The resistances of a series of aqueous NaClsolutions, formed by successive dilution of asample, were measured in a cell with cell constant(the constant C in the relation K = C/R) equal to0.2063 cm-1 and the following values were foundat 25°C:c/(mol | 0.00050 0.0010 0.0050 0.010 0.020 | 0.050dm-3)R/W33141669342.1174.1 89.08 37.14Find the molar conductance of Nacl at 25°C atinfinite dilution from the graph.

Molar conductivity, λm = k/c = specific conductivity/concentration in mole per liter = k/c k = C/R…

The resistances of a series of aqueous NaCl solutions, formed by successive dilution of a sample, were measured in a cell with cell constant (the constant C in the relation K = C/R) equal to 0.2063 cm¹ and the following values were found at 25°C: c/(mol 0.00050 0.0010 0.0050 0.010 0.020 0.050 dm-3) R/W 3314 1669 342.1 174.1 89.08 37.14 Find the molar conductance of NaCl at 25°C at infinite dilution from the graph.

The resistances of a series of aqueous NaCl solutions, formed by successive dilution of a sample, were measured in a cell with cell constant (the constant C in the relation K = C/R) equal to 0.2063 cm¹ and the following values were found at 25°C: c/(mol 0.00050 0.0010 0.0050 0.010 0.020 0.050 dm-3) R/W 3314 1669 342.1 174.1 89.08 37.14 Find the molar conductance of NaCl at 25°C at infinite dilution from the graph.

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter22: Bulk Electrolysis: Electrogravimetry And Coulometry

Section: Chapter Questions

Problem 22.25QAP

See similar textbooks

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Table 17-1 lists common half-reactions along with the standard reduction potential associated with each half-reaction. These standard reduction potentials are all relative to some standard. What is the standard (zero point)? lf is positive for a half-reaction, what does it mean? If is negative for a half-reaction, what does it mean? Which species in Table 17-1 is most easily reduced? Least easily reduced? The reverse of the half-reactions in Table 17-1 are the oxidation half-reactions. How are standard oxidation potentials determined? In Table 17-1, which species is the best reducing agent? The worst reducing agent? To determine the standard cell potential for a redox reaction, the standard reduction potential is added to the standard oxidation potential. What must be true about this sum if the cell is to be spontaneous (produce a galvanic cell)? Standard reduction and oxidation potentials are intensive. What does this mean? Summarize how line notation is used to describe galvanic cells.
From the standard potentials Tl++eTl(s)E0=0.336V TlCl(s)+eTl(s)+ClE0=0.557V calculate the solubility product constant for TlCl.
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)
What cathode potential (versus SCE) would be required to lower the total Hg(II) concentration of the following solutions to 1.00 10-6 M (assume reaction product in each case is elemental Hg): (a) an aqueous solution of Hg2+? (b) a solution with an equilibrium SCN- concentration of 0.100 M? Hg2+ + 2SCN- Hg(SCN)2(aq) = Kf = 1.8 107 c) a solution with an equilibrium Br- concentration of 0.100 M? HgBr42++ 2e- Hg(l) + 4Br- E0= 0.223 V
The table below lists the cell potentials for the 10 possible galvanic cells assembled from the metals A. B. C. D. and E. and their respective 1.00 M 2+ ions in solution. Using the data in the table, establish a standard reduction potential table similar to Table 17-1 in the text. Assign a reduction potential of 0.00 V to the half-reaction that falls in the middle of the series. You should get two different tables. Explain why, and discuss what you could do to determine which table is correct. A(s)in A2+(aq) B(s)in B2+(aq) C(s)in V2+(aq) D(s)in D2+(aq) E(s)in E2+(aq) 0.28V 0.81V 0.13V 1.00V D(s)in D2+(aq) 0.72V 0.19V 1.13V C(s)in V2+(aq) 0.41V 0.94V B(s)in B2+(aq) 0.53V
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
Consider the reaction low at 25°C: 3SO42(aq)+12H+(aq)+2Cr(s)3SO2(g)+2Cr3+(aq)+6H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 3.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (c) Is the reaction spontaneous at a pH of 8.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M and all gases at 1.00 atm?
In the temperature range 0-90 ºC , the potential difference of the following cell: Pt (s) | H2 (g, f = 1) | HCl (aq, m = 0.1) | AgCl (s) | Ag (s) changes as follows with the temperature: Ecell (V) = 0.35510 – 0.3422x10-4t - 3.2347x10-8t2 + 6.314x10-9t3 (t being the temperature in ºC) Write the reaction and calculate ΔG, ΔH and ΔS at 90 ºC.
In the temperature range 0-90 ºC , the potential difference of the following cell: Pt (s) | H2 (g, f = 1) | HCl (aq, m = 0.1) | AgCl (s) | Ag (s) changes as follows with the temperature: Ecell (V) = 0.35510 – 0.3422x10-4t - 3.2347x10-8t2 + 6.314x10-9t3 (t being the temperature in ºC) Write the reaction and calculate ΔG, ΔH and ΔS at 90 ºC. Result: -34388 J/mol, 10.94 J/Kmol, -30.42 KJ/mol