Q: 3) The following gases were bubbled through water, which of the gases is most likely to dissolve?a.…
A: Approach to solving the question: TO identify the gas which is most soluble in water depends on the…
Q: By what factor will the pressure of a sample of a gas change if the volume is reduced by 1/3 while…
A: Step 1: Step 2:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Step 1:The concentration of a solution can be calculated using the formula A = εcl, where A is the…
Q: 4.41 Which compound would you expect to be the more stable: cis-1,2-dimethylcyclopropane…
A:
Q: 5 1 point Calculate the keq for ½ B2 + E = D, given: 3A+B22C+2D; Keq = 1.65 x 10-4 3A=2C+2E, Keq =…
A: The problem asks us to calculate the equilibrium constant, K_eq, for the reaction:1/2 B2 + E…
Q: Please correct answer and don't use hand rating
A: Step 1:Step 2: Step 3: Step 4:
Q: Show work. don't give Ai generated solution
A: Step 1: If the volume of the equilibrium system for the reaction 2SO3 (g) --><__ 2SO2(g)…
Q: What is the geometry at the central nitrogen atom in the following anion? [Hint: Draw a Lewis…
A: The given anion is H₂NO⁻, where the nitrogen is the central atom. To determine the geometry around…
Q: Show work with explanation needed. Don't give Ai generated solution
A: (a)Longest Chain: The main chain has 7 carbons, so the base name is heptene.Double Bond: The double…
Q: K Problem 9.b of 28 Submit Curved arrows are used to illustrate the flow of electrons. Using the…
A:
Q: Show work...don't give Ai generated solution
A: As you can see from the image below, the sodium atom loses the outer electron to become a sodium…
Q: What is the concentration of sodium ions in 0.245 M Na₂CO₃?
A: The chemical formula of Sodium Carbonate is Na2CO3. This means that for each molecule of Sodium…
Q: Tiny samples of aqueous solutions are sketched below, as if under a microscope so powerful that…
A: Answer: Q is the reaction quotient at any time of reaction.As the reaction proceeds there is a…
Q: Give detailed mechanism Solution with explanation needed..avoid handwritten Solution. Don't give Ai…
A: Step 1:The reactant is a tertiary alcohol with an iodine substituent in a cyclohexane ring. The…
Q: Draw the products of the following reactions considering regiochemistry where applicable. Note that…
A: I assumed this was the question:If yes, then this is the answer:
Q: Draw the simplest mechanism possible for the reaction below. You may need to re-draw structures to…
A: ----I m sure this will help youI hope you will appreciate my efforts Thank you!!!!Happy…
Q: 1. Calculation for conversion of Maleic to Fumaric acid (2 points) Mass of Maleic acid Molar mass of…
A:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Part 2: Explanation:We are tasked with calculating the enthalpy change (ΔH) and the heat (q) for…
Q: Give the geometry, number of d e-, draw the CF splitting diagram, number of unpaired e-, and…
A:
Q: Assume you are trying to develop a GC-MS instrument which would be used in the field (unit must be…
A: For a GC-MS instrument, the ionization method should be chosen based on the nature of the compounds…
Q: help asap
A: An energy level diagram visually represents the energy staes of electrons in an atom or…
Q: 4-dimethylaminopyridine (4-DMAP) is a good catalyst for acylation of 2° alcohols
A: Step 1:Step 2:Step 3:
Q: Please correct answer and don't use hand rating
A: The reaction in the image shows a diene (1,3-cyclohexadiene) reacting with methyl vinyl ketone under…
Q: Balance this chemical equation.
A: Step 1 Normal equation is N2H4 =NH3 + N2Step 2By balancing 3N2H4=4NH3+N2
Q: 2. For the following: a. Draw the Lewis structure for each anion. b. Rank the anions from most…
A: i. F⁻, I⁻, Br⁻1. Lewis Structures:F⁻: I⁻: Br⁻: 2. Ranking of Anions (Stability):I⁻ > Br⁻ >…
Q: For the element lead Pb please answer the questions and be specific: 1. Write its proper…
A: Step 1:Answer1. The chemical symbol for lead is Pb.Isotope: Isotopes are distinct nuclear species…
Q: name fuctional groups of the ir specturm and obseverd absorbations as well as the bond sctreching…
A: Hydroxyl group (-OH): Observed absorption: 3437.9 cm^-1, 3332.5 cm^-1, 3183.1 cm^-1 Bond stretching:…
Q: Please correct answer and don't use hand rating
A: Given: molH+=0.065;V=1.00L;[HOCl]=0.365M;[OCl−]=0.249M;Ka=4.0x10−8The constant is obtained here:…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Part 2: Explanation:We are tasked with calculating the rate constant (k) for the reaction \( A + B…
Q: Consider the reaction between NO(g) and O2 (g) represented below. 02 NO. NO₂ What is the balanced…
A: 1. Reactants:(molecules with one blue and one red sphere).(molecules with two red spheres). 2.…
Q: HI + KOH ローロ - Predict the products of the reaction below. That is, complete the right-hand side of…
A: The given reaction is between hydroiodic acid (HI) and potassium hydroxide (KOH). This is an example…
Q: Please correct answer and don't use hand rating
A: Step 1: Enter Data into ExcelOpen Excel and create a new worksheet.In the first row, enter the…
Q: Please correct answer and don't use hand rating
A: we need to divide the molar mass of the element by Avogadro's number.Part 1: GeMolar mass of Ge…
Q: What volume of 0.25M lithium fluoride solution can be made by dissolving 5.0 g lithium fluoride,…
A: The molar mass of a compound is calculated by adding up the atomic masses of each element in the…
Q: Name these organic compounds
A: Step 1: Guidelines for IUPAC nomenclature of organic compounds:Consider the carbon chain with the…
Q: Structure and Bonding Identifying functional groups in organic molecules written in skeletal... 35…
A: Approach to solving the question: Simply identify the type of functional groups present in the given…
Q: Rank the following structures in the order of their acidity (1=most acidic, 4=least cidic) SH OH SH…
A: CH3-CH2-CH2-SH (with three fluorine atoms)The introduction of three fluorine atoms increases the…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A:
Q: (not a graded assignment just aleks practice)
A: Draw the major productCH3-O-CH2-C(CH3)(CH2CH2CH3)2 This molecule is formed by replacing the Cl with…
Q: y Bookmarks Window Help achieve.macmillanlearning.com Macmillan Learning +1271 pts /1800 ŕtv Q -> O…
A: This reaction is based on acid - catalyzed hydration of alkene in which water added across the…
Q: If Kc = 0.0045 for the reaction below at 298.0 K, then what is the value of Kp? (R = 0.0821…
A: The relationship between the equilibrium constants Kp and Kc is given by the…
Q: 3. Which of the compounds below will rotate the plane of plane-polarized light? 1 2 3 4 5 A) only 1…
A: Step 1: Step 2: Step 3: Step 4:
Q: None
A: Step 1: Step 2:Increased pressure favors reactions with a decrease in…
Q: Problem V The Energy of the levels of the hydrogen atoms were calculated to be: (1) E = -Rh n Is the…
A: We're given the energy levels of a hydrogen atom and Rydberg's equation. We need to:Calculate the…
Q: Write the balanced net ionic equation for the following (If no reaction write NR): a. The reaction…
A: At the equivalence point in a titration, the amount of titrant (in this case, HBr) added is just…
Q: Below is the Lewis structure of the bicarbonate (HCO3) io ion. : 0: .... H:0:C:0: Count the number…
A: To solve the problem, we need to count the bonding pairs and lone pairs around the left oxygen atom…
Q: Draw particulate models of two of the amine molecules above. Draw how the strongest…
A: * A step by step explanation is shown below.Particulate Models of Amine Molecules and Hydrogen…
Q: Draw the structure of all products of the mechanism below. H H. + H OH H H Click and drag to start…
A: The deprotonation will occur. The proton will give its electrons to N and N will become neutral from…
Q: In this section you should record any visual observations you make for denisty (colors,appearances…
A: The provided question discusses the observations and data collection for an experiment involving the…
Q: GMU QUESTION 7 An ethanol solution of 3.5 mg/100 ml of compound Y (150.0 g/mol) in a 1.00 cm quartz…
A: To calculate the molar extinction coefficient (ε) using the Beer-Lambert Law, we can use the…
Show work. Don't give Ai generated solution
Step by step
Solved in 2 steps with 2 images
- Which molecule below has the lowest pKa? 0000 A B D OH A OH B C OH D OHPregabalin, C3H17NO2 is used as a treatment of epilepsy and neuropathic pain. NH2 pK, = 4.2 %3D H. pK = HO, = 3.4 Select the equilibrium corresponding the to the pK, = 9.8 CgH18NO2 (aq) + H20 (I) C3H17NO2 (aq) + OH (aq) C3H16NO2 (aq) + H20 (1) CgH17NO2 (aq) + OH (aq) CgH17NO2 (aq) + H20 (1) C3H18NO2 *(aq) + OH (aq) C3H17NO2 (aq) + H20 (1) CgH16NO2 (aq)+ H30*(aq)Which of the following will have the highest pka? A. Co3?. B, HCO31 C. H2CO3 D. H2SO3 E. HCIO3
- Rank compounds L-P in order of decreasing acid strength, from lowest pk, to highest pka. Explain. L M2. Which molecule shown below should have the highest pKa? a. PH3 b. H2S c. SİH4 d. AIH39. Phosphotyrosine (shown below) has four ionizable functional groups (pK1 = 2.5, pKR1 = 2.1, pKr2 = 7.2, pK2 = 9.5). (a) Write the equilibrium equation for its four ionization forms and assign the proper pka for each ionization. DRAW the structure of phosphotyrosine in each ionization state. What is the net charge on the phosphotyrosine molecule in each ionization state? *H3N. pk2 - 9.5 .COOH pK, - 2.5 O=P-OH pKRI - 2.1 ÖH pKRI - 7.2 (b) Draw the titration curve of phosphorotyrosine and indicate each pKa and the isoelectric point (pl), indicate the molar equivalents of OH on the x-axis.
- Which of the compounds is most acidic? 이이이이이 01 Ol O III OV OV 10 IVThe weakest of the acids below is and its pK is The strongest of the acids below is and its pK is 4.21 4.76 imidazolium ion 5.64 8.20 succinate boric acid formic acid 4.21 4.76 imidazolium ion 5.64 8.20 succinate boric acid formic acid phosphoric acid succinic acid 3.75 7.00 p-nitrophenol 9.24 acetic acid 0.18 9.25 glycinamide ammonium ion 2.15 7.24At which pH would the following ionization state of methionine be the the most dominant species in solution? (pKa and pl vales are shown below) 0 H₂N-CH-C 1 2 CH₂ CH₂ S CH3 Methionine pka₁ = 2.28 pka₂ = 9.21 pl = 5.74