Interpretation:
A half-cell reaction is given. The value of
Concept introduction:
The relationship between reduction potential and standard reduction potential value and activities of species present in an
The value of
At room temperature the above equation is specifies as,
This relation is further used to determine the relation between
Solubility product is applied only for those ionic compounds that are sparingly soluble. The product of solubility of ions is called solubility product and solubility is present in moles per liter.
To determine: The value of cell potential
Want to see the full answer?
Check out a sample textbook solutionChapter 17 Solutions
EBK CHEMISTRY: AN ATOMS FIRST APPROACH
- Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.arrow_forwardAn aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?arrow_forwardAn electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?arrow_forward
- What is the standard cell potential you would obtain from a cell at 25C using an electrode in which Hg22+(aq) is in contact with mercury metal and an electrode in which an aluminum strip dips into a solution of Al3+(aq)?arrow_forwardAt 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.arrow_forwardCalculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)arrow_forward
- At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.arrow_forwardA solution contains the ions H+, Ag+, Pb2+, and Ba2+, each at a concentration of 1.0 M. (a) Which of these ions would be reduced first at the cathode during an electrolysis? (b) After the first ion has been completely removed by electrolysis, which is the second ion to be reduced? (c) Which, if any, of these ions cannot be reduced by the electrolysis of the aqueous solution?arrow_forwardConsider a galvanic cell based on the following half-reactions: a. What is the standard potential for this cell? b. A nonstandard cell is set up at 25C with [Mg2+] = 1.00 105 M. The cell potential is observed to be 4.01 V. Calculate [Au3+] in this cell.arrow_forward
- Consider the following cell reaction at 25C. 2Cr(s)+3Fe2+(aq)2Cr3+(aq)+3Fe(s) Calculate the standard cell potential of this cell from the standard electrode potentials, and from this obtain G for the cell reaction. Use data in Appendix C to calculate H; note that Cr(H2O)63+(aq) equals Cr3+(aq). Use these values of H and G to obtain S for the cell reaction.arrow_forwardCalculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)arrow_forwardConsider the following cell running under standard conditions: Fe(s)Fe2+(aq)Al3+(aq)Al(s) a Is this a voltaic cell? b Which species is being reduced during the chemical reaction? c Which species is the oxidizing agent? d What happens to the concentration of Fe3+(aq) as the reaction proceeds? e How does the mass of Al(s) change as the reaction proceeds?arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningPrinciples of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning