Answered: How many moles of C are produced from 2…

How many moles of C are produced from 2 molmol of A? Express your answer as an integer and include the appropriate units.

Chemistry: Matter and Change

1st Edition

ISBN:9780078746376

Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Publisher:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl Wistrom

Chapter11: Stoichiometry

Section: Chapter Questions

Problem 40A

See similar textbooks

Similar questions

3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
Write the balanced chemical equation for the complete combustion of heptene, C7H14. In combustion, hcpLcnc reacts with oxygen to produce carbon dioxide and water. What is the mole ratio that would enable you to calculate the number of moles of oxygen needed to react exactly with a given number of moles of heptene? What mole ratios would you use to calculate how many moles of each product form from a given number of moles of heptene?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
A weighed sample of iron (Fe) is added to liquid bromine (Br2) and allowed to react completely. The reaction produces a single product, which can be isolated and weighed. The experiment was repeated a number of times with different masses of iron but with the same mass of bromine (see graph below). (a) What mass of Br2 is used when the reaction consumes 2.0 g of Fe? (b) What is the mole ratio of Br2 to Fe in the reaction? (c) What is the empirical formula of the product? (d) Write the balanced chemical equation tor the reaction of iron and bromine. (e) What is the name of the reaction product? (f) Which statement or statements best describe the experiments summarized by the graph? (i) When 1.00 g of Fe is added to the Br2, Fe is the limiting reagent. (ii) When 3.50 g of Fe is added to the Br2, there is an excess of Br2. (iii) When 2.50 g of Fe is added to the Br2, both reactanu are used up compietely. (iv) When 2.00 g of Fe is added to the Br2, 10.8 g of product is formed. The percent yield must therefore be 20.0%.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
Consider a reaction represented by the following balanced equation :math>2A+3BC+4D u find that it requires equal masses of A and B so that there are no reactants left over. Which of the following is true? Justify your choice. l type='a'> The molar mass of A must be greater than the molar mass of B. i>The molar mass of A must be less than the molar mass of B. i>The molar mass of A must be the same as the molar mass of B.
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
Classify each of the following statements as true or false: a Coefficients in a chemical equation express the molar proportions among both reactants and products. b A stoichiometry problem can be solved with an unbalanced equation. c In solving a stoichiometry problem, the change from quantity of given substance to quantity of wanted substance is based on masses. d Percentage yield is actual yield expressed as a percentage of ideal yield. e The quantity of product of any reaction can be calculated only through the moles of the limiting reactant. f rH is positive for an endothermic reaction and negative for an exothermic reaction.
The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A at-oms are shown in blue and B atoms in white). The box on the left represents the box on the right shows what is left once the reaction has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Billions of pounds of urea, CO(NH2)2, are produced annually for use as a fertilizer. The principal reaction employed is: 2NH3+CO2CO(NH2)2+H2O By assuming unlimited amounts of CO2, how many moles of urea can be produced from each of the following amounts of NH3? a.2molNH3b.0.45molNH3c.10gNH3d.2.0kgNH3