Concept explainers
Interpretation:
The half cell reactions and cell notation should be written and cell potential (EMF) of given voltaic cell reaction should be calculated by using standard reduction potentials.
Concept introduction:
Cell reaction:
The overall reaction that occurs in the cell is known as cell reaction and it is given by sum of two half cell reactions.
Cell notations:
The terms used to designating the particular voltaic cell by easy and convenient ways are known as cell notation.
Representation of an
Representation of an electrochemical Cell was recommended by IUPAC at 1953 and they are Zinc-Copper cell.
A phase boundary between metal electrode and ion solution (electrolyte) are represented by a single vertical line (|).
A double vertical line (||) represents the salt bridge between two half cells.
Left side of the double vertical line (||), the anodic half cell reaction would be written and oxidation occurs at that electrode.
Right side of the double vertical line (||), the cathode half cell reaction would be written and reduction occurs at that electrode.
The electron flow is from anode to cathode in the outer circuit.
Cell potential (EMF):
The maximum potential difference between two electrodes of voltaic cell is known as cell potential.
If standard reduction potentials of electrodes are given the cell potential (EMF) is given by,
Where,
Trending nowThis is a popular solution!
Chapter 19 Solutions
General Chemistry - Standalone book (MindTap Course List)
- A voltaic cell is constructed in which one half-cell consists of a silver wire in an aqueous solution of AgNO3.The other half cell consists of an inert platinum wire in an aqueous solution containing Fe2+(aq) and Fe3+(aq). (a) Calculate the cell potential, assuming standard conditions. (b) Write the net ionic equation for the reaction occurring in the cell. (c) Which electrode is the anode and which is the cathode? (d) If [Ag+] is 0.10 M, and [Fe2+] and [Fe3+] are both 1.0 M, what is the cell potential? Is the net cell reaction still that used in part (a)? If not, what is the net reaction under the new conditions?arrow_forwardWhat is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?arrow_forwardAn electrolytic cell is set up with Cd(s) in Cd(NO3)2(aq) and Zn(s) in Zn(NO3)2(aq). Initially both electrodesweigh 5.00 g. After running the cell for several hours theelectrode in the left compartment weighs 4.75 g. (a) Which electrode is in the left compartment? (b) Does the mass of the electrode in the right compartmentincrease, decrease, or stay the same? If the masschanges, what is the new mass? (c) Does the volume of the electrode in the right compartment increase, decrease, or stay the same? If the volumechanges, what is the new volume? (The density of Cd is8.65 g/cm3.)arrow_forward
- Consider the following cell running under standard conditions: Fe(s)Fe2+(aq)Al3+(aq)Al(s) a Is this a voltaic cell? b Which species is being reduced during the chemical reaction? c Which species is the oxidizing agent? d What happens to the concentration of Fe3+(aq) as the reaction proceeds? e How does the mass of Al(s) change as the reaction proceeds?arrow_forwardGive the notation for a voltaic cell whose overall cell reaction is Mg(s)+2Ag+(aq)Mg2+(aq)+2Ag(s) What are the half-cell reactions? Label them as anode or cathode reactions. What is the standard cell potential of this cell?arrow_forwardAnother type of battery is the alkaline zinc-mercury cell, in which the cell reaction is Zn(s) + HgO(s) Hg() + ZnO(s) E = + 1.35 V (a) What is the standard free energy change for this reaction? (b) The standard free energy change in a voltaic cell is the maximum electrical energy that the cell can produce. If the reaction in a zinc-mercury cell consumes 1.00 g mercury oxide, what is the standard free energy change? (c) For how many hours could a mercury cell produce a 10-mA current if the limiting reactant is 3.50 g mercury oxide?arrow_forward
- Draw a diagram of each cell. Label the anode, the cathode, the species in each half-cell solution, the direction of electron movement in an external circuit, and thedirection of movement of ions within the cell. (a) Cu(s) | Cu2+(aq) || Fe2+(aq) |Fe(s) (b) Pt(s) | H2O2(aq), H+(aq) || Fe2+(aq), Fe3+(aq) | Pt(s)arrow_forwardUse the data from the table of standard reduction potentials in Appendix H to calculate the standard potential of the cell based on each of the following reactions. In each case, state whether the reaction proceeds spontaneously as written or spontaneously in the reverse direction under standard-state conditions. (a) H2(g)+Cl2(g)2H+(aq)+2Cl(aq) (b) Al3+(aq)+3Cr2+(aq)Al(s)+3Cr3+(aq) (c) Fe2+(aq)+Ag+(aq)Fe3+(aq)+Ag(s)arrow_forwardIn principle, a battery could be made from aluminum metal and chlorine gas. (a) Write a balanced equation for the reaction thatwould occur in a battery using Al3+(aq) | Al(s) andCl2(g) | Cl(aq) half-cells. (b) Identify the half-reaction at the anode and at the cathode. Do electrons flow from the Al electrode when thecell does work? Explain. (c) Calculate the standard potential, Ecell, for the battery.arrow_forward
- At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.arrow_forwardThe voltaic cell is represented as Zn(s)Zn2+(1.0M)Cu2+(1.0M)Cu(s) Which of the following statements is not true of this cell? a The mass of the zinc electrode, Zn(s), decreases as the cell runs. b The copper electrode is the anode. c Electrons flow through the external circuit from the zinc electrode to the copper electrode. d Reduction occurs at the copper electrode as the cell runs. e The concentration of Cu2+ decreases as the cell runs.arrow_forwardYou have 1.0 M solutions of Al(NO3)3 and AgNO3 along with Al and Ag electrodes to construct a voltaic cell. The salt bridge contains a saturated solution of KCl. Complete the picture associated with this problem by a writing the symbols of the elements and ions in the appropriate areas (both solutions and electrodes). b identifying the anode and cathode. c indicating the direction of electron flow through the external circuit. d indicating the cell potential (assume standard conditions, with no current flowing). e writing the appropriate half-reaction under each of the containers. f indicating the direction of ion flow in the salt bridge. g identifying the species undergoing oxidation and reduction. h writing the balanced overall reaction for the cell.arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning