The nitrosyl ligand (NO) is often studied by Inorganic chemists. Please draw and label each orbital of the MO diagram for the NO ligand and answer the following questions: a. What is the bond order for NO? b. Is NO paramagnetic of diamagnetic? c. Will NO bind to metals at the N or O end of the ligand? Why?

The nitrosyl ligand (NO) is often studied by Inorganic chemists. Please draw and label each orbital of the MO diagram for the NO ligand and answer the following questions: a. What is the bond order for NO? b. Is NO paramagnetic of diamagnetic? c. Will NO bind to metals at the N or O end of the ligand? Why?

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 53AP

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
Which of the following statements is not true? A. Coordination Chemistry is the science concerned with the interactions of organic and inorganic ligands with metal centers. B. Coordination compounds are composed of a metal atom or ion and one or more ligands (atoms, ions, or molecules) that donate electrons to the metal. C. Coordination compounds include organometallic compounds. D. The modern theory of coordination chemistry is based largely on the work of Alfred Werner. E. Coordination compounds are examples of Brønsted-Lowry acid-base adducts.
3. Draw the molecular orbital diagram for octahedral SFs. Treat each F ligand as though it is spherically symmetric (like an H atom) to construct your SALCS. Mix these SALCs (which can start at -20 eV) with the valence s and p orbitals of sulfur (which have energies of -20.7 and -11.6 eV, respectively). Populate your diagram with 12 electrons (S has six valence e and each F interacts through one valence e). Label o, o, and nonbonding M.O.s. Use your diagram to suggest how a molecule can be hypervalent (i.e. contain a main group element that exceeds the octet rule) but still stable. 2
Thiocyanate, SCN- is a fun ligand.Draw the Lewis structure and all of the possible resonance structures List all of the ways you can describe the ligand (*dentate, bridging, etc) Briefly explain which end of (SCN-), S or N, will bond with the following metals:
Why do ligands cause the d orbitals of a transition metal ion to cease being degenerate? A. New molecular orbitals are formed via atomic orbital overlapt B. There is repulsion between the ligands and the d orbitals. C. They destabilize the ion nucleus D. Donation of electrons to the metal ion results in redox chemistry
W, X, Y, and Z are different monodentate ligands.a. Is the square planar [NiWXYZ]2+ optically active?b. Is the tetrahedral [ZnWXYZ]2+ optically active?