Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple.  Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures.   A chemist ran the reaction and obtained 5.50 gg  of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures.   The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess ethanol? Express your answer in grams to three significant figures.

Q: Provide the IUPAC name of (CH3)3CCH₂CH₂NHCH₂CH3. N-methyl-3-ethyl-1-butanamine…

A: ->Aliphatic amines are named by naming the alkyl group or groups attached to nitrogen and…

Q: Explain in detail the structure of Lactic Acid.

A:

Q: Isoamyl acetate is the common name of the substance most responsible for the characteristic odor of…

A: Esters are a kind of organic molecules having functional groups, R-COO-R' where R and R' are the…

Q: Compare the families of alcohols, phenols, ethers, thiols and alkyl halides in terms of polarity,…

A: Comparision of the families of alcohols, phenols, ethers, thiols, alkyl halides in terms of…

Q: Hydrolysis of an acetal in aqueous acid gives an aldehyde or a ketone and two molecules of alcohol…

A: Acetals are the organic compounds having two RO- groups attached to one carbon. They are usually…

Q: Explain why 1-ethylpropene is the incorrect name for the following molecule. Provide the correct…

A:

Q: Classify the following characteristics of the organic reactions according to the type of organic…

A: Solution- Substitution reaction -  Reaction involving the replacement of one atom or group of atom.…

Q: Without any specific reaction conditions, potentially what functional groups could be formed between…

A: There is no reaction between two acids always acid reacts with base . -> Carboxylic acid reacts…

Q: Draw the skeletal structures of: phenyl benzoate, benanilide, benzoic acid, and 2-napthaldehyde and…

A: In this question, we will draw the structure of the given compounds and then identify their carbonyl…

Q: Draw the structures of the following compounds: Ethylcycohexane 2-propanone 2-methyl hexanoic acid…

A:

Q: Give a chemical test to distinguish between Propanal and Propanone.

A: The chemical test which helps to distinguish between Propanal and Propanone is shown below,

Q: What is the IUPAC name for CH3CH2CH2CH2OHCH3CH2CH2CH2OH? 5-pentanal pentanal 3-butanol 1-butanol…

A:

Q: Explain the General Features of Dehydration in Acid ?

A:

Q: What is the role of the acetic acid in the oxidation of Cyclohexanol to Cyclohexanone? Write the…

A: Given reaction,        Oxidation of cyclohexanol to cyclohexanone

Q: Draw the structure if the following compounds. benzoic propanoic anhyydride octyl butanoate…

A: 1 is anhydride . 2 is ester. and 3 is acyl chloride

Q: triethylammonium chloride structural formula

A: In structure of triethylammonium chloride , there are three ethyl groups attached to Nitrogen atom…

Q: 6) the preparation of hexyl ethanoate from an acid and an alcohol 7) the hydrolysis of methyl…

A: (6) The reaction in which alcohal and acid react and form Ester

Q: Which of the following best describes the solubility of aldehydes and ketones? A) They are all…

A: Aldehyde and ketones are called carbonyl compound.

Q: 2) Provide structures for the following compounds: a) ethyl acetate b) Pentanoic acid

A: Ans

Q: What is the structure when 3-methylbutanal reacts with phenylhydrazine?

A: When aldehyde or ketone reacts with phenylhydrazine then phenylhydrazone form.

Q: Draw a structural formula of the principal product formed when ethyl benzoate is treated with…

A: The synthesis of product transformation is shown below:

Q: What is an cyclic anion?

A: Abstraction of a proton from a cyclic compound lead to the formation of a cyclic anion.

Q: Draw the structural formula for the following compounds A) 2,3 -dimethyl-6-phenyloctanal

A:

Q: Which one of the following reacts with ethanoic acid and with phenol? A) Aqueous potassium…

A: The structure of ethanoic acid is shown below: The structure of phenol is shown below:

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.