Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.

Q: What is the formula of the hemiacetal of methanol and propanal? A CH3CH2CH(OCH3)OH CH3CH(OC2H5)OH…

A: given methanol - CH3OH propanal - CH3CH2CHO

Q: Compound X and compound Y are constitutional isomers with the molecular formula C5H₁0. Compound X…

A: Compound X and Y have molecular formula C5H10. Stereoisomers are isomers that differ in spatial…

Q: Without any specific reaction conditions, potentially what functional groups could be formed between…

A: There is no reaction between two acids always acid reacts with base . -> Carboxylic acid reacts…

Q: Explain Structure and Bonding of Alcohols, ethers, and epoxides ?

A: The general structure of alcohols, ethers and epoxides is ashown below, The alcohols contain a…

Q: The following compound undergoes an intramolecular reaction to form ethene and a product with a…

A: The given compound undergoes intramolecular cyclization to produce 5 membered ring as well as…

Q: The reaction is an example of: H₂C—C=C—CH₂ O elimination dehydration substitution oxidation…

A: we have to determine the type of reaction for the given reaction

Q: synthetic organic molecule, G, which contains both aldehyde and ether functional groups, is…

A: The objective of this question is to determine the functional groups present in the given structure.…

Q: Draw structural formulas for the hemiacetal and acetal formed from the  reagents. The stoichiometry…

A: Hemi-acetal: When only one group of ether is attached to the carbonyl groups. Acetal: When two…

Q: 4) Complete the following reaction by filling in the necessary reagents. OH 1) 2) OH O OH

A: This is kolbe reaction. Find out suitable reagent for conversion.

Q: What functional group is shown here: CH3CH₂COOH carboxylic acid ether alcohol ketone aldehyde

A:

Q: Draw the structure of Kodel, a polyester formed from 1,4-dihydroxymethylcyclohexane and terephthalic…

A: Kodel is polyester.  It is produced by the transesterification process.  It is a linear condensation…

Q: a) b) c) d) 4. Draw the correct structure of the alcohol starting material that would give the…

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: Benzocaine, a topical anesthetic, is prepared by treatment of 4-aminobenzoic acid with ethanol in…

A:

Q: What is the IUPAC name for the following compound? of O t-butyl cyclohexanecarboxylate O…

A: Write IUPAC name of the given structure---

Q: Which of the following compounds will undergo reaction with Tollens' reagent? A) butanal B)…

A: Tollen reagent gives a test with aldehyde and terminal Alkyne .Tollen reagent also reacts with…

Q: Write equations to show the synthesis pathway for ethyl 3-hydroxybutanoate, the flavouring in…

A: Introduction : 3-hydroxybutanoate belongs to the class of organic compounds known as beta hydroxy…

Q: Synthesize each compound.You may use benzene, acetylene (HC≡CH), ethanol, ethylene oxide, and any…

A: Benzene undergoes Friedel Crafts alkylation to give ethyl benzene which undergoes bromination by the…

Q: The product of the oxidation of t-butanol, shown below, is: H3C H3C -ОН t-butanol cannot be oxidized…

A: Information of question

Q: OH CH;CH,CHCHOCH,CH3 CH3

A: Applying definition of acetal and hemiacetal.

Q: are acetals and ketals stable to acid or base? Why?

A: Acetals are geminal diether of aldehyde. Ketals are geminal diether of ketone.

Q: What reactions and reagents can be used to make phenol from benzene if electrophilic aromatic…

A: Solution You can prepare phenols in massive quantities by the shift of the Na salt of benzol…

Q: Alkenes can be converted to alcohols by reaction with mercuric acetate to form a…

A:

Q: A 59.3 mL sample of 0.423 M NH4NO3 is diluted with water to a total volume of 245.3 mL. What is the…

A:

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.