HỌ5.47 Homework Unanswered The combustion reaction of nitromethane fuel occurs as follows: 2 CH3 NO2 (1) + 3/2 O2(g) → 2 CO₂(g) + 3 H₂O(l) + N₂ (g) The standard enthalpy of this reaction is -1418 kJ. What is the standard enthalpy of formation of nitromethane in kJ/mol? Respond with the correct number of significant figures in scientific notation (Use E notation and only 1 digit before decimal e.g. 2.5E5 for 2.5 x 105) Type your numeric answer and submit * Unanswered. 3 attempts left Submit

HỌ5.47 Homework Unanswered The combustion reaction of nitromethane fuel occurs as follows: 2 CH3 NO2 (1) + 3/2 O2(g) → 2 CO₂(g) + 3 H₂O(l) + N₂ (g) The standard enthalpy of this reaction is -1418 kJ. What is the standard enthalpy of formation of nitromethane in kJ/mol? Respond with the correct number of significant figures in scientific notation (Use E notation and only 1 digit before decimal e.g. 2.5E5 for 2.5 x 105) Type your numeric answer and submit * Unanswered. 3 attempts left Submit

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter9: Energy And Chemistry

Section: Chapter Questions

Problem 9.53PAE: 9.53 Using these reactions, find the standard enthalpy change for the formation of 1 mol of PhO(s)...

See similar textbooks

Similar questions

A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
The complete combustion of acetylene, C2H2(g), produces 1300. kJ of energy per mole of acetylene consumed. How many grams of acetylene must be burned to produce enough heat to raise the temperature of 1.00 gal water by 10.0c if the process is 80.0% efficient? Assume the density of water is 1.00 g/cm3
Ethylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJ
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
A sample of sucrose, C12H22O11, is contaminated by sodium chloride. When the contaminated sample is burned in a bomb calorimeter, sodium chloride does not burn. What is the percentage of sucrose in the sample if a temperature increase of 1.67C is observed when 3.000 g of the sample are burned in the calorimeter? Sucrose gives off 5.64103kJ/mol when burned. The heat capacity of the calorimeter and water is 22.51 kJ/C.
Salicylic acid, C7H6O3, is one of the starting materials in the manufacture of aspirin. When 1.00 g of salicylic acid burns in a bomb calorimeter, the temperature of the bomb and water goes from 23.11C to 28.91C. The calorimeter and water absorb 21.9 kJ of heat. How much heat is given off when one mole of salicylic acid burns?
Combustion of table sugar produces CO2(g) and H2O( l). When 1.46 g table sugar is combusted in a constant-volume (bomb) calorimeter, 24.00 kJ of heat is liberated. a. Assuming that table sugar is pure sucrose, C12H22O11 (s), write the balanced equation for the combustion reaction. b. Calculate E in kJ/mol C12H22O11 for the combustion reaction of sucrose.
Methanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of combustion per gram of liquid methanol, and compare this answer to that for ethanol in Exercise 87.
The combustion of 1.00 mol liquid methyl alcohol (CH3OH) in excess oxygen is exothermic, giving 727 kJ of heat. (a) Write the thermochemical equation for this reaction. (b) Calculate the enthalpy change that accompanies the burning 10.0 g methanol. (c) Compare this with the amount of heat produced by 10.0 g octane, C8H18, a component of gasoline (see Exercise 5.41).
Hydrogen sulfide, H2S, is a foul-smelling gas. It burns to form sulfur dioxide. 2H2S(g)+3O2(g)2SO2(g)+2H2O(g);H=1036kJ Calculate the enthalpy change to burn 27.4 g of hydrogen sulfide.
When a 0.740-g sample of trinitrotoluene (TNT), C7H5N2O6, is burned in a bomb calorimeter, the temperature increases from 23.4 C to 26.9 C. The heat capacity of the calorimeter is 534 J/C, and it contains 675 mL of water. How much heat was produced by the combustion of the TNT sample?
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.