:Ball, David W. (david Warren), BAER, TomasPublisher:Wadsworth Cengage Learning,
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningWorld of ChemistryChemistryISBN:9780618562763Author:Steven S. ZumdahlPublisher:Houghton Mifflin College Div