Interpretation:
The metal which takes longer time to increase its temperature, out of the given metals, A and B, under the given conditions, is to be predicted.
Concept Introduction:
The amount of heat absorbed by a given mass of substance depends upon the specific heat capacity of the substance. Higher is the specific heat capacity, higher is the heat required to raise the temperature of substance, and lesser is the absorption of heat by the substance.
The specific heat (s) of a substance is the amount of heat required to raise the temperature of 1 g of the substance by
The heat absorbed by a substance in the given system is calculated by the formula,
Here,
Want to see the full answer?
Check out a sample textbook solutionChapter 5 Solutions
Chemistry
- A piece of lead of mass 121.6 g was heated by an electrical coil. From the resistance of the coil, the current, and the Time the current flowed, it was calculated that 235 J of heat was added to the lead. The temperature of the lead rose from 20.4C to 35.5C. What is the specific heat of the lead?arrow_forwardWhat mass of acetylene, C2H2(g), must be burned to produce 3420 kJ of heat, given that its enthalpy of combustion is 1301 kJ/mol? Compare this with the answer to Exercise 5.91 and determine which substance produces more heat per gram.arrow_forwardA piece of unknown solid substance weighs 437.2 g, and requires 8460 J to increase its temperature from 19.3 °C to 68.9 °C. (a) What is the specific heat of the substance? (b) If it is one of the substances found in Table 5.1, what is its likely identity?arrow_forward
- Enthalpy a A 100.-g sample of water is placed in an insulated container and allowed to come to room temperature at 21C. To heat the water sample to 41C, how much heat must you add to it? b Consider the hypothetical reaction,2X(aq)+Y(l)X2Y(aq)being run in an insulated container that contains 100. g of solution. If the temperature of the solution changes from 21C to 31C, how much heat does the chemical reaction produce? How does this answer compare with that in part a? (You can assume that this solution is so dilute that it has the same heat capacity as pure water.) c If you wanted the temperature of 100. g of this solution to increase from 21C to 51C, how much heat would you have to add to it? (Try to answer this question without using a formula.) d If you had added 0.02 mol of X and 0.01 mol of Y to form the solution in part b, how many moles of X and Y would you need to bring about the temperature change described in part c. e Judging on the basis of your answers so far, what is the enthalpy of the reaction 2X(aq) + Y(l) X2Y(aq)?arrow_forwardA 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forward
- The equation for the fermentation of glucose to alcohol and carbon dioxide is: C6H12O6(aq) 2C2H5OH(aq) + 2CO2(g) The enthalpy change for the reaction is 67 kJ. Is this reaction exothermic or endothermic? Is energy, in the form of heat, absorbed or evolved as the reaction occurs?arrow_forwardThe temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.arrow_forwardHow much heat is absorbed by a 44.7-g piece of leadwhen its temperature increases by 65.4°C?arrow_forward
- How much will the temperature of a cup (180 g) of coffee at 95 C be reduced when a 45 g silver spoon (specific heat 0.24 J/g C) at 25 C is placed in the coffee and the two are allowed to reach the same temperature? Assume that the coffee has the same density and specific heat as water.arrow_forwardAn iron skillet weighing 1.63 kg is heated on a stove to 178C. Suppose the skillet is cooled to room temperature, 21C. How much heat energy (in joules) must be removed to affect this cooling? The specific heat of iron is 0.449 J/(gC).arrow_forwardWhen one mole of ethylene gas, C2H4, reacts with fluorine gas, hydrogen fluoride and carbon tetrafluoride gases are formed and 2496.7 kJ of heat are given off. What is Hf for CF4(g)?arrow_forward
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- Living By Chemistry: First Edition TextbookChemistryISBN:9781559539418Author:Angelica StacyPublisher:MAC HIGHERChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co