Measurements show that the energy of a mixture of gaseous reactants increases by 285. kJ during a certain chemical reaction, which is carried out at a constant pressure. Furthermore, by carefully monitoring the volume change it is determined that 54. kJ of work is done on the mixture during the reaction. Calculate the change in enthalpy of the gas mixture during the reaction. Round your answer to 3 significant digits. Is the reaction exothermic or endothermic? OkJ exothermic endothermic 5 ?

Measurements show that the energy of a mixture of gaseous reactants increases by 285. kJ during a certain chemical reaction, which is carried out at a constant pressure. Furthermore, by carefully monitoring the volume change it is determined that 54. kJ of work is done on the mixture during the reaction. Calculate the change in enthalpy of the gas mixture during the reaction. Round your answer to 3 significant digits. Is the reaction exothermic or endothermic? OkJ exothermic endothermic 5 ?

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter5: Principles Of Chemical Reactivity: Energy And Chemical Reactions

Section: Chapter Questions

Problem 31PS: A volume of 1.50 L of argon gas is confined in a cylinder with a movable piston under a constant...

See similar textbooks

Similar questions

The enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.
Under what circumstances is the heat of a process equal to the enthalpy change for the process?
The formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
The standard enthalpies of formation of KNO3(s) and K2S(s) are 494.6 kJ/mol and 376.6 kJ/mol, respectively. a. Determine the standard enthalpy change for the reaction of black powder according to the balanced equation on the previous page. b. Determine the enthalpy change that occurs when 1.00 g of black powder decomposes according to the stoichiometry of the balanced equation above. (Even though black powder is a mixture, assume that we can designate 1 mol of black powder as consisting of exactly 2 mol of KNO3, 3 mol of C, and 1 mol of S.)
Calculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.
An industrial process for manufacturing sulfuric acid, H2SO4, uses hydrogen sulfide, H2S, from the purification of natural gas. In the first step of this process, the hydrogen sulfide is burned to obtain sulfur dioxide, SO2. 2H2S(g)+3O2(g)2H2O(l)+2SO2(g);H=1124kJ The density of sulfur dioxide at 25C and 1.00 atm is 2.62 g/L, and the molar heat capacity is 30.2 J/(mol C). (a) How much heat would be evolved in producing 1.00 L of SO2 at 25C and 1.00 atm? (b) Suppose heat from this reaction is used to heat 1.00 L of the SO2 from 25C to 500C for its use in the next step of the process. What percentage of the heat evolved is required for this?
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
A sample of benzene, C6H6, weighing 3.51 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 37.18C. If the heat capacity of the calorimeter and contents was 12.05 kJ/C, what is the value of q for burning 1.00 mol of benzene at constant volume and 25.00C? The reaction is C6H6(l)+152O2(g)6CO2(g)+3H2O(l) Is q equal to U or H?
Given the following thermochemical equations: 4B(s)+3O2(g)2B2O3(s)H=2543.8kJ H2(g)+12 O2(g)H2O(g)H=241.8kJ B2H6(s)+3O2B2O3(s)+3H2O(g)H=2032.9kJ Calculate H for the decomposition of B2H6 into its elements.
9.41 Under what conditions does the enthalpy change equal the heat of a process?