Answered: reaction mechanism, synthesis of…

Science

Chemistry

reaction mechanism, synthesis of salicylic acid from methyl salicylate, NaOH and H2SO4

Organic Chemistry

8th Edition

ISBN:9781305580350

Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Publisher:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. Foote

Chapter23: Amines

Section: Chapter Questions

Problem 23.55P: Several diamines are building blocks for the synthesis of pharmaceuticals and agro-chemicals. Show...

See similar textbooks

Related questions

Q: Show work with explanation needed. Don't give Ai generated solution

Q: Show work. don't give Ai generated solution

Q: CHEM 107 Dignam Name Jostine narez veras Module 11-Activity 1: Effective Nuclear Charge, Periodic…

A: Step 1: Step 2: Step 3: Step 4:

Q: Which fossil fuel, methane (natural gas) or carbon (coal) produces the least amount of CO2 per GJ of…

A: #1Step 1: Calculate moles of CO₂ produced per mole of fuel burned:For carbon (coal), burning 1 mole…

Q: Please correct answer and don't used hand raiting

A: Option c: This option is correct or incorrect because ; 3 oxygen gas molecules + 6 hydrogen gas…

Q: 9. Write chemical names for polymers given below: ₤NH-8 POLYMER I Polycaprolactone [CH₂-CH] 0 C=0…

A: The two polymers given are Polycaprolactone (Polymer I) and Poly (vinyl acetate) (Polymer II).

Q: Can u show me which portions, especially on the Oxygen part. Where we have sp2 and sp3 so I am able…

A: Hybridization of atoms:The hybridization atoms are based on the number of lone pairs and bonded…

Q: The rotational and vibrational spectra of molecules are studied in their ground electronic state.…

A: In molecular spectroscopy, the energy levels of molecules are studied. These energy levels are…

Q: Show work with explanation needed...don't give Ai generated solution

A: The compound which can donate proton to another compound is called Bronsted -Lowry acid.The compound…

Q: Consider the reaction Ca(OH) 2 (s) → Ca2+ (aq) + 2 OH- (aq) The reaction occurs at 25°C. For [Ca2+]…

A: The standard free energy change (ΔG°) for a reaction can be calculated using the formula: ΔG° = Σ…

Q: A coffee-cup calorimeter contains 50.0 mL of distilled water at 22.7 degrees Celsius. Solid…

A: The heat absorbed or released by the water can be calculated using the formula: q = m × c × ΔT…

Q: How many moles of C are produced from 2 molmol of A? Express your answer as an integer and include…

Q: How does nitric acid formation occur in the troposphere? Your answer should cite one or more…

A: The troposphere is the lowest layer of Earth's atmosphere and site of all weather on Earth. The…

Q: What is the major organic product obtained from the following sequence of reactions? MCPBA 1.…

A: Step 1:The reactant is an alkene, and the reagent for the first step is mCPBA and Grignard reagent…

Q: Please correct answer and don't used hand raiting

A: Step 1: Given data,At temperature, T1 = 298 KEquilibrium constant K1 = 6.3×105Standard reaction…

Q: Question 1 (0.5 points) The dehydration of cyclohexanol in the presence of an acid catalyst produces…

A: Given:Volume of cyclohexanol = 2.07 mLDensity of cyclohexanol = 0.948 g/mL Plan to solve:We need to…

Q: Please correct answer and don't used hand raiting

A: Step 1:Cs(standard) = 11.1 ppm, Vs = 10 ml, Vt = 50 mlm = 0.03820, b = 0.2412Concentration of Fe3+…

Q: None

Q: Hello, can you help me to solve this and explain me how does pople nomenclature works in NMR? thanks

Q: On the molecule below, highlight the worst leaving group in red and the best leaving group in blue.…

A: Step 1:Properties of an Effective Leaving GroupGood leaving groups are highly electronegative,…

Q: Can you show me im trying to determine which portions are sp2 and sp3 so I can determine where…

Q: Please correct answer and don't use hand rating

Q: A. The electrode of a pH meter is placed in a sample of urine and a reading of 7.9 is obtained. Is…

A: Considering the pH scalepH < 7 (1.00-6.99) ACIDICpH = 7 NEUTRALpH >…

Q: A gas chromatographic peak had a retention time of 730 sec. The base width obtained from…

A: The height equivalent to a theoretical plate H can be calculated using the formula:H=NLwhere:- H =…

Q: 19. Please make sure you answer is correct. Dont use AI

A: Step 1: Step 2: Step 3: Step 4:

Q: 9. Consider the two polymers Nylon 6,10, with the degree of polymerization of 100 and poly(ethyl…

A: The chemical structure of Nylon 6,10 is as follows:[-NH-(CH2)6-CO-(CH2)4-CO-]nWhere n is the degree…

Q: Provide the balanced molecular reaction for each___ Mg + ___ HCl ----->___ MgO + ___ HCl…

A: The balanced molecular reaction is the one in whi

Q: A. % Concentration 1 GIVEN: FIND: APPROACH: 52.3 g of NaCl completed dissolved in 215.6 g solvent %…

A: Step 1: Given,Amount of solute (NaCl) dissolved, w1 = 52.3 gMass of solvent, w2 = 215.6 gTo…

Q: о Concentration 12 10 о Concentration 2 2AB = A2 + B2 Select the graph that represents the change in…

A: Initial Condition:Concentration of [AB] starts at 12 M.Concentration of [A2] and [B2] starts at 0…

Q: Need experts solution only, Don't use chtgpt4 or other AI

A: The standard entropy change for a chemical reaction:ΔSrxno=∑So(products)−∑So(reactants)For the…

Q: Draw the products for the reaction. Include both the major organic product and the inorganic…

A: Step 1:The reactant is a secondary cycloalkyl bromide, and the reagent is a cyanide ion in DMSO…

Q: please help me answer it all. thanks!

A: Step 1: Structural formulaChemical formula which shows the groupings of atoms in a compound. Step 2:…

Q: Please help number 6

A: This elimination reaction involves a strong base, thus a E2 reaction. The E2 reactions in a…

Q: Please correct answer and don't used hand raiting

Q: Show work with structures....

Q: Please correct answer and don't used hand raiting

A: Molecular formula: The chemical formula of the molecule.Structure: A description or image of the…

Q: Please correct answer and don't used hand raiting

A: To determine which substances can readily pass through the inner mitochondrial membrane, let's…

Q: O Answer all parts, please. 6) (10 pts) Provide the bond line structure for the major organic…

Q: Please correct answer and don't used hand raiting

A: 2-methyl-1-butene:In this molecule, the vinylic hydrogens are attached to the carbons of the double…

Q: 1. Provide a multistep synthesis for ONE of the two problems below. You get to choose. If you do…

Q: Which of the following compounds are organometallic compounds. Give the reason. NaOCN, H2CO3, CaCO3,…

A: Approach to solving the question: In order for us to answer this one we need to define first what is…

Q: Question 2 You have a 1.75 M Mg(NO3)2 solution with a density of 1.03 g/mL. If the molar mass of…

Q: Please correct answer and don't used hand raiting

A: Step 1:Calculate moles of acid and base Moles ( H2SO4) = MV(L) M= moles/L = ( 0.5 mol/L)…

Q: Draw the curved arrow mechanism for the reaction indicated in Part 1. If you draw a one-step…

Q: Q3 (10 pts). 1) Under what pH conditions can NO3 be reduced by Fe2+ into NO (via the following…

Q: In molecules, microwave spectra and IR or Raman spectra are used to study the levels of rotation and…

A: In spectroscopy, different techniques are used to study different properties of molecules. Microwave…

Q: 8. Consider the following metabolic reaction: 3-Phosphoglycerate -> 2-Phosphoglycerate What is the…

A: Let me solve this step by step.For this reaction: 3-Phosphoglycerate → 2-PhosphoglycerateWe can use…

Q: Question is attached. thank you

A: Step 1: Step 2: Step 3: Step 4:

Q: Please correct answer and don't use hand rating

A: The reason why ketones 1 and 2 will racemize rapidly is due to the presence of substituents at the…

Question

None

reaction mechanism, synthesis of salicylic acid from methyl salicylate, NaOH and H2SO4

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Similar questions

1) Hydrolysis of Methyl Salicylate: Methyl Salicylate (C8H8O3) + sodium Hydroxide (NaOH) -> sodium Salicylate ( NaC7H5O3) + Methanol (CH3OH) 2) Acidification of Sodium Salicylate: Sodium salicylate (NaC7H5O3) + HCL -> Salicylic acid (C7H603) + sodium chloride (NaCL) Could you find the theoretical yield for me? 2.15g of methyl salicylate was used. 25ml of sodium hydroxide (2m solution) was used for hydrolysis and 2ml of hydrochloric acid was used for the acidification. This produced a yield of 1.53g of salicylic acid.
Calcium carbonate and lactic acid used to prepare Calcium lactate mixture. Whu?
Answer C for the first reagent fill in the blank is incorrect. Answer B for the second reagent fill in the blank is incorrect.
Write the reaction scheme
When trichloroacetaldehyde is dissolved in water, almost all of it is converted to the hydrate. Chloral hydrate, the product of the reaction, is a sedative that can be lethal. A cocktail laced with it is known—in detective novels, at least—as a “Mickey Finn.” Explain why an aqueous solution of trichloroacetaldehyde is almost all hydrate.
I don't get it at all and i struggled. Can you help me? Can you explain to me, please?
1. Write a balanced chemical equation to show the dissociation of Butanoic acid (C3H7COOH). Physical states must be included. 2. When butanoic acid (C3H7COOH) reacts with the strong base potassium hydroxide (KOH), potassium butanoate (C3H7COOK), a salt of the weak acid is formed. Write a balanced chemical equation to show the dissociation of the potassium butanoate (C3H7COOK). Physical states must be included.
hat is the organic product formed in the following reaction? (amine) NH₂ Select one OA II OBI LU CH3 CH, ++ NEN CI 0=N CH, *ON'N NH₂ - HCl(aq) 0°C CH₂ CH, NHẸ NÓI 0
OChem help with IUPAC names involving Ph and Bn The phenyl group (Ph-R, C6H5-R) can be formed by removing a hydrogen from benzene and attaching a substituent to where the hydrogen was removed. The benzyl group (abbv. Bn), similar to the phenyl group, is formed by manipulating the benzene ring. In the case of the benzyl group, it is formed by taking the phenyl group and adding a CH2 group to where the hydrogen was removed. Its molecular fragment can be written as C6H5CH2-R, PhCH2-R, or Bn-R. Please provide the IUPAC name for the following: (Ph)2CHC(CH3)2CC(CH2)3CH(Bn)CHO
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.