Concept explainers
Using KF as an example, write equations that refer to ∆Hsoln and ∆Hhyd· Lattice energy was defined in Chapter 3 as ∆H for the reaction K+(g) + F− (g) → KF(s). Show how you would utilize Hess’s law to calculate ∆Hso1n from ∆Hhyd and ∆HLE for KF, where ∆HLE = lattice energy. ∆Hsoln for KF, as for other soluble ionic compounds, is a relatively small number. How can this be since ∆Hhyd and ∆HLE are relatively large negative numbers?
Trending nowThis is a popular solution!
Chapter 11 Solutions
Student Solutions Manual for Zumdahl/Zumdahl/DeCoste?s Chemistry, 10th Edition
Additional Science Textbook Solutions
Cosmic Perspective Fundamentals
Campbell Biology: Concepts & Connections (9th Edition)
Organic Chemistry
Campbell Biology in Focus (2nd Edition)
Chemistry: Structure and Properties (2nd Edition)
Human Physiology: An Integrated Approach (8th Edition)
- 9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?arrow_forwardWould the amount of heat absorbed by the dissolution in Example 5.6 appear greater, lesser, or remain the same if the heat capacity of the calorimeter were taken into account? Explain your answer.arrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forward
- Dissolving 6.00 g CaCl2 in 300 mL of water causes the temperature of the solution to increase by 3.43 C. Assume that the specific heat of the solution is 4.18 J/g K and its mass is 306 g. (a) Calculate the enthalpy change when the CaCl2 dissolves. Is the process exothermic or endothermic? (b) Determine H on a molar basis for CaCl2(s)H2OCa2+(aq)+2Cl(aq)arrow_forwardUnder what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forwardHow is the sign of q, heat, defined? How does it relate to the total energy of the system?arrow_forward
- Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.arrow_forwardWhen a gas expands, what is the sign of w? Why? When a gas contracts, what is the sign of w? Why? What are the signs of q and w for the process of boiling water?arrow_forwardA pot of cold water is heated on a stove, and when the water boils, a fresh egg is placed in the water to cook. Describe the events that are occurring in terms of the zeroth law of thermodynamics.arrow_forward
- At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?arrow_forwardGiven the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.arrow_forwardThe combustion of methane can be represented as follows: a. Use the information given above to determine the value of H for the combustion of methane to form CO2(g) and 2H2O(l). b. What is Hf for an element in its standard state? Why is this? Use the figure above to support your answer. c. How does H for the reaction CO2(g) + 2H2O (1) CH4(g) + O2(g) compare to that of the combustion of methane? Why is this?arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning