NH4NO3(s) →NH(aq) + NO3(aq) What is the standard change in free energy in kJ mol at 298.15 K? The heat of formation data are as follows: KJ AH, NH4NO3(s) = -365.6 mol KJ AH, NH+ (aq) = -132.5 mol kJ AH, NO3(aq) = -205.0 mol The standard entropy data are as follows: SNH4NO3(s) = 151.1 SNH: (04) = 113.4 SNO₂ (aq) = 146.4 • Your answer should include two significant figures. Provide your answer below: kJ/mol J mol K J mol K J mol K

NH4NO3(s) →NH(aq) + NO3(aq) What is the standard change in free energy in kJ mol at 298.15 K? The heat of formation data are as follows: KJ AH, NH4NO3(s) = -365.6 mol KJ AH, NH+ (aq) = -132.5 mol kJ AH, NO3(aq) = -205.0 mol The standard entropy data are as follows: SNH4NO3(s) = 151.1 SNH: (04) = 113.4 SNO₂ (aq) = 146.4 • Your answer should include two significant figures. Provide your answer below: kJ/mol J mol K J mol K J mol K

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter17: Chemcial Thermodynamics

Section: Chapter Questions

Problem 17.69QE: What is the sign of the standard Gibbs free-energy change at low temperatures and at high...

See similar textbooks

Similar questions

What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
Chemists and engineers who design nuclear power plants have to worry about high-temperature reactions because it is possible for water to decompose. (a) Under what conditions does this reaction occur spontaneously? 2H2O(g) 2H2(g) + O2(g) (b) Under conditions where the decomposition of water is spontaneous, do nuclear engineers have to worry about an oxygen/hydrogen explosion? Justify your answer.
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the synthesis of ammonia? 3H2(g) + N2(g) 2NH3(g)
Appendix J lists standard molar entropies S, not standard entropies of formation rS. Why is this possible forentropy but not for internal energy, enthalpy, or Gibbsfree energy?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the formation of hydrogen sulfide from the elements? H2(g)+18S8(s)H2S(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
Describe how the standard entropy of hydrogen gas at 25C can be obtained from heat measurements.
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
The standard molar entropy of iodine vapor, I2(g), is 260.7 J Kl mol-1 and the standard molar enthalpy of formation is 62.4 kJ/mol. a) Calculate the entropy change for vaporization of 1 mol of solid iodine (use data from Table 16.1 or Appendix J). b) Calculate the enthalpy change for sublimation of iodine. c) Assuming that rSdoes not change with temperature, estimate the temperature at which iodine would sublime (change directly from solid to gas).
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the decomposition of phosgene? COCl2(g)CO(g)+Cl2(g)