Q: This is a Brønsted-Lowry acid-base reaction. Draw structures for all the products, showing any…
A: Step 1: Step 2: Step 3: Step 4:
Q: 13.27 (a) Draw all constitutional isomers formed by monochlorination of each alkane with Cl₂ and hv.…
A: A) B)
Q: 1. What is the degree of polymerization for the polymer shown below: 25 HO_CH, GOH +25 HẠN—(CH,NH:…
A: The degree of polymerization (DP) is a concept in polymer science that refers to the number of…
Q: Don't use AI.
A: Approach to solving the question: Detailed explanation:Certain amino acids with ionizable side…
Q: Copper was determined in a river water sample by atomic absorption spectrometry and the method of…
A: Step 1: Determine the increase in absorbance due to the addition of the standard.Step 2: Calculate…
Q: Use the CIP rules to prioritize the following four groups from highest to lowest priority. Your…
A: Thank you.
Q: None
A: The Diels-Alder reaction is a classic and highly important reaction in organic chemistry used to…
Q: Please correct answer and don't use hand rating
A: The reaction Scheme isReagentFormula Wt. (g/mol)AmountMillimolesBoiling Point (°C)Melting Point…
Q: None
A: Step 1:(a) Here you can see carbon has two single bond, one double bond and zero lone pair When a…
Q: which of the following statement is false a. a liquid has a definite volume but it has no definite…
A: Step 1:True statement: (A)A liquids has definite volume but no definite shape.(B)A solid has…
Q: None
A: A free amino acid(s) can have its side chain involved in hydrogen bonding, let's analyze the given…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Question 4: Williamson Ether Synthesis Pathways for Butyl Methyl EtherPathway 1:CH3CH2CH2CH2ONa +…
Q: Please correct answer and don't use hand rating
A: The constant pressure heat capacity Cp of a gas can be obtained from the derivative of the enthalpy…
Q: Please correct answer and don't use hand rating
A: Given value of ∆H = 25.00 kJ/molGiven value of ∆S = 262.0 J/mol.K . In kJ/mol.K we can write it as…
Q: not use ai please Why is this incorrect?
A: The two resonance structures in the image you sent are shown with arrows indicating the movement of…
Q: None
A:
Q: Potassium permanganate, KMnO4, is standardized using high-quality sodium oxalate, Na2C2O4, in…
A: Step 1:
Q: image of question attached
A: Step 1:Question (6) solutionResonating Structure are given below Step 2:Step 3:Solution (6) B…
Q: Bookmarks Window Help Macmillan Learning achieve.macmillanlearning.com X Chapter 4 HW-General,…
A: 1. Top left molecule (long chain with a triple bond):This molecule is unsaturated. It contains a…
Q: Give detailed mechanism Solution with explanation needed....don't give Ai generated solution
A: Step 1:Dative bond formed between Lewis base to Lewis acid Step 2:Ether act as a Lewis base BF3…
Q: None
A:
Q: 13.47 Draw the products formed in each reaction and include the stereochemistry around any…
A: Step 1:An alkane's hydrogen atom is converted to a halogen to form a halogen alkane. Justification…
Q: None
A: In the alpha fragmentation, a bond coming from the carbon alpha to the oxygen is broken in half. One…
Q: Draw the correct product for the Diels-Alder reaction. + Select Draw Templates More Erase Reset…
A:
Q: Consider the following hypothetical scenarios and propose how theymay impact(a) the components of a…
A: Let's break down the impact of each scenario on both the calibration curve components and the…
Q: Don't use AI.
A: To draw a molecular orbital (MO) diagram for ethanol (CH₃CH₂OH), follow these steps:Step 1. Identify…
Q: None
A: PROBLEM 1: Step 1: Calculate the ValueThe cube root of 8.47: (8.471/3)=2.04So, the answer here 2.04…
Q: a. How many molecules of ethanol are in 2.1 mol of ethanol?
A: In chemistry, a mole is a unit of measurement for the amount of a substance. The mole is a standard…
Q: Please correct answer and don't use hend raiting
A: Step 1: The given molecule is in Newman projection and converted to Saw Horse projection by…
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: Given:Moles of Al = 13.0 mol (3 significant figures)Moles of Cl2 =…
Q: In the concentration range of 1 to 100 µg/mL P , phosphate suppresses the atomic absorption of Ca in…
A: Explanation:In the concentration range of 1 to 100 µg/mL of phosphate (P), phosphate ions suppress…
Q: Please correct answer and don't use hand rating
A: Part (a): Moles of Nitrogen Atoms in a 2.330 mol Sample of the Fertilizer Understand the Chemical…
Q: PROBLEMS Predict the chemical shifts for the signals in the proton NMR spectrum of each of the…
A: Thorough explanation of signals is given in these images.
Q: No need to explain just need the answer please ASAP thank you
A: The work function is given in electron volts (eV). We need to convert this to Joules (J) to be able…
Q: 3 1 point Consider the image of the graduated cylinder shown below. What would be the volume you…
A: Each unit in the given graduated cylinder is 10 mL. For example each unit increases by 10 mL, like…
Q: Please draw in detail the expected product C, explain selectivity and draw the arrow pushing…
A: I. CONCEPTS: A. Chromic acid (H2CrO4) is an oxidant used tor oxidizing alcohols. For primary…
Q: 5. When does the molecular weight of the polymer increase the most during a step-growth…
A: In a step-growth polymerization process, the polymer chains grow by the reaction of functional…
Q: C Figure 1 1. What type of hybridized carbon is depicted in Figure 1? a) sp b) sp² c) sp³ d) s y…
A: Carbon hybridization refers to the mixing of atomic orbitals to form new hybrid orbitals, which are…
Q: None
A: a): Structure of 3-Methylhexane3-Methylhexane has a six-carbon chain with a methyl group attached to…
Q: not use ai please
A: To perform data interpretation and analysis, especially for statistics and probability questions…
Q: Below you are given a 13C NMR for a compound with the chemical formula C7H7Br. With words and…
A:
Q: write the chemical structure of the alternating copolymer of Nylon 6 and Nylon 8
A: Step 1: The polymerization of each of the monomers that make up Nylon 6 and Nylon 8 results in the…
Q: Based on this 'H NMR spectrum, choose the compound that is the most likely to match the integration,…
A: Structure I: Two sets of chemically equivalent protons are there. Expected proton NMROne set of…
Q: Please correct answer and don't use hand rating
A:
Q: help please answer in text form with proper workings and explanation for each and every part and…
A: 3. Completing the sequential reaction:Reaction 1: Sodium oxide is solid which on reaction with water…
Q: Please correct answer and don't use hand rating
A: Step 1:Order of reaction with respect to H2 and I2 is one so the Rate equation r = k [ H2] [ I2 ]…
Q: 7. Complete the drawings below to represent an enantiomer and diastereomer of the compound in the…
A: Step 1: Step 2: Step 3: Step 4:
Q: The following diagram shows the relative energy of 2,3-dimethylbutane as one end of the molecule…
A: Step 1: As the given above Newman projection represent Eclipsed form of conformers. Step 2: Order of…
Q: Don't provide AI solution other wise I am dislikes.
A:
Q: None
A:
Step by step
Solved in 2 steps
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.
- When the conjugate acid of aniline, C6H5NH3+, reacts with the acetate ion, the following reaction takes place: C6H5NH3+(aq)+CH3COO(aq)C6H5NH2(aq)+CH3COOH(aq) If Kafor C6H5NH3+ is 1.35105 and Kafor CH3COOH is 1.86105 , what is K for the reaction?List the following compounds in order of increasing water solubility: a.ethoxyethane b.propanoic acid c.pentane d.1 butanolDraw the structure if the following compounds. benzoic propanoic anhyydride octyl butanoate 30methylhexanoyl chloride
- Please give small explanation.This compound has the common name of: ○ acetone O phenaldehyde acetophenone benzoic acid ○ benzaldehydeEthyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…when ethanoic acid reacts with diethylamine, provide the IUPAC of the major product formedWhich one of the following reacts with ethanoic acid and with phenol? A) Aqueous potassium hydroxide B) Bromine C) Calcium Carbonate D) Methanol and an acid catalyst
